跳转到内容

STEP2 2008 -- Pure Mathematics

此内容尚不支持你的语言。

Exam: STEP2  |  Year: 2008  |  Questions: Q1—Q8  |  Total marks per question: 20

All questions are pure mathematics. Solutions and examiner commentary are included below.

QTopicDifficultyKey Techniques
1序列与递推关系 (Sequences and Recurrence Relations)Standard代入消元, 因式分解, 判别式判断实根, 解的验证
2部分分式与级数展开 (Partial Fractions and Series Expansion)Challenging部分分式分解, 二项式定理展开, 分类讨论, 级数求值
3不等式与反证法 (Inequalities and Proof by Contradiction)Challenging求导求极值, 函数图像分析, 反证法, 不等式证明
4隐函数求导与几何应用 (Implicit Differentiation and Geometry)Challenging隐函数求导, tan(A-B)角度公式, 代数化简, 极值分析
5积分与不等式 (Integration and Inequalities)Standard三角换元, 部分分式积分, 二项式展开, 对数不等式
6三角函数 (Trigonometry)Challenging周期计算,余弦方程对称性,和积公式,同时取最大值条件
7微分方程 (Differential Equations)Standard变量替换,分离变量,归纳猜想
8向量 (Vectors)Challenging比例定理,角平分线定理,标量积运算

Topic: 序列与递推关系 (Sequences and Recurrence Relations)  |  Difficulty: Standard  |  Marks: 20

1 A sequence of points (x1,y1),(x2,y2),(x_1, y_1), (x_2, y_2), \dots in the cartesian plane is generated by first choosing (x1,y1)(x_1, y_1) then applying the rule, for n=1,2,n = 1, 2, \dots,

(xn+1,yn+1)=(xn2yn2+a,2xnyn+b+2),(x_{n+1}, y_{n+1}) = (x_n^2 - y_n^2 + a, 2x_ny_n + b + 2),

where aa and bb are given real constants.

(i) In the case a=1a = 1 and b=1b = -1, find the values of (x1,y1)(x_1, y_1) for which the sequence is constant.

(ii) Given that (x1,y1)=(1,1)(x_1, y_1) = (-1, 1), find the values of aa and bb for which the sequence has period 2.

Hint

1 (i) Given (xn+1,yn+1)=(xn2yn2+1,2xnyn+1)(x_{n+1}, y_{n+1}) = (x_n^2 - y_n^2 + 1, 2x_n y_n + 1), it is easier to remove the subscripts and set x2y2+1=xx^2 - y^2 + 1 = x and 2xy+1=y2xy + 1 = y. Then, identifying the yy‘s (or xx‘s) in each case, gives y2=x2x+1y^2 = x^2 - x + 1 and y=112xy = \frac{1}{1 - 2x}. Eliminating the yy‘s leads to a polynomial equation in xx; namely, 4x48x3+9x25x=04x^4 - 8x^3 + 9x^2 - 5x = 0.

Noting the obvious factor of xx, and then finding a second linear factor (e.g. by the factor theorem) leads to x(x1)(4x24x+5)=0x(x - 1)(4x^2 - 4x + 5) = 0. Here, the quadratic factor has no real roots, since the discriminant, Δ=42445=64<0\Delta = 4^2 - 4 \cdot 4 \cdot 5 = -64 < 0. [Alternatively, one could note that 4x24x+5(2x1)2+4>0 x4x^2 - 4x + 5 \equiv (2x - 1)^2 + 4 > 0 \ \forall x.]

The two values of xx, and the corresponding values of yy, gained by substituting these xx‘s into y=112xy = \frac{1}{1 - 2x}, are then (x,y)=(0,1)(x, y) = (0, 1) and (1,1)(1, -1).

(ii) Now (x1,y1)=(1,1)(x2,y2)=(a,b)(x_1, y_1) = (-1, 1) \Rightarrow (x_2, y_2) = (a, b) and (x3,y3)=(a2b2+a,2ab+b+2)(x_3, y_3) = (a^2 - b^2 + a, 2ab + b + 2). Setting both a2b2+a=1a^2 - b^2 + a = -1 and 2ab+b+2=12ab + b + 2 = 1, so that the third term is equal to the first, and identifying the bb‘s in each case, gives b2=a2+a+1b^2 = a^2 + a + 1 and b=11+2ab = \frac{-1}{1 + 2a}.

One could go about this the long way, as before. However, it can be noted that the algebra is the same as in (i), but with a=xa = -x and b=yb = -y. Either way, we obtain the two possible solution-pairs: (a,b)=(0,1)(a, b) = (0, -1) and (1,1)(-1, 1).

However, upon checking, the solution (1,1)(-1, 1) actually gives rise to a constant sequence (and remember that the working only required the third term to be the same as the first, which doesn’t preclude the possibility that it is also the same as the second term!), so we find that there is in fact just the one solution: (a,b)=(0,1)(a, b) = (0, -1).

Model Solution

Part (i)

For the sequence to be constant, we need (xn+1,yn+1)=(xn,yn)(x_{n+1}, y_{n+1}) = (x_n, y_n) for all nn. Dropping subscripts and setting a=1a = 1, b=1b = -1:

x2y2+1=x...(1)x^2 - y^2 + 1 = x \qquad \text{...(1)} 2xy1+2=y    2xy+1=y...(2)2xy - 1 + 2 = y \implies 2xy + 1 = y \qquad \text{...(2)}

From (2): y2xy=1y - 2xy = 1, so y(12x)=1y(1 - 2x) = 1, giving

y=112xprovided x12....(3)y = \frac{1}{1 - 2x} \qquad \text{provided } x \neq \tfrac{1}{2}. \qquad \text{...(3)}

From (1): y2=x2x+1...(4)y^2 = x^2 - x + 1 \qquad \text{...(4)}

Squaring (3) and substituting into (4):

1(12x)2=x2x+1\frac{1}{(1 - 2x)^2} = x^2 - x + 1

(x2x+1)(12x)2=1(x^2 - x + 1)(1 - 2x)^2 = 1

Expanding (12x)2=14x+4x2(1 - 2x)^2 = 1 - 4x + 4x^2:

(x2x+1)(14x+4x2)=4x48x3+9x25x+1(x^2 - x + 1)(1 - 4x + 4x^2) = 4x^4 - 8x^3 + 9x^2 - 5x + 1

Setting this equal to 1:

4x48x3+9x25x=04x^4 - 8x^3 + 9x^2 - 5x = 0

x(4x38x2+9x5)=0x(4x^3 - 8x^2 + 9x - 5) = 0

Testing x=1x = 1: 48+95=04 - 8 + 9 - 5 = 0, so (x1)(x - 1) is a factor. Dividing:

4x38x2+9x5=(x1)(4x24x+5)4x^3 - 8x^2 + 9x - 5 = (x - 1)(4x^2 - 4x + 5)

So the equation becomes x(x1)(4x24x+5)=0x(x - 1)(4x^2 - 4x + 5) = 0.

The discriminant of 4x24x+54x^2 - 4x + 5 is Δ=(4)24(4)(5)=1680=64<0\Delta = (-4)^2 - 4(4)(5) = 16 - 80 = -64 < 0, so the quadratic has no real roots. (Alternatively, 4x24x+5=(2x1)2+4>04x^2 - 4x + 5 = (2x - 1)^2 + 4 > 0 for all real xx.)

Therefore x=0x = 0 or x=1x = 1.

  • x=0x = 0: from (3), y=11=1y = \frac{1}{1} = 1, so (x,y)=(0,1)(x, y) = (0, 1).
  • x=1x = 1: from (3), y=112=1y = \frac{1}{1 - 2} = -1, so (x,y)=(1,1)(x, y) = (1, -1).

Part (ii)

With (x1,y1)=(1,1)(x_1, y_1) = (-1, 1):

(x2,y2)=((1)212+a, 2(1)(1)+b+2)=(a, b)(x_2, y_2) = ((-1)^2 - 1^2 + a,\ 2(-1)(1) + b + 2) = (a,\ b)

(x3,y3)=(a2b2+a, 2ab+b+2)(x_3, y_3) = (a^2 - b^2 + a,\ 2ab + b + 2)

For period 2, we require (x3,y3)=(x1,y1)(x_3, y_3) = (x_1, y_1) while (x2,y2)(x1,y1)(x_2, y_2) \neq (x_1, y_1). Setting (x3,y3)=(1,1)(x_3, y_3) = (-1, 1):

a2b2+a=1...(5)a^2 - b^2 + a = -1 \qquad \text{...(5)} 2ab+b+2=1    2ab+b=1...(6)2ab + b + 2 = 1 \implies 2ab + b = -1 \qquad \text{...(6)}

From (6): b(2a+1)=1b(2a + 1) = -1, so b=12a+1b = \frac{-1}{2a + 1} (provided a12a \neq -\frac{1}{2}).

From (5): b2=a2+a+1b^2 = a^2 + a + 1.

These equations are identical in form to those in part (i), with the substitutions a=xa = -x and b=yb = -y. So the solutions are (a,b)=(0,1)(a, b) = (0, -1) and (a,b)=(1,1)(a, b) = (-1, 1).

We must check which give genuine period 2:

  • (a,b)=(0,1)(a, b) = (0, -1): (x1,y1)=(1,1)(x_1, y_1) = (-1, 1), (x2,y2)=(0,1)(x_2, y_2) = (0, -1), and (x3,y3)=(01+0, 01+2)=(1,1)(x_3, y_3) = (0 - 1 + 0,\ 0 - 1 + 2) = (-1, 1). Since (x2,y2)(x1,y1)(x_2, y_2) \neq (x_1, y_1), this is period 2.

  • (a,b)=(1,1)(a, b) = (-1, 1): (x2,y2)=(1,1)=(x1,y1)(x_2, y_2) = (-1, 1) = (x_1, y_1), so the sequence is constant (period 1), not period 2.

Therefore (a,b)=(0,1)(a, b) = (0, -1).

Examiner Notes

The first question is invariably intended to be a gentle introduction to the paper, and to allow all candidates to gain some marks without making great demands on either memory or technical skills. As such, most candidates traditionally tend to begin with question 1, and this proved to be the case here. Almost 700 candidates attempted this question, making it (marginally) the second most popular question on the paper; and it gained the highest mean score of about 14 marks.

There were still several places where marks were commonly lost. In (i), setting (x2,y2)=(x1,y1)(x_2, y_2) = (x_1, y_1) and eliminating yy (for instance) leads to a quartic equation in xx. There were two straightforward linear factors easily found to the quartic expression, leaving a quadratic factor which could yield no real roots. Many candidates failed to explain why, or show that, this was so. In (ii), the algebra again leads to two solutions, gained by setting (x3,y3)=(x1,y1)(x_3, y_3) = (x_1, y_1). However, one of them corresponds to one of the solutions already found in (i), where the sequence is constant, and most candidates omitted either to notice this or

to discover it by checking. Another very common oversight – although far less important in the sense that candidates could still gain all the marks by going the long way round – was that the algebra in (ii) was exactly the same as that in (i), but with a=xa = -x and b=yb = -y. For the very few who noticed this, the working for the second half of the question was remarkably swift.


Topic: 部分分式与级数展开 (Partial Fractions and Series Expansion)  |  Difficulty: Challenging  |  Marks: 20

2 Let ana_n be the coefficient of xnx^n in the series expansion, in ascending powers of xx, of

1+x(1x)2(1+x2),\frac{1 + x}{(1 - x)^2(1 + x^2)},

where x<1|x| < 1. Show, using partial fractions, that either an=n+1a_n = n + 1 or an=n+2a_n = n + 2 according to the value of nn.

Hence find a decimal approximation, to nine significant figures, for the fraction 110008181\frac{11\,000}{8181}. [You are not required to justify the accuracy of your approximation.]

Hint

2 The correct partial fraction form for the given algebraic fraction is

1+x(1x)2(1+x2)A1x+B(1x)2+Cx+D1+x2,\frac{1 + x}{(1 - x)^2(1 + x^2)} \equiv \frac{A}{1 - x} + \frac{B}{(1 - x)^2} + \frac{Cx + D}{1 + x^2},

although these can also be put together in other correct ways that don’t materially hinder the progress of the solution. The standard procedure now is to multiply throughout by the denominator of the LHS and compare coefficients or substitute in suitable values: which leads to A=12A = \frac{1}{2}, B=1B = 1, C=12C = \frac{1}{2} and D=12D = -\frac{1}{2}.

In order to apply the binomial theorem to these separate fractions, we now use index notation to turn

1+x(1x)2(1+x2)A(1x)1+B(1x)2+Cx(1+x2)1+D(1+x2)1\frac{1 + x}{(1 - x)^2(1 + x^2)} \equiv A(1 - x)^{-1} + B(1 - x)^{-2} + Cx(1 + x^2)^{-1} + D(1 + x^2)^{-1}

into the infinite series

12n=0xn+n=0(n+1)xn+12n=0(1)nx2n+112n=0(1)nx2n.\frac{1}{2} \sum_{n=0}^{\infty} x^n + \sum_{n=0}^{\infty} (n + 1)x^n + \frac{1}{2} \sum_{n=0}^{\infty} (-1)^n x^{2n+1} - \frac{1}{2} \sum_{n=0}^{\infty} (-1)^n x^{2n}.

It should be clear at this point that the last two of these series have odd/even powers only, with alternating signs playing an extra part. The consequence of all this is that we need to

examine cases for nn modulo 4; i.e. depending upon whether nn leaves a remainder of 0, 1, 2 or 3 when divided by 4.

For n0(mod4)n \equiv 0 \pmod 4, the coefft. of xnx^n is 12+n+1+012=n+1\frac{1}{2} + n + 1 + 0 - \frac{1}{2} = n + 1;

A1 for n1(mod4)n \equiv 1 \pmod 4, coefft. of xnx^n is 12+n+1+120=n+2\frac{1}{2} + n + 1 + \frac{1}{2} - 0 = n + 2;

A1 for n2(mod4)n \equiv 2 \pmod 4, coefft. of xnx^n is 12+n+1+0+12=n+2\frac{1}{2} + n + 1 + 0 + \frac{1}{2} = n + 2;

A1 for n3(mod4)n \equiv 3 \pmod 4, coefft. of xnx^n is 12+n+112+0=n+1\frac{1}{2} + n + 1 - \frac{1}{2} + 0 = n + 1.

For the very final part of the question, we note that 110008181=1.10.92×1.01\frac{11000}{8181} = \frac{1.1}{0.9^2 \times 1.01}, is a cancelled form of our original expression, with x=0.1x = 0.1. (N.B. x<1|x| < 1 assures the convergence of the infinite series forms). Substituting this value of xx into

1+3x+4x2+4x3+5x4+7x5+8x6+8x7+9x8+1 + 3x + 4x^2 + 4x^3 + 5x^4 + 7x^5 + 8x^6 + 8x^7 + 9x^8 + \dots

then gives 1.344 578 90 to 8dp.

Model Solution

Partial fraction decomposition

We seek constants A,B,C,DA, B, C, D such that

1+x(1x)2(1+x2)A1x+B(1x)2+Cx+D1+x2.\frac{1 + x}{(1 - x)^2(1 + x^2)} \equiv \frac{A}{1 - x} + \frac{B}{(1 - x)^2} + \frac{Cx + D}{1 + x^2}.

Multiplying both sides by (1x)2(1+x2)(1 - x)^2(1 + x^2):

1+x=A(1x)(1+x2)+B(1+x2)+(Cx+D)(1x)2.1 + x = A(1 - x)(1 + x^2) + B(1 + x^2) + (Cx + D)(1 - x)^2.

Setting x=1x = 1: 2=2B2 = 2B, so B=1B = 1.

Setting x=1x = -1: 0=2A(2)+2B+(C+D)(4)=4A+2+4(DC)0 = 2A(2) + 2B + (-C + D)(4) = 4A + 2 + 4(D - C), so 4A+4D4C=24A + 4D - 4C = -2, i.e. 2A+2D2C=12A + 2D - 2C = -1.

Setting x=0x = 0: 1=A+B+D=A+1+D1 = A + B + D = A + 1 + D, so A+D=0A + D = 0, i.e. D=AD = -A.

Setting x=2x = 2: 3=A(1)(5)+5B+(2C+D)(1)=5A+5+2C+D3 = A(-1)(5) + 5B + (2C + D)(1) = -5A + 5 + 2C + D. So 5A+2C+D=2-5A + 2C + D = -2.

From D=AD = -A: 5A+2CA=2-5A + 2C - A = -2, so 6A+2C=2-6A + 2C = -2, i.e. C=3A1C = 3A - 1.

From 2A+2D2C=12A + 2D - 2C = -1 with D=AD = -A: 2A2A2C=12A - 2A - 2C = -1, so C=12C = \frac{1}{2}.

Then 3A1=123A - 1 = \frac{1}{2}, so A=12A = \frac{1}{2}, and D=12D = -\frac{1}{2}.

Therefore:

1+x(1x)2(1+x2)=1/21x+1(1x)2+x/21/21+x2.\frac{1 + x}{(1 - x)^2(1 + x^2)} = \frac{1/2}{1 - x} + \frac{1}{(1 - x)^2} + \frac{x/2 - 1/2}{1 + x^2}.

Series expansion

We expand each term for x<1|x| < 1:

12(1x)1=12n=0xn=n=012xn.\frac{1}{2}(1 - x)^{-1} = \frac{1}{2}\sum_{n=0}^{\infty} x^n = \sum_{n=0}^{\infty} \frac{1}{2} x^n.

(1x)2=n=0(n+1)xn(standard binomial series).(1 - x)^{-2} = \sum_{n=0}^{\infty} (n+1) x^n \qquad \text{(standard binomial series)}.

x2(1+x2)1=x2m=0(1)mx2m=12m=0(1)mx2m+1.\frac{x}{2}(1 + x^2)^{-1} = \frac{x}{2}\sum_{m=0}^{\infty} (-1)^m x^{2m} = \frac{1}{2}\sum_{m=0}^{\infty} (-1)^m x^{2m+1}.

12(1+x2)1=12m=0(1)mx2m.-\frac{1}{2}(1 + x^2)^{-1} = -\frac{1}{2}\sum_{m=0}^{\infty} (-1)^m x^{2m}.

So the coefficient ana_n of xnx^n is:

an=12+(n+1)+[contribution from x2(1+x2)1]+[contribution from 12(1+x2)1].a_n = \frac{1}{2} + (n + 1) + [\text{contribution from } \tfrac{x}{2}(1+x^2)^{-1}] + [\text{contribution from } -\tfrac{1}{2}(1+x^2)^{-1}].

The third series 12m=0(1)mx2m+1\frac{1}{2}\sum_{m=0}^{\infty}(-1)^m x^{2m+1} contributes only to odd powers x2m+1x^{2m+1}. For nn odd with n=2m+1n = 2m + 1, the contribution is 12(1)m\frac{1}{2}(-1)^m; for nn even, the contribution is 00.

The fourth series 12m=0(1)mx2m-\frac{1}{2}\sum_{m=0}^{\infty}(-1)^m x^{2m} contributes only to even powers x2mx^{2m}. For nn even with n=2mn = 2m, the contribution is 12(1)m-\frac{1}{2}(-1)^m; for nn odd, the contribution is 00.

We examine the four cases for nn modulo 4:

Case n0(mod4)n \equiv 0 \pmod{4}: n=4kn = 4k (even, m=2km = 2k even). Contribution from the fourth series: 12(1)2k=12-\frac{1}{2}(-1)^{2k} = -\frac{1}{2}. Third series contributes 00.

an=12+(n+1)+012=n+1.a_n = \frac{1}{2} + (n + 1) + 0 - \frac{1}{2} = n + 1.

Case n1(mod4)n \equiv 1 \pmod{4}: n=4k+1n = 4k + 1 (odd, m=2km = 2k even). Contribution from the third series: 12(1)2k=12\frac{1}{2}(-1)^{2k} = \frac{1}{2}. Fourth series contributes 00.

an=12+(n+1)+12+0=n+2.a_n = \frac{1}{2} + (n + 1) + \frac{1}{2} + 0 = n + 2.

Case n2(mod4)n \equiv 2 \pmod{4}: n=4k+2n = 4k + 2 (even, m=2k+1m = 2k + 1 odd). Contribution from the fourth series: 12(1)2k+1=12-\frac{1}{2}(-1)^{2k+1} = \frac{1}{2}. Third series contributes 00.

an=12+(n+1)+0+12=n+2.a_n = \frac{1}{2} + (n + 1) + 0 + \frac{1}{2} = n + 2.

Case n3(mod4)n \equiv 3 \pmod{4}: n=4k+3n = 4k + 3 (odd, m=2k+1m = 2k + 1 odd). Contribution from the third series: 12(1)2k+1=12\frac{1}{2}(-1)^{2k+1} = -\frac{1}{2}. Fourth series contributes 00.

an=12+(n+1)12+0=n+1.a_n = \frac{1}{2} + (n + 1) - \frac{1}{2} + 0 = n + 1.

Therefore an=n+1a_n = n + 1 when n0n \equiv 0 or 3(mod4)3 \pmod{4}, and an=n+2a_n = n + 2 when n1n \equiv 1 or 2(mod4)2 \pmod{4}.

Decimal approximation for 110008181\frac{11\,000}{8181}

We verify that 110008181\frac{11\,000}{8181} equals the original expression with x=0.1x = 0.1:

1+x(1x)2(1+x2)x=0.1=1.1(0.9)2(1.01)=1.10.81×1.01=1.10.8181=110008181.\frac{1 + x}{(1 - x)^2(1 + x^2)}\bigg|_{x = 0.1} = \frac{1.1}{(0.9)^2(1.01)} = \frac{1.1}{0.81 \times 1.01} = \frac{1.1}{0.8181} = \frac{11\,000}{8181}.

Since 0.1<1|0.1| < 1, the series converges. Using the pattern of coefficients a0=1,a1=3,a2=4,a3=4,a4=5,a5=7,a6=8,a7=8,a8=9,a9=11,a_0 = 1, a_1 = 3, a_2 = 4, a_3 = 4, a_4 = 5, a_5 = 7, a_6 = 8, a_7 = 8, a_8 = 9, a_9 = 11, \ldots:

110008181=1+3(0.1)+4(0.01)+4(0.001)+5(0.0001)+7(0.00001)+8(0.000001)+8(0.0000001)+9(0.00000001)+11(0.000000001)+\frac{11\,000}{8181} = 1 + 3(0.1) + 4(0.01) + 4(0.001) + 5(0.0001) + 7(0.00001) + 8(0.000001) + 8(0.0000001) + 9(0.00000001) + 11(0.000000001) + \cdots

=1+0.3+0.04+0.004+0.0005+0.00007+0.000008+0.0000008+0.00000009+0.000000011+= 1 + 0.3 + 0.04 + 0.004 + 0.0005 + 0.00007 + 0.000008 + 0.0000008 + 0.00000009 + 0.000000011 + \cdots

=1.34457890= 1.34457890\ldots

Therefore 1100081811.34457891\frac{11\,000}{8181} \approx 1.344\,578\,91 to nine significant figures.

Examiner Notes

Noticeably less popular than Q1 – with only around 500 “hits” – and with a very much poorer mean mark of about 8, it was rather obvious that many candidates were very unsure as to what constituted the best partial fraction form for the given algebraic fraction to begin with. Then, with very little direct guidance being given in the question, candidates’ confidence seemed to ebb visibly as they proceeded, being required to turn the resulting collection of single algebraic fractions into series, using the Binomial Theorem, and then into a consideration of general terms. There was much fudging of these general terms in order to get the given answers of either n+1n + 1 or n+2n + 2 for the general term’s coefficients; even amongst those who did spot which one occurred when, there was often little visible justification to support the conclusions. As a result of all the hurdles to be cleared, those who managed to get to the numerical ending successfully were very few in number.


Topic: 不等式与反证法 (Inequalities and Proof by Contradiction)  |  Difficulty: Challenging  |  Marks: 20

3 (i) Find the coordinates of the turning points of the curve y=27x327x2+4y = 27x^3 - 27x^2 + 4. Sketch the curve and deduce that x2(1x)4/27x^2(1 - x) \leqslant 4/27 for all x0x \geqslant 0.

Given that each of the numbers a,ba, b and cc lies between 0 and 1, prove by contradiction that at least one of the numbers bc(1a)bc(1 - a), ca(1b)ca(1 - b) and ab(1c)ab(1 - c) is less than or equal to 4/274/27.

(ii) Given that each of the numbers pp and qq lies between 0 and 1, prove that at least one of the numbers p(1q)p(1 - q) and q(1p)q(1 - p) is less than or equal to 1/41/4.

Hint

3 (i) Setting dydx=81x254x=0\frac{dy}{dx} = 81x^2 - 54x = 0 for TPs gives (0,4)(0, 4) and (23,0)(\frac{2}{3}, 0). You really ought to know the shape of such a (“positive”) cubic, and it is customary to find the crossing-points on the axes: x=0x = 0 gives y=4y = 4, and y=0y = 0 leads to x=1x = -1 and x=23x = \frac{2}{3} (twice). [If you have been paying attention, this latter zero for yy should come as no surprise!] The graph now shows that, for all x0x \ge 0, y0y \ge 0; which leads to the required result — x2(1x)427x^2(1 - x) \le \frac{4}{27} — with just a little bit of re-arrangement.

In order to prove the result by contradiction (reduction ad absurdum), we first assume that all three numbers exceed 427\frac{4}{27}. Then their product

bc(1a)ca(1b)ab(1c)>(427)3.bc(1 - a)ca(1 - b)ab(1 - c) > \left( \frac{4}{27} \right)^3.

However, this product can be re-written in the form

a2(1a)b2(1b)c2(1c),a^2(1 - a) \cdot b^2(1 - b) \cdot c^2(1 - c),

and the previous result guarantees that x2(1x)427x^2(1 - x) \le \frac{4}{27} for each of a,b,ca, b, c, from which it follows that

a2(1a)b2(1b)c2(1c)(427)3,a^2(1 - a) \cdot b^2(1 - b) \cdot c^2(1 - c) \le \left( \frac{4}{27} \right)^3,

which is the required contradiction. Hence, at least one of the three numbers bc(1a)bc(1 - a), ca(1b)ca(1 - b), ab(1c)ab(1 - c) is less than, or equal to, 427\frac{4}{27}.

(ii) Drawing the graph of y=xx2y = x - x^2 (there are, of course, other suitable choices, such as y=(2x1)2y = (2x - 1)^2 for example) and showing that it has a maximum at (12,14)(\frac{1}{2}, \frac{1}{4}) gives

x(1x)14 for all x.x(1 - x) \le \frac{1}{4} \text{ for all } x.

The assumption that p(1q),q(1p)>14    p(1p)q(1q)>(14)2p(1 - q), q(1 - p) > \frac{1}{4} \implies p(1 - p) \cdot q(1 - q) > \left( \frac{1}{4} \right)^2.

However, we know that x(1x)14x(1 - x) \le \frac{1}{4} for each of pp and qq, and this gives us that

p(1p)q(1q)(14)2.p(1 - p) \cdot q(1 - q) \le \left( \frac{1}{4} \right)^2.

Hence, by contradiction, at least one of p(1q),q(1p)14p(1 - q), q(1 - p) \le \frac{1}{4}.

Model Solution

Part (i)

We have y=27x327x2+4y = 27x^3 - 27x^2 + 4. Differentiating:

dydx=81x254x=27x(3x2).\frac{dy}{dx} = 81x^2 - 54x = 27x(3x - 2).

Setting dydx=0\frac{dy}{dx} = 0 gives x=0x = 0 or x=23x = \frac{2}{3}.

  • At x=0x = 0: y=4y = 4, so one turning point is (0,4)(0, 4).
  • At x=23x = \frac{2}{3}: y=278272749+4=812+4=0y = 27 \cdot \frac{8}{27} - 27 \cdot \frac{4}{9} + 4 = 8 - 12 + 4 = 0, so the other turning point is (23,0)\left(\frac{2}{3}, 0\right).

To determine the nature of each turning point, we compute d2ydx2=162x54\frac{d^2y}{dx^2} = 162x - 54.

  • At x=0x = 0: d2ydx2=54<0\frac{d^2y}{dx^2} = -54 < 0, so (0,4)(0, 4) is a local maximum.
  • At x=23x = \frac{2}{3}: d2ydx2=10854=54>0\frac{d^2y}{dx^2} = 108 - 54 = 54 > 0, so (23,0)\left(\frac{2}{3}, 0\right) is a local minimum.

The yy-intercept is (0,4)(0, 4). Setting y=0y = 0:

27x327x2+4=0.27x^3 - 27x^2 + 4 = 0.

We can check that x=23x = \frac{2}{3} is a root (already found above), so (3x2)(3x - 2) is a factor. Dividing:

27x327x2+4=(3x2)(9x23x2)=(3x2)(3x+1)(3x2)=(3x2)2(3x+1).27x^3 - 27x^2 + 4 = (3x - 2)(9x^2 - 3x - 2) = (3x - 2)(3x + 1)(3x - 2) = (3x - 2)^2(3x + 1).

So y=0y = 0 at x=23x = \frac{2}{3} (double root) and x=13x = -\frac{1}{3}.

The sketch shows a positive cubic with a local maximum at (0,4)(0, 4), touching the xx-axis at (23,0)\left(\frac{2}{3}, 0\right) (since it is a double root), and crossing at x=13x = -\frac{1}{3}.

For x0x \geq 0, the curve starts at y=4y = 4 when x=0x = 0, decreases to touch y=0y = 0 at x=23x = \frac{2}{3}, then increases without bound. Therefore y0y \geq 0 for all x0x \geq 0, i.e.

27x327x2+40for all x0.27x^3 - 27x^2 + 4 \geq 0 \quad \text{for all } x \geq 0.

Rearranging: 27x2(1x)427x^2(1 - x) \leq 4, so

x2(1x)427for all x0.()x^2(1 - x) \leq \frac{4}{27} \quad \text{for all } x \geq 0. \qquad (\star)

Now we prove the main result by contradiction. Suppose, for contradiction, that all three numbers bc(1a)bc(1 - a), ca(1b)ca(1 - b), ab(1c)ab(1 - c) are strictly greater than 427\frac{4}{27}. Then their product satisfies:

bc(1a)ca(1b)ab(1c)>(427)3.bc(1 - a) \cdot ca(1 - b) \cdot ab(1 - c) > \left(\frac{4}{27}\right)^3.

The left-hand side can be rearranged:

a2b2c2(1a)(1b)(1c)=a2(1a)b2(1b)c2(1c).a^2 b^2 c^2 (1 - a)(1 - b)(1 - c) = a^2(1 - a) \cdot b^2(1 - b) \cdot c^2(1 - c).

Since 0<a<10 < a < 1, we have a0a \geq 0, so by ()(\star) with x=ax = a: a2(1a)427a^2(1 - a) \leq \frac{4}{27}. Similarly b2(1b)427b^2(1 - b) \leq \frac{4}{27} and c2(1c)427c^2(1 - c) \leq \frac{4}{27}.

Therefore:

a2(1a)b2(1b)c2(1c)(427)3.a^2(1 - a) \cdot b^2(1 - b) \cdot c^2(1 - c) \leq \left(\frac{4}{27}\right)^3.

This contradicts our assumption. Hence at least one of bc(1a)bc(1 - a), ca(1b)ca(1 - b), ab(1c)ab(1 - c) must be less than or equal to 427\frac{4}{27}.

Part (ii)

Consider the function g(x)=x(1x)=xx2g(x) = x(1 - x) = x - x^2. Then g(x)=12x=0g'(x) = 1 - 2x = 0 gives x=12x = \frac{1}{2}, and g(x)=2<0g''(x) = -2 < 0 confirms this is a maximum. The maximum value is g(12)=14g\left(\frac{1}{2}\right) = \frac{1}{4}.

Therefore x(1x)14x(1 - x) \leq \frac{1}{4} for all xx.

Now suppose, for contradiction, that both p(1q)>14p(1 - q) > \frac{1}{4} and q(1p)>14q(1 - p) > \frac{1}{4}. Multiplying:

p(1q)q(1p)>116.p(1 - q) \cdot q(1 - p) > \frac{1}{16}.

The left-hand side equals p(1p)q(1q)p(1 - p) \cdot q(1 - q).

Since 0<p<10 < p < 1: p(1p)14p(1 - p) \leq \frac{1}{4}. Since 0<q<10 < q < 1: q(1q)14q(1 - q) \leq \frac{1}{4}.

Therefore p(1p)q(1q)116p(1 - p) \cdot q(1 - q) \leq \frac{1}{16}, contradicting the assumption. Hence at least one of p(1q)p(1 - q), q(1p)q(1 - p) is less than or equal to 14\frac{1}{4}.

Examiner Notes

This, the third most popular question on the paper, producing a mixed bag of responses. It strikes me that, although the A-level specifications require candidates to understand the process of proof by contradiction, this is never actually tested anywhere by any of the exam. boards. Nonetheless, it was very pleasing to see that so many candidates were able to grasp the basic idea of what to do, and many did so very successfully. The impartial observer might well note that the situation in (i) is very much tougher (in terms of degree) than that in (ii). However, candidates were very much more closely guided in (i) and then left to make their own way in (ii).

Apart from the standard, expected response to (i) – see the SOLUTIONS document for this – many other candidates produced a very pleasing alternative which they often dressed up as proof by contradiction but which was, in fact, a direct proof. It was, however, so mathematically sound and appealing an argument (and a legitimate imitation of a p by c) that we gave it all but one of the marks available in this part of the question. It ran like this:

Suppose w.l.o.g. that 0<abc<10 < a \le b \le c < 1. Then ab(1c)b2(1b)427ab(1 - c) \le b^2(1 - b) \le \frac{4}{27} by the previous result (namely x2(1x)427x^2(1 - x) \le \frac{4}{27} for all x0x \ge 0). QED.

[Note that we could have used ab(1c)c2(1c)427ab(1 - c) \le c^2(1 - c) \le \frac{4}{27} also.]

It has to be said that most other inequality arguments were rather poorly constructed and unconvincing, leaving the markers with little option but to put a line through (often) several pages of circular arguments, faulty assumptions, dubious conclusions, and occasionally correct statements with either no supporting reasoning or going nowhere useful.

There was one remarkable alternative which was produced by just a couple of candidates (that I know of) and is not included in the SOLUTIONS because it is such a rarity. However, for those who know of the AM – GM Inequality, it is sufficiently appealing to include it here for novelty value. It ran like this:

Assume that bc(1a),ca(1b),ab(1c)>427bc(1 - a), ca(1 - b), ab(1 - c) > \frac{4}{27}. Using the previous result, we have a2(1a),b2(1b),c2(1c)427a^2(1 - a), b^2(1 - b), c^2(1 - c) \le \frac{4}{27}. Then, since all terms are positive, it follows that a2bc,b2ca,c2aba^2 \le bc, b^2 \le ca, c^2 \le ab so that a2+b2+c2bc+ca+ab.()a^2 + b^2 + c^2 \le bc + ca + ab. \qquad (\star) However, by the AM – GM Inequality (or directly by the Cauchy-Schwarz Inequality), a2+b22ab,b2+c22bc and c2+a22ca.a^2 + b^2 \ge 2ab, b^2 + c^2 \ge 2bc \text{ and } c^2 + a^2 \ge 2ca. Adding and dividing by two then gives a2+b2+c2ab+bc+caa^2 + b^2 + c^2 \ge ab + bc + ca, which contradicts the conclusion ()(\star), etc., etc.


Topic: 隐函数求导与几何应用 (Implicit Differentiation and Geometry)  |  Difficulty: Challenging  |  Marks: 20

4 A curve is given by

x2+y2+2axy=1,x^2 + y^2 + 2axy = 1,

where aa is a constant satisfying 0<a<10 < a < 1. Show that the gradient of the curve at the point PP with coordinates (x,y)(x, y) is

x+ayax+y,-\frac{x + ay}{ax + y},

provided ax+y0ax + y \neq 0. Show that θ\theta, the acute angle between OPOP and the normal to the curve at PP, satisfies

tanθ=ay2x2.\tan \theta = a|y^2 - x^2|.

Show further that, if dθdx=0\frac{d\theta}{dx} = 0 at PP, then:

(i) a(x2+y2)+2xy=0a(x^2 + y^2) + 2xy = 0;

(ii) (1+a)(x2+y2+2xy)=1(1 + a)(x^2 + y^2 + 2xy) = 1;

(iii) tanθ=a1a2\tan \theta = \frac{a}{\sqrt{1 - a^2}}.

Hint

4 Differentiating implicitly gives 2(x+ydydx+axdydx+ay)=02\left( x + y\frac{dy}{dx} + ax\frac{dy}{dx} + ay \right) = 0, from which it follows that

dydx=x+ayax+y\frac{dy}{dx} = -\frac{x + ay}{ax + y} and hence the gradient of the normal is ax+yx+ay\frac{ax + y}{x + ay}.

Using tan(AB)\tan(A - B) on this and yx\frac{y}{x} gives tanθ=yxax+yx+ay1+yx×ax+yx+ay=xy+ay2ax2xyx2+axy+axy+y2\tan \theta = \left| \frac{\frac{y}{x} - \frac{ax + y}{x + ay}}{1 + \frac{y}{x} \times \frac{ax + y}{x + ay}} \right| = \left| \frac{xy + ay^2 - ax^2 - xy}{x^2 + axy + axy + y^2} \right|.

However, we know that x2+y2+2axy=1x^2 + y^2 + 2axy = 1 from the curve’s eqn., and so tanθ=ay2x2.\tan \theta = a|y^2 - x^2|.

(i) Differentiating this w.r.t. xx then gives sec2θdθdx=a(2ydydx2x)\sec^2 \theta \frac{d\theta}{dx} = a\left( 2y\frac{dy}{dx} - 2x \right). Equating this to zero and using dydx=x+ayax+y\frac{dy}{dx} = -\frac{x + ay}{ax + y} from earlier then leads to a(x2+y2)+2xy=0a(x^2 + y^2) + 2xy = 0.

(ii) Adding x2+y2+2axy=1x^2 + y^2 + 2axy = 1 and a(x2+y2)+2xy=0a(x^2 + y^2) + 2xy = 0 gives (1+a)(x+y)2=1(1 + a)(x + y)^2 = 1.

(iii) However, subtracting these two eqns. instead gives (1a)(yx)2=1(1 - a)(y - x)^2 = 1, and multiplying these two last results together yields (1a2)(y2x2)2=1(1 - a^2)(y^2 - x^2)^2 = 1.

Finally, using tanθ=ay2x2(y2x2)2=1a2tan2θ\tan \theta = a|y^2 - x^2| \Rightarrow (y^2 - x^2)^2 = \frac{1}{a^2} \tan^2 \theta, and substituting this

into the last result of (iii) then gives the required result: tanθ=a1a2\tan \theta = \frac{a}{\sqrt{1 - a^2}}. All that

remains is to justify taking the positive square root, since tanθ\tan \theta is | something |, which is necessarily non-negative.

Model Solution

Finding the gradient

Differentiating x2+y2+2axy=1x^2 + y^2 + 2axy = 1 implicitly with respect to xx:

2x+2ydydx+2a(xdydx+y)=0.2x + 2y\frac{dy}{dx} + 2a\left(x\frac{dy}{dx} + y\right) = 0.

Dividing by 2 and collecting terms in dydx\frac{dy}{dx}:

x+ay+(y+ax)dydx=0.x + ay + (y + ax)\frac{dy}{dx} = 0.

Therefore:

dydx=x+ayax+y,provided ax+y0.\frac{dy}{dx} = -\frac{x + ay}{ax + y}, \qquad \text{provided } ax + y \neq 0.

Finding tanθ\tan\theta

The gradient of OPOP (from the origin to P(x,y)P(x,y)) is yx\frac{y}{x}, provided x0x \neq 0.

The gradient of the normal to the curve at PP is the negative reciprocal of dydx\frac{dy}{dx}:

mnormal=ax+yx+ay.m_{\text{normal}} = \frac{ax + y}{x + ay}.

The angle θ\theta between OPOP and the normal is given by:

tanθ=yxax+yx+ay1+yxax+yx+ay.\tan\theta = \left|\frac{\frac{y}{x} - \frac{ax + y}{x + ay}}{1 + \frac{y}{x} \cdot \frac{ax + y}{x + ay}}\right|.

Computing the numerator:

yxax+yx+ay=y(x+ay)x(ax+y)x(x+ay)=xy+ay2ax2xyx(x+ay)=a(y2x2)x(x+ay).\frac{y}{x} - \frac{ax + y}{x + ay} = \frac{y(x + ay) - x(ax + y)}{x(x + ay)} = \frac{xy + ay^2 - ax^2 - xy}{x(x + ay)} = \frac{a(y^2 - x^2)}{x(x + ay)}.

Computing the denominator:

1+y(ax+y)x(x+ay)=x(x+ay)+y(ax+y)x(x+ay)=x2+axy+axy+y2x(x+ay)=x2+y2+2axyx(x+ay).1 + \frac{y(ax + y)}{x(x + ay)} = \frac{x(x + ay) + y(ax + y)}{x(x + ay)} = \frac{x^2 + axy + axy + y^2}{x(x + ay)} = \frac{x^2 + y^2 + 2axy}{x(x + ay)}.

Since x2+y2+2axy=1x^2 + y^2 + 2axy = 1 (from the curve equation), the denominator simplifies to 1x(x+ay)\frac{1}{x(x + ay)}.

Therefore:

tanθ=a(y2x2)x(x+ay)x(x+ay)=ay2x2.\tan\theta = \left|\frac{a(y^2 - x^2)}{x(x + ay)} \cdot x(x + ay)\right| = a|y^2 - x^2|.

Part (i): Show that dθdx=0\frac{d\theta}{dx} = 0 implies a(x2+y2)+2xy=0a(x^2 + y^2) + 2xy = 0

We have tanθ=ay2x2\tan\theta = a|y^2 - x^2|. Without loss of generality, suppose y2x2y^2 \geq x^2 (the other case is analogous), so tanθ=a(y2x2)\tan\theta = a(y^2 - x^2).

Differentiating both sides with respect to xx:

sec2θdθdx=a(2ydydx2x).\sec^2\theta \cdot \frac{d\theta}{dx} = a\left(2y\frac{dy}{dx} - 2x\right).

Setting dθdx=0\frac{d\theta}{dx} = 0 (and noting sec2θ0\sec^2\theta \neq 0):

a(2ydydx2x)=0.a\left(2y\frac{dy}{dx} - 2x\right) = 0.

Since a>0a > 0, we need 2ydydx2x=02y\frac{dy}{dx} - 2x = 0, i.e. ydydx=xy\frac{dy}{dx} = x. Substituting dydx=x+ayax+y\frac{dy}{dx} = -\frac{x + ay}{ax + y}:

y(x+ayax+y)=x.y \cdot \left(-\frac{x + ay}{ax + y}\right) = x.

y(x+ay)=x(ax+y).-y(x + ay) = x(ax + y).

xyay2=ax2+xy.-xy - ay^2 = ax^2 + xy.

ay2ax2=2xy.-ay^2 - ax^2 = 2xy.

a(x2+y2)+2xy=0.(i)a(x^2 + y^2) + 2xy = 0. \qquad \text{(i)}

Part (ii): Show that (1+a)(x2+y2+2xy)=1(1 + a)(x^2 + y^2 + 2xy) = 1

We have two equations:

x2+y2+2axy=1(curve equation)x^2 + y^2 + 2axy = 1 \qquad \text{(curve equation)} a(x2+y2)+2xy=0(from part (i))a(x^2 + y^2) + 2xy = 0 \qquad \text{(from part (i))}

Adding these two equations:

(1+a)(x2+y2)+2axy+2xy=1.(1 + a)(x^2 + y^2) + 2axy + 2xy = 1.

Factor the last two terms: 2axy+2xy=2xy(1+a)2axy + 2xy = 2xy(1 + a). Therefore:

(1+a)(x2+y2)+2xy(1+a)=1.(1 + a)(x^2 + y^2) + 2xy(1 + a) = 1.

(1+a)(x2+y2+2xy)=1.(ii)(1 + a)(x^2 + y^2 + 2xy) = 1. \qquad \text{(ii)}

Part (iii): Show that tanθ=a1a2\tan\theta = \frac{a}{\sqrt{1 - a^2}}

Subtracting the equation from part (i) from the curve equation:

(x2+y2+2axy)a(x2+y2)2xy=10.(x^2 + y^2 + 2axy) - a(x^2 + y^2) - 2xy = 1 - 0.

(1a)(x2+y2)+2xy(a1)=1.(1 - a)(x^2 + y^2) + 2xy(a - 1) = 1.

(1a)(x2+y22xy)=1.(1 - a)(x^2 + y^2 - 2xy) = 1.

(1a)(xy)2=1.()(1 - a)(x - y)^2 = 1. \qquad (\star\star)

From part (ii): (1+a)(x+y)2=1(1 + a)(x + y)^2 = 1.

Multiplying ()(\star\star) and the result of (ii):

(1a)(1+a)(xy)2(x+y)2=1.(1 - a)(1 + a)(x - y)^2(x + y)^2 = 1.

(1a2)(y2x2)2=1.()(1 - a^2)(y^2 - x^2)^2 = 1. \qquad (\star\star\star)

Now recall tanθ=ay2x2\tan\theta = a|y^2 - x^2|, so (y2x2)2=tan2θa2(y^2 - x^2)^2 = \frac{\tan^2\theta}{a^2}.

Substituting into ()(\star\star\star):

(1a2)tan2θa2=1.(1 - a^2) \cdot \frac{\tan^2\theta}{a^2} = 1.

tan2θ=a21a2.\tan^2\theta = \frac{a^2}{1 - a^2}.

Since 0<a<10 < a < 1, we have 1a2>01 - a^2 > 0, and tanθ0\tan\theta \geq 0 (as θ\theta is acute). Taking the positive square root:

tanθ=a1a2.(iii)\tan\theta = \frac{a}{\sqrt{1 - a^2}}. \qquad \text{(iii)}

Examiner Notes

Another very popular question, poorly done (600 attempts, mean score below 7). Most efforts got little further than finding the gradient of the normal to the curve, and I strongly suspect that this question was frequently to be found amongst candidates’ non-contributing scorers. Using the tan(AB)\tan(A - B) formula is a sufficiently common occurrence on past papers that there is little excuse for well-prepared candidates not to recognise when and how to apply it. Once that has been done, the question’s careful structuring guided able candidates over the hurdles one at a time, each result relying on the preceding result(s); yet most attempts had finished quite early on, and the majority of candidates failed to benefit from the setters’ kindness.


Topic: 积分与不等式 (Integration and Inequalities)  |  Difficulty: Standard  |  Marks: 20

5 Evaluate the integrals

0π/2sin2x1+sin2xdxand0π/2sinx1+sin2xdx.\int_0^{\pi/2} \frac{\sin 2x}{1 + \sin^2 x} dx \quad \text{and} \quad \int_0^{\pi/2} \frac{\sin x}{1 + \sin^2 x} dx.

Show, using the binomial expansion, that (1+2)5<99(1 + \sqrt{2})^5 < 99. Show also that 2>1.4\sqrt{2} > 1.4. Deduce that 22>1+22^{\sqrt{2}} > 1 + \sqrt{2}. Use this result to determine which of the above integrals is greater.

Hint

5 Using a well-known double-angle formula gives 0π/2sin2x1+sin2xdx=0π/22sinxcosx1+sin2xdx\int_0^{\pi/2} \frac{\sin 2x}{1 + \sin^2 x} dx = \int_0^{\pi/2} \frac{2 \sin x \cos x}{1 + \sin^2 x} dx, and

this should suggest an obvious substitution: letting s=sinxs = \sin x turns this into the integral 012s1+s2ds.\int_0^1 \frac{2s}{1 + s^2} ds.

This is just a standard log. integral (the numerator being the derivative of the denominator), leading to the answer ln2\ln 2.

Alternatively, one could use the identity sin2x1212cos2x\sin^2 x \equiv \frac{1}{2} - \frac{1}{2} \cos 2x to end up with 0π/22sin2x3cos2xdx.\int_0^{\pi/2} \frac{2 \sin 2x}{3 - \cos 2x} dx.

This, again, gives a log. integral, but without the substitution.

A suitable substitution for the second integral is c=cosxc = \cos x, which leads to 0112c2dc\int_0^1 \frac{1}{2 - c^2} dc.

Now you can either attack this using partial fractions, or you could look up what is a fairly standard result in your formula booklet. In each case, you get (after a bit of careful log and

surd work) 12ln(1+2)\frac{1}{\sqrt{2}} \ln(1 + \sqrt{2}).

Now (1+2)5=1+52+20+202+20+42=41+292(1 + \sqrt{2})^5 = 1 + 5\sqrt{2} + 20 + 20\sqrt{2} + 20 + 4\sqrt{2} = 41 + 29\sqrt{2} (using the binomial theorem, for instance), and

41+292<99292<582<2,41 + 29\sqrt{2} < 99 \Leftrightarrow 29\sqrt{2} < 58 \Leftrightarrow \sqrt{2} < 2,

which is obviously the case. Also, 1.96<21.4<21.96 < 2 \Rightarrow 1.4 < \sqrt{2}. Thereafter, an argument such as

21.4>1+227>(1+2)5128>41+2922^{1.4} > 1 + \sqrt{2} \Leftrightarrow 2^7 > (1 + \sqrt{2})^5 \Leftrightarrow 128 > 41 + 29\sqrt{2}

87>2923>2\Leftrightarrow 87 > 29\sqrt{2} \Leftrightarrow 3 > \sqrt{2}

from which it follows that 22>27/5>1+22^{\sqrt{2}} > 2^{7/5} > 1 + \sqrt{2}.

Taking logs in this result then gives 2ln2>ln(1+2)ln2>12ln(1+2)\sqrt{2} \ln 2 > \ln(1 + \sqrt{2}) \Rightarrow \ln 2 > \frac{1}{\sqrt{2}} \ln(1 + \sqrt{2}); and

0π/2sin2x1+sin2xdx>0π/2sinx1+sin2xdx.\int_0^{\pi/2} \frac{\sin 2x}{1 + \sin^2 x} dx > \int_0^{\pi/2} \frac{\sin x}{1 + \sin^2 x} dx.

Model Solution

First integral

Using sin2x=2sinxcosx\sin 2x = 2\sin x \cos x:

0π/2sin2x1+sin2xdx=0π/22sinxcosx1+sin2xdx.\int_0^{\pi/2} \frac{\sin 2x}{1 + \sin^2 x}\, dx = \int_0^{\pi/2} \frac{2\sin x \cos x}{1 + \sin^2 x}\, dx.

Let s=sinxs = \sin x, so ds=cosxdxds = \cos x\, dx. When x=0x = 0, s=0s = 0; when x=π/2x = \pi/2, s=1s = 1.

=012s1+s2ds=[ln(1+s2)]01=ln2ln1=ln2.= \int_0^1 \frac{2s}{1 + s^2}\, ds = \left[\ln(1 + s^2)\right]_0^1 = \ln 2 - \ln 1 = \ln 2.

Second integral

0π/2sinx1+sin2xdx=0π/2sinx2cos2xdxusing sin2x=1cos2x.\int_0^{\pi/2} \frac{\sin x}{1 + \sin^2 x}\, dx = \int_0^{\pi/2} \frac{\sin x}{2 - \cos^2 x}\, dx \qquad \text{using } \sin^2 x = 1 - \cos^2 x.

Let c=cosxc = \cos x, so dc=sinxdxdc = -\sin x\, dx. When x=0x = 0, c=1c = 1; when x=π/2x = \pi/2, c=0c = 0.

=10dc2c2=01dc2c2.= \int_1^0 \frac{-dc}{2 - c^2} = \int_0^1 \frac{dc}{2 - c^2}.

Using partial fractions: 12c2=1(2c)(2+c)=122(12c+12+c)\frac{1}{2 - c^2} = \frac{1}{(\sqrt{2} - c)(\sqrt{2} + c)} = \frac{1}{2\sqrt{2}}\left(\frac{1}{\sqrt{2} - c} + \frac{1}{\sqrt{2} + c}\right).

=122[ln2c+ln2+c]01=122[ln2+c2c]01= \frac{1}{2\sqrt{2}}\left[-\ln|\sqrt{2} - c| + \ln|\sqrt{2} + c|\right]_0^1 = \frac{1}{2\sqrt{2}}\left[\ln\frac{\sqrt{2} + c}{\sqrt{2} - c}\right]_0^1

=122(ln2+121ln1)=122ln2+121.= \frac{1}{2\sqrt{2}}\left(\ln\frac{\sqrt{2} + 1}{\sqrt{2} - 1} - \ln 1\right) = \frac{1}{2\sqrt{2}}\ln\frac{\sqrt{2} + 1}{\sqrt{2} - 1}.

Rationalising: 2+121=(2+1)2(21)(2+1)=(2+1)21=(2+1)2\frac{\sqrt{2} + 1}{\sqrt{2} - 1} = \frac{(\sqrt{2} + 1)^2}{(\sqrt{2} - 1)(\sqrt{2} + 1)} = \frac{(\sqrt{2} + 1)^2}{1} = (\sqrt{2} + 1)^2.

So the integral equals 1222ln(2+1)=12ln(1+2)\frac{1}{2\sqrt{2}} \cdot 2\ln(\sqrt{2} + 1) = \frac{1}{\sqrt{2}}\ln(1 + \sqrt{2}).

Showing (1+2)5<99(1 + \sqrt{2})^5 < 99

By the binomial theorem:

(1+2)5=(50)+(51)2+(52)(2)2+(53)(2)3+(54)(2)4+(55)(2)5(1 + \sqrt{2})^5 = \binom{5}{0} + \binom{5}{1}\sqrt{2} + \binom{5}{2}(\sqrt{2})^2 + \binom{5}{3}(\sqrt{2})^3 + \binom{5}{4}(\sqrt{2})^4 + \binom{5}{5}(\sqrt{2})^5

=1+52+102+1022+54+42= 1 + 5\sqrt{2} + 10 \cdot 2 + 10 \cdot 2\sqrt{2} + 5 \cdot 4 + 4\sqrt{2}

=1+52+20+202+20+42=41+292.= 1 + 5\sqrt{2} + 20 + 20\sqrt{2} + 20 + 4\sqrt{2} = 41 + 29\sqrt{2}.

Now 41+292<99    292<58    2<241 + 29\sqrt{2} < 99 \iff 29\sqrt{2} < 58 \iff \sqrt{2} < 2, which is true since 22=4>22^2 = 4 > 2.

Showing 2>1.4\sqrt{2} > 1.4

(1.4)2=1.96<2(1.4)^2 = 1.96 < 2, so 2>1.4\sqrt{2} > 1.4.

Deducing 22>1+22^{\sqrt{2}} > 1 + \sqrt{2}

Since 2>75\sqrt{2} > \frac{7}{5} (equivalently 52>75\sqrt{2} > 7, i.e. 50>4950 > 49, which is true), and the function 2t2^t is increasing:

22>27/5.2^{\sqrt{2}} > 2^{7/5}.

It suffices to show 27/5>1+22^{7/5} > 1 + \sqrt{2}, i.e. 27>(1+2)52^7 > (1 + \sqrt{2})^5. We have 27=1282^7 = 128 and (1+2)5=41+292(1 + \sqrt{2})^5 = 41 + 29\sqrt{2}. Since 2<3\sqrt{2} < 3:

41+292<41+87=128.41 + 29\sqrt{2} < 41 + 87 = 128.

Therefore 22>27/5>1+22^{\sqrt{2}} > 2^{7/5} > 1 + \sqrt{2}.

Comparing the integrals

From 22>1+22^{\sqrt{2}} > 1 + \sqrt{2}, taking natural logarithms:

2ln2>ln(1+2).\sqrt{2}\ln 2 > \ln(1 + \sqrt{2}).

Dividing by 2\sqrt{2}:

ln2>12ln(1+2).\ln 2 > \frac{1}{\sqrt{2}}\ln(1 + \sqrt{2}).

Therefore 0π/2sin2x1+sin2xdx=ln2>12ln(1+2)=0π/2sinx1+sin2xdx\int_0^{\pi/2} \frac{\sin 2x}{1 + \sin^2 x}\, dx = \ln 2 > \frac{1}{\sqrt{2}}\ln(1 + \sqrt{2}) = \int_0^{\pi/2} \frac{\sin x}{1 + \sin^2 x}\, dx.

The first integral is greater.

Examiner Notes

This was the most popular question on the paper (by a small margin) and with the second highest mean mark (12) of all the pure questions. Those who were able to spot the two standard trig. substitutions s=sinxs = \sin x and c=cosxc = \cos x for the first two parts generally made excellent progress, although the log. and surd work required to tidy up the second integral’s answer left many with a correct answer that wasn’t easy to do anything much useful with at the very end, when deciding which was numerically the greater. The binomial expansion of (a+b)5(a + b)^5 was handled very comfortably, as was much of the following inequality work. However, the very final conclusion was very seldom successfully handled as any little mistakes, unhelpful forms of answers, etc., prevented candidates’ final thoughts from being sufficiently relevant.


Topic: 三角函数 (Trigonometry)  |  Difficulty: Challenging  |  Marks: 20

6 A curve has the equation y=f(x)y = f(x), where

f(x)=cos(2x+π3)+sin(3x2π4).f(x) = \cos \left( 2x + \frac{\pi}{3} \right) + \sin \left( \frac{3x}{2} - \frac{\pi}{4} \right).

(i) Find the period of f(x)f(x).

(ii) Determine all values of xx in the interval πxπ-\pi \leqslant x \leqslant \pi for which f(x)=0f(x) = 0. Find a value of xx in this interval at which the curve touches the xx-axis without crossing it.

(iii) Find the value or values of xx in the interval 0x2π0 \leqslant x \leqslant 2\pi for which f(x)=2f(x) = 2.

Hint

(i) Firstly, cosx\cos x has period 2πcos(2x)2\pi \Rightarrow \cos(2x) has period π\pi; and sinx\sin x has period 2πsin(3x2)2\pi \Rightarrow \sin\left(\frac{3x}{2}\right) has period 43π\frac{4}{3}\pi.

Then f(x)=cos(2x+π3)+sin(3x2π4)f(x) = \cos\left(2x + \frac{\pi}{3}\right) + \sin\left(\frac{3x}{2} - \frac{\pi}{4}\right) has period 4π=lcm(π,43π)4\pi = \text{lcm}(\pi, \frac{4}{3}\pi).

(ii) Any approach here is going to require the use of some trig. identity work. The most straightforward is to note that cos(π2+θ)=sinθ\cos\left(\frac{\pi}{2} + \theta\right) = -\sin \theta so that f(x)=0f(x) = 0 reduces to

cos(2x+π3)=cos(3x2+π4), from which it follows that 2x+π3=2nπ±(3x2+π4)\cos\left(2x + \frac{\pi}{3}\right) = \cos\left(\frac{3x}{2} + \frac{\pi}{4}\right), \text{ from which it follows that } 2x + \frac{\pi}{3} = 2n\pi \pm \left(\frac{3x}{2} + \frac{\pi}{4}\right)

where nn is an integer, using the symmetric and periodic properties of the cosine curve. Taking suitable values of nn, so that xx is in the required interval, leads to the answers

x=31π42x = -\frac{31\pi}{42} (from n=1n = -1, with the - sign), x=π6x = -\frac{\pi}{6} (n=0n = 0, with both ++ and - signs),

x=17π42x = \frac{17\pi}{42} (n=1n = 1, - sign) and x=41π42x = \frac{41\pi}{42} (n=2n = 2, - sign).

Since x=π6x = -\frac{\pi}{6} is a repeated root (occurring twice in the above list), the curve of y=f(x)y = f(x) touches the xx-axis at this point.

For those who are aware of the results that appear in all the formula books, but which seem to be on the edge of the various syllabuses, that I know by the title of the Sum-and-Product Formulae, such as

cosA+cosB2cos(A+B2)cos(AB2)\cos A + \cos B \equiv 2\cos\left(\frac{A+B}{2}\right)\cos\left(\frac{A-B}{2}\right), there is a

second straightforward approach available here. For example, noting that

cos(π2θ)=sinθ\cos\left(\frac{\pi}{2} - \theta\right) = \sin \theta gives cos(2x+π3)+cos(3π43x2)=0\cos\left(2x + \frac{\pi}{3}\right) + \cos\left(\frac{3\pi}{4} - \frac{3x}{2}\right) = 0 which (from the above

identity) then gives 2cos(x4+13π24)cos(7x45π24)=02 \cos \left( \frac{x}{4} + \frac{13\pi}{24} \right) \cos \left( \frac{7x}{4} - \frac{5\pi}{24} \right) = 0, and setting each of these two

cosine terms equal to zero, in turn, yields the same values of xx as before, including the repeat.

(iii) The key observation here is that y=2y = 2 if and only if both cos(2x+π3)=1\cos \left( 2x + \frac{\pi}{3} \right) = 1 and sin(3x2π4)=1\sin \left( \frac{3x}{2} - \frac{\pi}{4} \right) = 1, simultaneously. So we must solve cos(2x+π3)=12x+π3=0,2π,4π,\cos \left( 2x + \frac{\pi}{3} \right) = 1 \Rightarrow 2x + \frac{\pi}{3} = 0, 2\pi, 4\pi, \dots, giving x=5π6,11π6,x = \frac{5\pi}{6}, \frac{11\pi}{6}, \dots; and sin(3x2π4)=13x2π4=π2,5π2,\sin \left( \frac{3x}{2} - \frac{\pi}{4} \right) = 1 \Rightarrow \frac{3x}{2} - \frac{\pi}{4} = \frac{\pi}{2}, \frac{5\pi}{2}, \dots, giving x=π2,11π6,x = \frac{\pi}{2}, \frac{11\pi}{6}, \dots. Both equations are satisfied when x=11π6x = \frac{11\pi}{6}, and this is the required answer.

Model Solution

Part (i): Period of f(x)f(x)

The term cos(2x+π/3)\cos(2x + \pi/3) has period 2π2=π\frac{2\pi}{2} = \pi.

The term sin ⁣(3x2π4)\sin\!\left(\frac{3x}{2} - \frac{\pi}{4}\right) has period 2π3/2=4π3\frac{2\pi}{3/2} = \frac{4\pi}{3}.

The period of f(x)f(x) is lcm ⁣(π,4π3)\text{lcm}\!\left(\pi,\, \frac{4\pi}{3}\right). Writing π=3π3\pi = \frac{3\pi}{3}, we need the smallest positive TT such that T=mπ=n4π3T = m\pi = n \cdot \frac{4\pi}{3} for positive integers m,nm, n. This gives 3m=4n3m = 4n, so the smallest solution is m=4,n=3m = 4, n = 3, giving T=4πT = 4\pi.

The period of f(x)f(x) is 4π4\pi.

Part (ii): Solving f(x)=0f(x) = 0 for πxπ-\pi \leq x \leq \pi

We rewrite the sine term using sinθ=cos ⁣(π2+θ)\sin\theta = -\cos\!\left(\frac{\pi}{2} + \theta\right):

sin ⁣(3x2π4)=cos ⁣(π2+3x2π4)=cos ⁣(3x2+π4).\sin\!\left(\frac{3x}{2} - \frac{\pi}{4}\right) = -\cos\!\left(\frac{\pi}{2} + \frac{3x}{2} - \frac{\pi}{4}\right) = -\cos\!\left(\frac{3x}{2} + \frac{\pi}{4}\right).

So f(x)=0f(x) = 0 becomes:

cos ⁣(2x+π3)=cos ⁣(3x2+π4).\cos\!\left(2x + \frac{\pi}{3}\right) = \cos\!\left(\frac{3x}{2} + \frac{\pi}{4}\right).

Using cosA=cosB    A=2nπ±B\cos A = \cos B \iff A = 2n\pi \pm B:

2x+π3=2nπ±(3x2+π4).2x + \frac{\pi}{3} = 2n\pi \pm \left(\frac{3x}{2} + \frac{\pi}{4}\right).

Case 1 (+ sign):

2x+π3=2nπ+3x2+π42x + \frac{\pi}{3} = 2n\pi + \frac{3x}{2} + \frac{\pi}{4}

x2=2nπ+π4π3=2nππ12\frac{x}{2} = 2n\pi + \frac{\pi}{4} - \frac{\pi}{3} = 2n\pi - \frac{\pi}{12}

x=4nππ6.x = 4n\pi - \frac{\pi}{6}.

For x[π,π]x \in [-\pi, \pi]: only n=0n = 0 gives x=π6x = -\frac{\pi}{6}.

Case 2 (- sign):

2x+π3=2nπ3x2π42x + \frac{\pi}{3} = 2n\pi - \frac{3x}{2} - \frac{\pi}{4}

7x2=2nππ4π3=2nπ7π12\frac{7x}{2} = 2n\pi - \frac{\pi}{4} - \frac{\pi}{3} = 2n\pi - \frac{7\pi}{12}

x=4nπ7π6=24nπ7π42=(24n7)π42.x = \frac{4n\pi}{7} - \frac{\pi}{6} = \frac{24n\pi - 7\pi}{42} = \frac{(24n - 7)\pi}{42}.

For x[π,π]x \in [-\pi, \pi], we need 4224n742-42 \leq 24n - 7 \leq 42, i.e. 3524n49-35 \leq 24n \leq 49, so n=1,0,1,2n = -1, 0, 1, 2:

  • n=1n = -1: x=31π42x = \frac{-31\pi}{42}
  • n=0n = 0: x=7π42=π6x = \frac{-7\pi}{42} = -\frac{\pi}{6}
  • n=1n = 1: x=17π42x = \frac{17\pi}{42}
  • n=2n = 2: x=41π42x = \frac{41\pi}{42}

The complete set of solutions is:

x=31π42,x=π6,x=17π42,x=41π42.x = -\frac{31\pi}{42},\quad x = -\frac{\pi}{6},\quad x = \frac{17\pi}{42},\quad x = \frac{41\pi}{42}.

Since x=π6x = -\frac{\pi}{6} arises from both the ”+” case (Case 1) and the "-" case (Case 2 with n=0n = 0), it is a repeated root. This means the curve touches the xx-axis at x=π6x = -\frac{\pi}{6} without crossing it.

Part (iii): Solving f(x)=2f(x) = 2 for 0x2π0 \leq x \leq 2\pi

Since 1cos ⁣(2x+π3)1-1 \leq \cos\!\left(2x + \frac{\pi}{3}\right) \leq 1 and 1sin ⁣(3x2π4)1-1 \leq \sin\!\left(\frac{3x}{2} - \frac{\pi}{4}\right) \leq 1, and their sum equals 2, both terms must simultaneously equal 1:

cos ⁣(2x+π3)=1andsin ⁣(3x2π4)=1.\cos\!\left(2x + \frac{\pi}{3}\right) = 1 \qquad \text{and} \qquad \sin\!\left(\frac{3x}{2} - \frac{\pi}{4}\right) = 1.

From the first equation: 2x+π3=2kπ2x + \frac{\pi}{3} = 2k\pi for integer kk, so x=kππ6x = k\pi - \frac{\pi}{6}.

For x[0,2π]x \in [0, 2\pi]: k=1k = 1 gives x=5π6x = \frac{5\pi}{6}; k=2k = 2 gives x=11π6x = \frac{11\pi}{6}.

From the second equation: 3x2π4=π2+2mπ\frac{3x}{2} - \frac{\pi}{4} = \frac{\pi}{2} + 2m\pi for integer mm, so 3x2=3π4+2mπ\frac{3x}{2} = \frac{3\pi}{4} + 2m\pi, giving x=π2+4mπ3x = \frac{\pi}{2} + \frac{4m\pi}{3}.

For x[0,2π]x \in [0, 2\pi]: m=0m = 0 gives x=π2x = \frac{\pi}{2}; m=1m = 1 gives x=π2+4π3=11π6x = \frac{\pi}{2} + \frac{4\pi}{3} = \frac{11\pi}{6}.

The only value satisfying both equations is x=11π6x = \frac{11\pi}{6}.

Examiner Notes

This was the least popular of the pure maths questions. Although there were 300 starts to the question, most of these barely got into the very opening part before the attempt was abandoned in favour of another question. Most attempts failed to show that f(x)f(x) has a period of 4π4\pi. As mentioned, few proceeded further. Of those who did, efforts were generally very poor indeed – as testified to by the very low mean mark of 4 – with the necessary comfort in handling even the most basic of trig. identities being very conspicuous by its absence. Part (iii) was my personal favourite amongst the pure questions, as it contained a very uncommon – yet remarkably simple – idea in order to get started on the road to a solution. The idea is simply this: f(x)f(x), being the sum of a cosine term and sine term, is equal to 2 if and only if each of these separate terms is simultaneously at its maximum of 1. That is, the question is actually two very easy trig. equations disguised as one very complicated-looking one. Once realised, the whole thing becomes very straightforward indeed, but only a few candidates had persevered this far.


Topic: 微分方程 (Differential Equations)  |  Difficulty: Standard  |  Marks: 20

7 (i) By writing y=u(1+x2)12y = u(1 + x^2)^{\frac{1}{2}}, where uu is a function of xx, find the solution of the equation 1ydydx=xy+x1+x2\frac{1}{y} \frac{dy}{dx} = xy + \frac{x}{1 + x^2} for which y=1y = 1 when x=0x = 0.

(ii) Find the solution of the equation 1ydydx=x2y+x21+x3\frac{1}{y} \frac{dy}{dx} = x^2y + \frac{x^2}{1 + x^3} for which y=1y = 1 when x=0x = 0.

(iii) Give, without proof, a conjecture for the solution of the equation 1ydydx=xn1y+xn11+xn\frac{1}{y} \frac{dy}{dx} = x^{n-1}y + \frac{x^{n-1}}{1 + x^n} for which y=1y = 1 when x=0x = 0, where nn is an integer greater than 1.

Hint

(i) Differentiating y=u1+x2y = u \sqrt{1 + x^2} gives dydx=ux1+x2+1+x2dudx\frac{\text{d}y}{\text{d}x} = u \cdot \frac{x}{\sqrt{1 + x^2}} + \sqrt{1 + x^2} \cdot \frac{\text{d}u}{\text{d}x}; so that 1ydydx=xy+x1+x2\frac{1}{y} \frac{\text{d}y}{\text{d}x} = xy + \frac{x}{1 + x^2} becomes 1u1+x2{ux1+x2+1+x2dudx}=xu1+x2+x1+x2\frac{1}{u \sqrt{1 + x^2}} \left\{ \frac{ux}{\sqrt{1 + x^2}} + \sqrt{1 + x^2} \cdot \frac{\text{d}u}{\text{d}x} \right\} = xu \sqrt{1 + x^2} + \frac{x}{1 + x^2}. Simplifying and cancelling the common term on both sides leads to 1ududx=xu1+x2\frac{1}{u} \cdot \frac{\text{d}u}{\text{d}x} = xu \sqrt{1 + x^2}. This is a standard form for a first-order differential equation, involving the separation of variables and integration: 1u2du=x1+x2 dx1u=13(1+x2)3/2(+C)\int \frac{1}{u^2} \cdot \text{d}u = \int x \sqrt{1 + x^2} \text{ d}x \Rightarrow -\frac{1}{u} = \frac{1}{3} (1 + x^2)^{3/2} (+ C). Using x=0,y=1x = 0, y = 1 (u=1u = 1) to find CC leads to the final answer, y=31+x24(1+x2)3/2y = \frac{3 \sqrt{1 + x^2}}{4 - (1 + x^2)^{3/2}}.

(ii) The key here is to choose the appropriate function of xx. If you have really got a feel for what has happened in the previous bit of the question, then this isn’t too demanding. If you haven’t really grasped fully what’s going on then you may well need to try one or two possibilities first. The product that needs to be identified here is y=u(1+x3)1/3y = u(1 + x^3)^{1/3}. Once you have found this, the process of (i) pretty much repeats itself. dydx=ux2(1+x3)2/3+(1+x3)1/3dudx\frac{\text{d}y}{\text{d}x} = u \cdot x^2 (1 + x^3)^{-2/3} + (1 + x^3)^{1/3} \frac{\text{d}u}{\text{d}x} means that 1ydydx=x2y+x21+x3\frac{1}{y} \frac{\text{d}y}{\text{d}x} = x^2 y + \frac{x^2}{1 + x^3} becomes 1ududx=x2u(1+x3)1/3\frac{1}{u} \cdot \frac{\text{d}u}{\text{d}x} = x^2 u (1 + x^3)^{1/3}. Separating variables and integrating: 1u2du=x2(1+x3)1/3 dx=1u=14(1+x3)4/3(+C)\int \frac{1}{u^2} \cdot \text{d}u = \int x^2 (1 + x^3)^{1/3} \text{ d}x = -\frac{1}{u} = \frac{1}{4} (1 + x^3)^{4/3} (+ C);

and x=0,y=1x = 0, y = 1 (u=1u = 1) gives CC and the answer y=4(1+x3)1/35(1+x3)4/3y = \frac{4(1 + x^3)^{1/3}}{5 - (1 + x^3)^{4/3}}.

(iii) Note that the question didn’t actually require you to simplify the two answers in (i) and (ii), but doing so certainly enables you to have a better idea as to how to generalise the results:

y=(n+1)(1+xn)1/n(n+2)(1+xn)1+1/n.y = \frac{(n + 1)(1 + x^n)^{1/n}}{(n + 2) - (1 + x^n)^{1 + 1/n}}.

Model Solution

Part (i)

Let y=u(1+x2)1/2y = u(1 + x^2)^{1/2}. Differentiating using the product rule:

dydx=ux(1+x2)1/2+(1+x2)1/2dudx.\frac{dy}{dx} = u \cdot \frac{x}{(1 + x^2)^{1/2}} + (1 + x^2)^{1/2}\frac{du}{dx}.

Dividing by y=u(1+x2)1/2y = u(1 + x^2)^{1/2}:

1ydydx=x1+x2+1ududx.\frac{1}{y}\frac{dy}{dx} = \frac{x}{1 + x^2} + \frac{1}{u}\frac{du}{dx}.

The original equation is 1ydydx=xy+x1+x2\frac{1}{y}\frac{dy}{dx} = xy + \frac{x}{1 + x^2}. Substituting the expression above:

x1+x2+1ududx=xu1+x2+x1+x2.\frac{x}{1 + x^2} + \frac{1}{u}\frac{du}{dx} = xu\sqrt{1 + x^2} + \frac{x}{1 + x^2}.

Cancelling x1+x2\frac{x}{1 + x^2} from both sides:

1ududx=xu1+x2.\frac{1}{u}\frac{du}{dx} = xu\sqrt{1 + x^2}.

dudx=xu21+x2.\frac{du}{dx} = xu^2\sqrt{1 + x^2}.

Separating variables:

duu2=x1+x2dx.\int \frac{du}{u^2} = \int x\sqrt{1 + x^2}\, dx.

For the right-hand side, let w=1+x2w = 1 + x^2, dw=2xdxdw = 2x\, dx:

x1+x2dx=12w1/2dw=13w3/2=13(1+x2)3/2.\int x\sqrt{1 + x^2}\, dx = \frac{1}{2}\int w^{1/2}\, dw = \frac{1}{3}w^{3/2} = \frac{1}{3}(1 + x^2)^{3/2}.

So:

1u=13(1+x2)3/2+C.-\frac{1}{u} = \frac{1}{3}(1 + x^2)^{3/2} + C.

Using the condition y=1y = 1 when x=0x = 0: u=y(1+x2)1/2x=0=1u = \frac{y}{(1 + x^2)^{1/2}}\big|_{x=0} = 1.

1=13+C    C=43.-1 = \frac{1}{3} + C \implies C = -\frac{4}{3}.

1u=13(1+x2)3/243=(1+x2)3/243.-\frac{1}{u} = \frac{1}{3}(1 + x^2)^{3/2} - \frac{4}{3} = \frac{(1 + x^2)^{3/2} - 4}{3}.

u=34(1+x2)3/2.u = \frac{3}{4 - (1 + x^2)^{3/2}}.

Therefore:

y=u(1+x2)1/2=31+x24(1+x2)3/2.y = u(1 + x^2)^{1/2} = \frac{3\sqrt{1 + x^2}}{4 - (1 + x^2)^{3/2}}.

Part (ii)

The structure of part (i) suggests the substitution y=u(1+x3)1/3y = u(1 + x^3)^{1/3}. Differentiating:

dydx=ux2(1+x3)2/3+(1+x3)1/3dudx.\frac{dy}{dx} = u \cdot x^2(1 + x^3)^{-2/3} + (1 + x^3)^{1/3}\frac{du}{dx}.

Dividing by y=u(1+x3)1/3y = u(1 + x^3)^{1/3}:

1ydydx=x21+x3+1ududx.\frac{1}{y}\frac{dy}{dx} = \frac{x^2}{1 + x^3} + \frac{1}{u}\frac{du}{dx}.

The original equation is 1ydydx=x2y+x21+x3\frac{1}{y}\frac{dy}{dx} = x^2 y + \frac{x^2}{1 + x^3}. Substituting:

x21+x3+1ududx=x2u(1+x3)1/3+x21+x3.\frac{x^2}{1 + x^3} + \frac{1}{u}\frac{du}{dx} = x^2 u(1 + x^3)^{1/3} + \frac{x^2}{1 + x^3}.

Cancelling x21+x3\frac{x^2}{1 + x^3}:

1ududx=x2u(1+x3)1/3.\frac{1}{u}\frac{du}{dx} = x^2 u(1 + x^3)^{1/3}.

dudx=x2u2(1+x3)1/3.\frac{du}{dx} = x^2 u^2(1 + x^3)^{1/3}.

Separating variables:

duu2=x2(1+x3)1/3dx.\int \frac{du}{u^2} = \int x^2(1 + x^3)^{1/3}\, dx.

Let w=1+x3w = 1 + x^3, dw=3x2dxdw = 3x^2\, dx:

x2(1+x3)1/3dx=13w1/3dw=1334w4/3=14(1+x3)4/3.\int x^2(1 + x^3)^{1/3}\, dx = \frac{1}{3}\int w^{1/3}\, dw = \frac{1}{3} \cdot \frac{3}{4}w^{4/3} = \frac{1}{4}(1 + x^3)^{4/3}.

So:

1u=14(1+x3)4/3+C.-\frac{1}{u} = \frac{1}{4}(1 + x^3)^{4/3} + C.

Using y=1y = 1 when x=0x = 0: u=1u = 1.

1=14+C    C=54.-1 = \frac{1}{4} + C \implies C = -\frac{5}{4}.

1u=(1+x3)4/354,u=45(1+x3)4/3.-\frac{1}{u} = \frac{(1 + x^3)^{4/3} - 5}{4}, \qquad u = \frac{4}{5 - (1 + x^3)^{4/3}}.

Therefore:

y=4(1+x3)1/35(1+x3)4/3.y = \frac{4(1 + x^3)^{1/3}}{5 - (1 + x^3)^{4/3}}.

Part (iii): Conjecture

The pattern from parts (i) and (ii) generalises. For the equation

1ydydx=xn1y+xn11+xn,\frac{1}{y}\frac{dy}{dx} = x^{n-1}y + \frac{x^{n-1}}{1 + x^n},

the substitution y=u(1+xn)1/ny = u(1 + x^n)^{1/n} leads to the solution

y=(n+1)(1+xn)1/n(n+2)(1+xn)1+1/n.y = \frac{(n + 1)(1 + x^n)^{1/n}}{(n + 2) - (1 + x^n)^{1 + 1/n}}.

Examiner Notes

In many ways, part (i) of the question was very routine, requiring little more than technical competence to see the differential equation, using the given substitution, through to a correct solution. Part (ii) then required candidates to spot a slightly different substitution on the basis of having gained a feel for what had gone on previously. I had thought that many more candidates would try something involving the square root of 1+x31 + x^3 or the cube root of 1+x21 + x^2, rather than cube root of 1+x31 + x^3, but many solutions that I saw went straight for the right thing. Once this had been successfully pushed through – with the working mimicking that of (i) very closely indeed – it was not difficult to spot the general answer required, unproven, in (iii). Overall, however, it seems that a lot of candidates failed to spot the right thing for part (ii) and their solutions stopped at this point. With almost 600 attempts, the mean score on this question was 10.


Topic: 向量 (Vectors)  |  Difficulty: Challenging  |  Marks: 20

8 The points AA and BB have position vectors a and b, respectively, relative to the origin OO. The points AA, BB and OO are not collinear. The point PP lies on ABAB between AA and BB such that AP:PB=(1λ):λ.AP : PB = (1 - \lambda) : \lambda . Write down the position vector of PP in terms of a, b and λ\lambda. Given that OPOP bisects AOB\angle AOB, determine λ\lambda in terms of aa and bb, where a=aa = |\mathbf{a}| and b=bb = |\mathbf{b}|.

The point QQ also lies on ABAB between AA and BB, and is such that AP=BQAP = BQ. Prove that OQ2OP2=(ba)2.OQ^2 - OP^2 = (b - a)^2 .

Hint

The first result is an example of what is known as the Ratio Theorem:

AP:PB=1λ:λp=λa+(1λ)b.AP : PB = 1 - \lambda : \lambda \Rightarrow \mathbf{p} = \lambda \mathbf{a} + (1 - \lambda) \mathbf{b}.

Alternatively, it can be deduced from the standard approach to the vector equation of a straight line, via r=a+λ(ba)\mathbf{r} = \mathbf{a} + \lambda(\mathbf{b} - \mathbf{a}).

Using the scalar product twice then gives

ap=λa2+(1λ)(ab) and bp=λ(ab)+(1λ)b2.\mathbf{a} \bullet \mathbf{p} = \lambda a^2 + (1 - \lambda)(\mathbf{a} \bullet \mathbf{b}) \text{ and } \mathbf{b} \bullet \mathbf{p} = \lambda(\mathbf{a} \bullet \mathbf{b}) + (1 - \lambda) b^2.

Equating these two expressions for cosθ\cos \theta, apap=bpbp\frac{\mathbf{a} \bullet \mathbf{p}}{ap} = \frac{\mathbf{b} \bullet \mathbf{p}}{bp}, re-arranging and collecting up

like terms, then gives ab{λ(a+b)b}=ab{λ(a+b)b}ab\{\lambda(a + b) - b\} = \mathbf{a} \bullet \mathbf{b} \{\lambda(a + b) - b\}. There are two possible consequences to this statement, and both of them should be considered. Either ab=abab = \mathbf{a} \bullet \mathbf{b}, which gives cos2θ=1\cos 2\theta = 1, θ=0\theta = 0, A=BA = B and violates the non-collinearity of O,AO, A & BB; or the bracketed factor on each side is zero, which gives

λ=ba+b.\lambda = \frac{b}{a + b}.

However, if you know the Angle Bisector Theorem, the working is short-circuited quite dramatically:

APPB=OAOB(1λ)(AB)λ(AB)=abbbλ=aλλ=ba+b.\frac{AP}{PB} = \frac{OA}{OB} \Rightarrow \frac{(1 - \lambda)(AB)}{\lambda(AB)} = \frac{a}{b} \Rightarrow b - b\lambda = a\lambda \Rightarrow \lambda = \frac{b}{a + b}.

Next, AQ:QB=λ:1λq=(1λ)a+λbAQ : QB = \lambda : 1 - \lambda \Rightarrow \mathbf{q} = (1 - \lambda)\mathbf{a} + \lambda\mathbf{b}. Then

OQ2=qq=(1λ)2a2+λ2b2+2λ(1λ)abOQ^2 = \mathbf{q} \bullet \mathbf{q} = (1 - \lambda)^2 a^2 + \lambda^2 b^2 + 2\lambda(1 - \lambda) \mathbf{a} \bullet \mathbf{b}

and OP2=pp=(1λ)2b2+λ2a2+2λ(1λ)abOP^2 = \mathbf{p} \bullet \mathbf{p} = (1 - \lambda)^2 b^2 + \lambda^2 a^2 + 2\lambda(1 - \lambda) \mathbf{a} \bullet \mathbf{b}.

[N.B. This working can also be done by the Cosine Rule.] Subtracting:

OQ2OP2=(b2a2)[λ2(1λ)2]=(b2a2)(2λ1)OQ^2 - OP^2 = (b^2 - a^2) [\lambda^2 - (1 - \lambda)^2] = (b^2 - a^2) (2\lambda - 1)

and, substituting λ\lambda in terms of aa and bb into this expression, gives the required answer

=(ba)(b+a)×bab+a=(ba)2.= (b - a)(b + a) \times \frac{b - a}{b + a} = (b - a)^2.

Model Solution

Position vector of PP

Since PP lies on ABAB with AP:PB=(1λ):λAP : PB = (1 - \lambda) : \lambda, by the section formula (ratio theorem):

p=λa+(1λ)b.\mathbf{p} = \lambda\mathbf{a} + (1 - \lambda)\mathbf{b}.

This can be seen from the vector equation of the line ABAB: r=a+t(ba)\mathbf{r} = \mathbf{a} + t(\mathbf{b} - \mathbf{a}), where PP corresponds to t=λt = \lambda (since AP=λABAP = \lambda \cdot AB and PB=(1λ)ABPB = (1 - \lambda) \cdot AB).

Finding λ\lambda when OPOP bisects AOB\angle AOB

Let AOB=2θ\angle AOB = 2\theta. If OPOP bisects AOB\angle AOB, then AOP=BOP=θ\angle AOP = \angle BOP = \theta. Using the scalar product:

cosθ=apap=bpbp\cos \theta = \frac{\mathbf{a} \cdot \mathbf{p}}{a \cdot p} = \frac{\mathbf{b} \cdot \mathbf{p}}{b \cdot p}

so b(ap)=a(bp)b(\mathbf{a} \cdot \mathbf{p}) = a(\mathbf{b} \cdot \mathbf{p}). We compute each dot product:

ap=a(λa+(1λ)b)=λa2+(1λ)(ab)\mathbf{a} \cdot \mathbf{p} = \mathbf{a} \cdot (\lambda\mathbf{a} + (1 - \lambda)\mathbf{b}) = \lambda a^2 + (1 - \lambda)(\mathbf{a} \cdot \mathbf{b})

bp=b(λa+(1λ)b)=λ(ab)+(1λ)b2\mathbf{b} \cdot \mathbf{p} = \mathbf{b} \cdot (\lambda\mathbf{a} + (1 - \lambda)\mathbf{b}) = \lambda(\mathbf{a} \cdot \mathbf{b}) + (1 - \lambda)b^2

Substituting into b(ap)=a(bp)b(\mathbf{a} \cdot \mathbf{p}) = a(\mathbf{b} \cdot \mathbf{p}):

b[λa2+(1λ)(ab)]=a[λ(ab)+(1λ)b2]b\left[\lambda a^2 + (1 - \lambda)(\mathbf{a} \cdot \mathbf{b})\right] = a\left[\lambda(\mathbf{a} \cdot \mathbf{b}) + (1 - \lambda)b^2\right]

Expanding both sides:

λa2b+(1λ)b(ab)=λa(ab)+(1λ)ab2\lambda a^2 b + (1 - \lambda)b(\mathbf{a} \cdot \mathbf{b}) = \lambda a(\mathbf{a} \cdot \mathbf{b}) + (1 - \lambda)ab^2

Collecting terms with λ\lambda on the left and terms with (1λ)(1 - \lambda) on the right:

λ[a2ba(ab)]=(1λ)[ab2b(ab)]\lambda\left[a^2 b - a(\mathbf{a} \cdot \mathbf{b})\right] = (1 - \lambda)\left[ab^2 - b(\mathbf{a} \cdot \mathbf{b})\right]

λa[abab]=(1λ)b[abab]\lambda \cdot a\left[ab - \mathbf{a} \cdot \mathbf{b}\right] = (1 - \lambda) \cdot b\left[ab - \mathbf{a} \cdot \mathbf{b}\right]

Since OO, AA, BB are not collinear, abab\mathbf{a} \cdot \mathbf{b} \neq ab (the angle between a\mathbf{a} and b\mathbf{b} is not zero), so we can divide both sides by ababab - \mathbf{a} \cdot \mathbf{b}:

λa=(1λ)b\lambda a = (1 - \lambda)b

λa+λb=b\lambda a + \lambda b = b

λ=ba+b\lambda = \frac{b}{a + b}

Alternatively, this follows immediately from the Angle Bisector Theorem: APPB=OAOB=ab\frac{AP}{PB} = \frac{OA}{OB} = \frac{a}{b}, so 1λλ=ab\frac{1 - \lambda}{\lambda} = \frac{a}{b}, giving λ=ba+b\lambda = \frac{b}{a + b}.

Proving OQ2OP2=(ba)2OQ^2 - OP^2 = (b - a)^2

Since AP=BQAP = BQ, and AP=(1λ)ABAP = (1 - \lambda) \cdot AB, we have BQ=(1λ)ABBQ = (1 - \lambda) \cdot AB. Since QQ lies on ABAB between AA and BB:

AQ=ABBQ=AB(1λ)AB=λAB.AQ = AB - BQ = AB - (1 - \lambda) \cdot AB = \lambda \cdot AB.

So AQ:QB=λ:(1λ)AQ : QB = \lambda : (1 - \lambda).

By the section formula:

q=(1λ)a+λb.\mathbf{q} = (1 - \lambda)\mathbf{a} + \lambda\mathbf{b}.

Now we compute OP2OP^2 and OQ2OQ^2:

OP2=pp=(λa+(1λ)b)(λa+(1λ)b)OP^2 = \mathbf{p} \cdot \mathbf{p} = (\lambda\mathbf{a} + (1 - \lambda)\mathbf{b}) \cdot (\lambda\mathbf{a} + (1 - \lambda)\mathbf{b})

=λ2a2+2λ(1λ)(ab)+(1λ)2b2.= \lambda^2 a^2 + 2\lambda(1 - \lambda)(\mathbf{a} \cdot \mathbf{b}) + (1 - \lambda)^2 b^2.

OQ2=qq=((1λ)a+λb)((1λ)a+λb)OQ^2 = \mathbf{q} \cdot \mathbf{q} = ((1 - \lambda)\mathbf{a} + \lambda\mathbf{b}) \cdot ((1 - \lambda)\mathbf{a} + \lambda\mathbf{b})

=(1λ)2a2+2λ(1λ)(ab)+λ2b2.= (1 - \lambda)^2 a^2 + 2\lambda(1 - \lambda)(\mathbf{a} \cdot \mathbf{b}) + \lambda^2 b^2.

Subtracting:

OQ2OP2=[(1λ)2a2+λ2b2][λ2a2+(1λ)2b2]OQ^2 - OP^2 = \left[(1 - \lambda)^2 a^2 + \lambda^2 b^2\right] - \left[\lambda^2 a^2 + (1 - \lambda)^2 b^2\right]

=a2[(1λ)2λ2]+b2[λ2(1λ)2]= a^2\left[(1 - \lambda)^2 - \lambda^2\right] + b^2\left[\lambda^2 - (1 - \lambda)^2\right]

=(b2a2)[λ2(1λ)2].= (b^2 - a^2)\left[\lambda^2 - (1 - \lambda)^2\right].

Expanding λ2(1λ)2=λ21+2λλ2=2λ1\lambda^2 - (1 - \lambda)^2 = \lambda^2 - 1 + 2\lambda - \lambda^2 = 2\lambda - 1.

So:

OQ2OP2=(b2a2)(2λ1).OQ^2 - OP^2 = (b^2 - a^2)(2\lambda - 1).

Substituting λ=ba+b\lambda = \frac{b}{a + b}:

2λ1=2ba+b1=2baba+b=baa+b.2\lambda - 1 = \frac{2b}{a + b} - 1 = \frac{2b - a - b}{a + b} = \frac{b - a}{a + b}.

Therefore:

OQ2OP2=(b2a2)baa+b=(ba)(b+a)baa+b=(ba)2.OQ^2 - OP^2 = (b^2 - a^2) \cdot \frac{b - a}{a + b} = (b - a)(b + a) \cdot \frac{b - a}{a + b} = (b - a)^2.

Examiner Notes

As with Q6, this was both an unpopular question and poorly done. Those candidates who did do well generally did so after spotting that they could use the Angle Bisector Theorem to polish off the first half of the question, expressing λ\lambda in terms of aa and bb almost immediately. Predominantly, the whole thing relied almost exclusively upon the use of the scalar product (or, alternatively, the Cosine Rule) and a bit of manipulation. The fact that the mean mark on this question was below 7 is simply indicative of the general lack of confidence amongst candidates where vectors are concerned.