Skip to content

STEP3 2007 -- Pure Mathematics

STEP3 2007 — Section A (Pure Mathematics)

Section titled “STEP3 2007 — Section A (Pure Mathematics)”

Exam: STEP3  |  Year: 2007  |  Questions: Q1—Q8  |  Total marks per question: 20

All questions are pure mathematics. Solutions and examiner commentary are included below.

QTopicDifficultyKey Techniques
1三角函数与多项式根 (Trigonometry and Polynomial Roots)Challenging复合角公式展开,韦达定理(根与系数关系),正切替换化为多项式
2级数与二项式定理 (Series and Binomial Theorem)Challenging阶乘表达式化简,二项式级数展开,幂级数逐项微分与积分,代入特定值求和
3斐波那契数列与数学归纳法 (Fibonacci Sequences and Mathematical Induction)Challenging数学归纳法,斐波那契递推关系,恒等式变形与化简
4参数方程与微分几何 (Parametric Equations and Differential Geometry)Challenging参数方程求导,链式法则,曲率公式,曲率中心计算
5双曲函数与高阶导数 (Hyperbolic Functions and Higher Derivatives)Hard双曲函数代换,隐函数求导,高阶导数计算,数学归纳法
6复数 (Complex Numbers)Hard复数极坐标形式,复数共轭运算,垂直条件转化
7积分 (Integration)Challenging变量代换,定积分拆分,函数方程,级数与积分联系
8微分方程 (Differential Equations)Challenging线性ODE通解,Riccati方程代换,初值条件代入

Topic: 三角函数与多项式根 (Trigonometry and Polynomial Roots)  |  Difficulty: Challenging  |  Marks: 20

1 In this question, do not consider the special cases in which the denominators of any of your expressions are zero.

Express tan(θ1+θ2+θ3+θ4)\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) in terms of tit_i, where t1=tanθ1t_1 = \tan \theta_1, etc.

Given that tanθ1,tanθ2,tanθ3\tan \theta_1, \tan \theta_2, \tan \theta_3 and tanθ4\tan \theta_4 are the four roots of the equation

at4+bt3+ct2+dt+e=0at^4 + bt^3 + ct^2 + dt + e = 0

(where a0a \neq 0), find an expression in terms of a,b,c,da, b, c, d and ee for tan(θ1+θ2+θ3+θ4)\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4).

The four real numbers θ1,θ2,θ3\theta_1, \theta_2, \theta_3 and θ4\theta_4 lie in the range 0θi<2π0 \le \theta_i < 2\pi and satisfy the equation

pcos2θ+cos(θα)+p=0,p \cos 2\theta + \cos(\theta - \alpha) + p = 0,

where pp and α\alpha are independent of θ\theta. Show that θ1+θ2+θ3+θ4=nπ\theta_1 + \theta_2 + \theta_3 + \theta_4 = n\pi for some integer nn.

Hint

The first result can be obtained by applying a compound angle formula to tan((θ1+θ2)+(θ3+θ4))\tan((\theta_1 + \theta_2) + (\theta_3 + \theta_4)) and then repeating the application to each of tan(θ1+θ2)\tan(\theta_1 + \theta_2) and tan(θ3+θ4)\tan(\theta_3 + \theta_4) where they appear. On simplification, this gives

tan(θ1+θ2+θ3+θ4)=t1+t2+t3+t4t2t3t4t3t4t1t4t1t2t1t2t31t1t2t1t3t1t4t2t3t2t4t3t4+t1t2t3t4.\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{t_1 + t_2 + t_3 + t_4 - t_2 t_3 t_4 - t_3 t_4 t_1 - t_4 t_1 t_2 - t_1 t_2 t_3}{1 - t_1 t_2 - t_1 t_3 - t_1 t_4 - t_2 t_3 - t_2 t_4 - t_3 t_4 + t_1 t_2 t_3 t_4} .

As tit_i, etc are the roots of the equation at4+bt3+ct2+dt+e=0at^4 + bt^3 + ct^2 + dt + e = 0, then at4+bt3+ct2+dt+e=a(tt1)(tt2)(tt3)(tt4)at^4 + bt^3 + ct^2 + dt + e = a(t - t_1)(t - t_2)(t - t_3)(t - t_4), which yields, from expansion and comparison of coefficients, the four results

t1+t2+t3+t4=ba,t1t2+t1t3+t1t4+t2t3+t2t4+t3t4=ca,t_1 + t_2 + t_3 + t_4 = \frac{-b}{a}, \quad t_1 t_2 + t_1 t_3 + t_1 t_4 + t_2 t_3 + t_2 t_4 + t_3 t_4 = \frac{c}{a}, t2t3t4+t3t4t1+t4t1t2+t1t2t3=da, and t1t2t3t4=ea.t_2 t_3 t_4 + t_3 t_4 t_1 + t_4 t_1 t_2 + t_1 t_2 t_3 = \frac{-d}{a}, \text{ and } t_1 t_2 t_3 t_4 = \frac{e}{a} .

These substituted in the first result lead to tan(θ1+θ2+θ3+θ4)=b+dac+e\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{-b + d}{a - c + e}.

Applying double and compound angle formulae to pcos2θ+cos(θα)+p=0p \cos 2\theta + \cos(\theta - \alpha) + p = 0 gives the equation 2pcos2θ+cosθcosα+sinθsinα=02p \cos^2 \theta + \cos \theta \cos \alpha + \sin \theta \sin \alpha = 0, which can be rearranged as cosα+tanθsinα=2psecθ.\cos \alpha + \tan \theta \sin \alpha = \frac{-2p}{\sec \theta} .

Squaring this and replacing tanθ\tan \theta by tt, (cosα+tsinα)2=4p21+t2(\cos \alpha + t \sin \alpha)^2 = \frac{4p^2}{1 + t^2}.

Rearranging this obtains the quartic equation t4sin2α+t3sin2α+t2+tsin2α+(cos2α4p2)=0t^4 \sin^2 \alpha + t^3 \sin 2\alpha + t^2 + t \sin 2\alpha + (\cos^2 \alpha - 4p^2) = 0, and so, from the second result tan(θ1+θ2+θ3+θ4)=04p2=0\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{0}{-4p^2} = 0, and thus θ1+θ2+θ3+θ4=nπ\theta_1 + \theta_2 + \theta_3 + \theta_4 = n\pi.

Model Solution

Expressing tan(θ1+θ2+θ3+θ4)\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) in terms of tit_i

We apply the compound angle formula tan(A+B)=tanA+tanB1tanAtanB\tan(A + B) = \frac{\tan A + \tan B}{1 - \tan A \tan B} repeatedly.

First, tan(θ1+θ2)=t1+t21t1t2\tan(\theta_1 + \theta_2) = \frac{t_1 + t_2}{1 - t_1 t_2} and tan(θ3+θ4)=t3+t41t3t4\tan(\theta_3 + \theta_4) = \frac{t_3 + t_4}{1 - t_3 t_4}.

Then

tan(θ1+θ2+θ3+θ4)=tan(θ1+θ2)+tan(θ3+θ4)1tan(θ1+θ2)tan(θ3+θ4).\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{\tan(\theta_1 + \theta_2) + \tan(\theta_3 + \theta_4)}{1 - \tan(\theta_1 + \theta_2)\tan(\theta_3 + \theta_4)}.

Let A=tan(θ1+θ2)=t1+t21t1t2A = \tan(\theta_1 + \theta_2) = \frac{t_1 + t_2}{1 - t_1 t_2} and B=tan(θ3+θ4)=t3+t41t3t4B = \tan(\theta_3 + \theta_4) = \frac{t_3 + t_4}{1 - t_3 t_4}. Then

A+B1AB=t1+t21t1t2+t3+t41t3t41(t1+t2)(t3+t4)(1t1t2)(1t3t4).\frac{A + B}{1 - AB} = \frac{\frac{t_1 + t_2}{1 - t_1 t_2} + \frac{t_3 + t_4}{1 - t_3 t_4}}{1 - \frac{(t_1 + t_2)(t_3 + t_4)}{(1 - t_1 t_2)(1 - t_3 t_4)}}.

Multiplying numerator and denominator by (1t1t2)(1t3t4)(1 - t_1 t_2)(1 - t_3 t_4):

=(t1+t2)(1t3t4)+(t3+t4)(1t1t2)(1t1t2)(1t3t4)(t1+t2)(t3+t4).= \frac{(t_1 + t_2)(1 - t_3 t_4) + (t_3 + t_4)(1 - t_1 t_2)}{(1 - t_1 t_2)(1 - t_3 t_4) - (t_1 + t_2)(t_3 + t_4)}.

Expanding the numerator:

(t1+t2)(t1+t2)t3t4+(t3+t4)(t3+t4)t1t2(t_1 + t_2) - (t_1 + t_2)t_3 t_4 + (t_3 + t_4) - (t_3 + t_4)t_1 t_2 =t1+t2+t3+t4t1t3t4t2t3t4t1t2t3t1t2t4.= t_1 + t_2 + t_3 + t_4 - t_1 t_3 t_4 - t_2 t_3 t_4 - t_1 t_2 t_3 - t_1 t_2 t_4.

Expanding the denominator:

1t1t2t3t4+t1t2t3t4t1t3t1t4t2t3t2t4.1 - t_1 t_2 - t_3 t_4 + t_1 t_2 t_3 t_4 - t_1 t_3 - t_1 t_4 - t_2 t_3 - t_2 t_4.

Therefore

tan(θ1+θ2+θ3+θ4)=S1S31S2+S4(i)\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{S_1 - S_3}{1 - S_2 + S_4} \qquad \text{(i)}

where S1=tiS_1 = \sum t_i, S2=titjS_2 = \sum t_i t_j, S3=titjtkS_3 = \sum t_i t_j t_k, S4=t1t2t3t4S_4 = t_1 t_2 t_3 t_4 are the elementary symmetric functions.

Using Vieta’s relations

Since t1,t2,t3,t4t_1, t_2, t_3, t_4 are roots of at4+bt3+ct2+dt+e=0at^4 + bt^3 + ct^2 + dt + e = 0, we have at4+bt3+ct2+dt+e=a(tt1)(tt2)(tt3)(tt4)at^4 + bt^3 + ct^2 + dt + e = a(t - t_1)(t - t_2)(t - t_3)(t - t_4). Expanding and comparing coefficients:

S1=t1+t2+t3+t4=ba,S2=titj=ca,S_1 = t_1 + t_2 + t_3 + t_4 = \frac{-b}{a}, \quad S_2 = \sum t_i t_j = \frac{c}{a}, S3=titjtk=da,S4=t1t2t3t4=ea.S_3 = \sum t_i t_j t_k = \frac{-d}{a}, \quad S_4 = t_1 t_2 t_3 t_4 = \frac{e}{a}.

Substituting into (i):

tan(θ1+θ2+θ3+θ4)=bada1ca+ea=b+dac+e.(ii)\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{\frac{-b}{a} - \frac{-d}{a}}{1 - \frac{c}{a} + \frac{e}{a}} = \frac{-b + d}{a - c + e}. \qquad \text{(ii)}

Showing θ1+θ2+θ3+θ4=nπ\theta_1 + \theta_2 + \theta_3 + \theta_4 = n\pi

Starting from pcos2θ+cos(θα)+p=0p\cos 2\theta + \cos(\theta - \alpha) + p = 0, we use cos2θ=2cos2θ1\cos 2\theta = 2\cos^2\theta - 1:

p(2cos2θ1)+cos(θα)+p=0,p(2\cos^2\theta - 1) + \cos(\theta - \alpha) + p = 0, 2pcos2θ+cos(θα)=0.2p\cos^2\theta + \cos(\theta - \alpha) = 0.

Expanding cos(θα)=cosθcosα+sinθsinα\cos(\theta - \alpha) = \cos\theta\cos\alpha + \sin\theta\sin\alpha:

2pcos2θ+cosθcosα+sinθsinα=0.2p\cos^2\theta + \cos\theta\cos\alpha + \sin\theta\sin\alpha = 0.

Dividing by cosθ\cos\theta (assuming cosθ0\cos\theta \neq 0; if cosθ=0\cos\theta = 0 the equation becomes sinα=0\sin\alpha = 0, a special case excluded by the problem):

2pcosθ+cosα+tanθsinα=0.2p\cos\theta + \cos\alpha + \tan\theta\sin\alpha = 0.

Since cosθ=1secθ=11+t2\cos\theta = \frac{1}{\sec\theta} = \frac{1}{\sqrt{1 + t^2}} where t=tanθt = \tan\theta, we rearrange:

cosα+tsinα=2p1+t2.\cos\alpha + t\sin\alpha = \frac{-2p}{\sqrt{1 + t^2}}.

Squaring both sides:

(cosα+tsinα)2=4p21+t2.(\cos\alpha + t\sin\alpha)^2 = \frac{4p^2}{1 + t^2}.

Multiplying by (1+t2)(1 + t^2):

(cosα+tsinα)2(1+t2)=4p2.(\cos\alpha + t\sin\alpha)^2(1 + t^2) = 4p^2.

Expanding the left side:

(cos2α+2tcosαsinα+t2sin2α)(1+t2)=4p2,(\cos^2\alpha + 2t\cos\alpha\sin\alpha + t^2\sin^2\alpha)(1 + t^2) = 4p^2,

cos2α+t2cos2α+2tcosαsinα+2t3cosαsinα+t2sin2α+t4sin2α=4p2.\cos^2\alpha + t^2\cos^2\alpha + 2t\cos\alpha\sin\alpha + 2t^3\cos\alpha\sin\alpha + t^2\sin^2\alpha + t^4\sin^2\alpha = 4p^2.

Collecting by powers of tt:

t4sin2α+t3sin2α+t2+tsin2α+(cos2α4p2)=0.(iii)t^4\sin^2\alpha + t^3\sin 2\alpha + t^2 + t\sin 2\alpha + (\cos^2\alpha - 4p^2) = 0. \qquad \text{(iii)}

This is a quartic in t=tanθt = \tan\theta. The four roots are t1=tanθ1,,t4=tanθ4t_1 = \tan\theta_1, \ldots, t_4 = \tan\theta_4.

Applying Vieta’s relations to (iii) with leading coefficient sin2α\sin^2\alpha:

S1=sin2αsin2α,S3=sin2αsin2α.S_1 = \frac{-\sin 2\alpha}{\sin^2\alpha}, \quad S_3 = \frac{-\sin 2\alpha}{\sin^2\alpha}.

Using formula (ii), where the coefficients of the quartic are a=sin2αa = \sin^2\alpha, b=sin2αb = \sin 2\alpha, c=1c = 1, d=sin2αd = \sin 2\alpha, e=cos2α4p2e = \cos^2\alpha - 4p^2:

tan(θ1+θ2+θ3+θ4)=b+dac+e=sin2α+sin2αsin2α1+cos2α4p2=04p2=0.\tan(\theta_1 + \theta_2 + \theta_3 + \theta_4) = \frac{-b + d}{a - c + e} = \frac{-\sin 2\alpha + \sin 2\alpha}{\sin^2\alpha - 1 + \cos^2\alpha - 4p^2} = \frac{0}{-4p^2} = 0.

Therefore θ1+θ2+θ3+θ4=nπ\theta_1 + \theta_2 + \theta_3 + \theta_4 = n\pi for some integer nn.

Examiner Notes

This question was popular. Many candidates did not simplify their first expression into the symmetrical form which made it harder for them to spot the use of the sums and products of roots results. A common slip was to make a 1 by default which also obscured what was going on. Most struggled to take the given equation requiring solution and produce a quartic equation in tt (tanθ\tan \theta), some producing a quartic equation in cosθ\cos \theta, and somehow expecting to use the earlier results.


Topic: 级数与二项式定理 (Series and Binomial Theorem)  |  Difficulty: Challenging  |  Marks: 20

2 (i) Show that 1.3.5.7..(2n1)=(2n)!2nn!1.3.5.7. \dots .(2n - 1) = \frac{(2n)!}{2^n n!} and that, for x<14|x| < \frac{1}{4},

114x=1+n=1(2n)!(n!)2xn.\frac{1}{\sqrt{1 - 4x}} = 1 + \sum_{n=1}^{\infty} \frac{(2n)!}{(n!)^2} x^n.

(ii) By differentiating the above result, deduce that

n=1(2n)!n!(n1)!(625)n=60.\sum_{n=1}^{\infty} \frac{(2n)!}{n! (n - 1)!} \left( \frac{6}{25} \right)^n = 60.

(iii) Show that

n=12n+1(2n)!32n(n+1)!n!=1.\sum_{n=1}^{\infty} \frac{2^{n+1}(2n)!}{3^{2n}(n + 1)! n!} = 1.

Hint

(i) 1.3.5.7.....(2n1)=1.2.3.4.....2n2.4.6.8.....2n=(2n)!2.1.2.2.2.3.2.4.....2.n=(2n)!2n.1.2.3.4.....n=(2n)!2nn!1.3.5.7.....(2n - 1) = \frac{1.2.3.4.....2n}{2.4.6.8.....2n} = \frac{(2n)!}{2.1.2.2.2.3.2.4.....2.n} = \frac{(2n)!}{2^n.1.2.3.4.....n} = \frac{(2n)!}{2^n n!}

Using the binomial theorem, which is valid given the condition x<14|x| < \frac{1}{4},

(14x)12=1+122(4x)+12322!(4x)2+...(1-4x)^{-\frac{1}{2}} = 1 + \frac{-\frac{1}{2}}{2}(-4x) + \frac{\frac{-1}{2} \cdot \frac{-3}{2}}{2!}(-4x)^2 + ... =1+1.(2x)+1.32!(2x)2+...+1.3.5.7...(2n1)n!(2x)n+...= 1 + 1.(2x) + \frac{1.3}{2!}(2x)^2 + ... + \frac{1.3.5.7...(2n - 1)}{n!}(2x)^n + ...

So the first result of the question yields (14x)12=1+n=1(2n)!2nn!(2x)nn!(1 - 4x)^{-\frac{1}{2}} = 1 + \sum_{n=1}^{\infty} \frac{\frac{(2n)!}{2^n n!}(2x)^n}{n!} leading to the required expression.

(ii) Differentiating (14x)12=1+n=1(2n)!xn(n!)2(1 - 4x)^{-\frac{1}{2}} = 1 + \sum_{n=1}^{\infty} \frac{(2n)!x^n}{(n!)^2} with respect to xx, and

multiplying the result by xx gives 2x(14x)32=n=1(2n)!xnn!(n1)!\frac{2x}{(1 - 4x)^{\frac{3}{2}}} = \sum_{n=1}^{\infty} \frac{(2n)!x^n}{n!(n - 1)!} and substituting x=625<14x = \frac{6}{25} < \frac{1}{4}, gives the desired result.

(iii) Integrating (14x)12=1+n=1(2n)!xn(n!)2(1 - 4x)^{-\frac{1}{2}} = 1 + \sum_{n=1}^{\infty} \frac{(2n)!x^n}{(n!)^2} with respect to xx, gives

12(14x)12=x+n=1(2n)!xn+1(n+1)!n!+c-\frac{1}{2}(1 - 4x)^{\frac{1}{2}} = x + \sum_{n=1}^{\infty} \frac{(2n)!x^{n+1}}{(n + 1)!n!} + c, and substituting x=0<14x = 0 < \frac{1}{4}, gives c=12c = -\frac{1}{2}.

Now substituting x=29=232<14x = \frac{2}{9} = \frac{2}{3^2} < \frac{1}{4} and simplifying, gives the desired result.

Model Solution

Part (i)

We show that 1357(2n1)=(2n)!2nn!1 \cdot 3 \cdot 5 \cdot 7 \cdots (2n-1) = \frac{(2n)!}{2^n n!}.

135(2n1)=1234(2n)246(2n)=(2n)!212232n=(2n)!2n(123n)=(2n)!2nn!.1 \cdot 3 \cdot 5 \cdots (2n-1) = \frac{1 \cdot 2 \cdot 3 \cdot 4 \cdots (2n)}{2 \cdot 4 \cdot 6 \cdots (2n)} = \frac{(2n)!}{2 \cdot 1 \cdot 2 \cdot 2 \cdot 3 \cdots 2 \cdot n} = \frac{(2n)!}{2^n(1 \cdot 2 \cdot 3 \cdots n)} = \frac{(2n)!}{2^n \, n!}.

Now we prove the series expansion. By the binomial theorem, for 4x<1|4x| < 1 (i.e. x<14|x| < \frac{1}{4}):

(14x)1/2=n=0(1/2n)(4x)n.(1 - 4x)^{-1/2} = \sum_{n=0}^{\infty} \binom{-1/2}{n}(-4x)^n.

The binomial coefficient is:

(1/2n)=(12)(32)(2n12)n!=(1)n135(2n1)2nn!.\binom{-1/2}{n} = \frac{(-\tfrac{1}{2})(-\tfrac{3}{2}) \cdots (-\tfrac{2n-1}{2})}{n!} = \frac{(-1)^n \cdot 1 \cdot 3 \cdot 5 \cdots (2n-1)}{2^n \, n!}.

Therefore the nn-th term (for n1n \ge 1) is:

(1)n13(2n1)2nn!(4x)n=(1)n13(2n1)2nn!(1)n4nxn=13(2n1)22n2nn!xn=13(2n1)2nn!xn.\frac{(-1)^n \cdot 1 \cdot 3 \cdots (2n-1)}{2^n \, n!} \cdot (-4x)^n = \frac{(-1)^n \cdot 1 \cdot 3 \cdots (2n-1)}{2^n \, n!} \cdot (-1)^n \cdot 4^n \cdot x^n = \frac{1 \cdot 3 \cdots (2n-1) \cdot 2^{2n}}{2^n \, n!} x^n = \frac{1 \cdot 3 \cdots (2n-1) \cdot 2^n}{n!} x^n.

Using the identity just proved, 13(2n1)=(2n)!2nn!1 \cdot 3 \cdots (2n-1) = \frac{(2n)!}{2^n \, n!}, the nn-th term becomes:

(2n)!2nn!2nn!xn=(2n)!(n!)2xn.\frac{(2n)!}{2^n \, n!} \cdot \frac{2^n}{n!} x^n = \frac{(2n)!}{(n!)^2} x^n.

Hence

114x=1+n=1(2n)!(n!)2xn.(i)\frac{1}{\sqrt{1 - 4x}} = 1 + \sum_{n=1}^{\infty} \frac{(2n)!}{(n!)^2} x^n. \qquad \text{(i)}

Part (ii)

Differentiating (i) with respect to xx:

ddx(14x)1/2=2(14x)3/2.\frac{\mathrm{d}}{\mathrm{d}x}(1 - 4x)^{-1/2} = \frac{2}{(1 - 4x)^{3/2}}.

On the right side, differentiating term by term:

n=1(2n)!(n!)2nxn1=n=1(2n)!n!(n1)!xn1.\sum_{n=1}^{\infty} \frac{(2n)!}{(n!)^2} \cdot n \, x^{n-1} = \sum_{n=1}^{\infty} \frac{(2n)!}{n! \, (n-1)!} x^{n-1}.

Therefore

2(14x)3/2=n=1(2n)!n!(n1)!xn1.\frac{2}{(1 - 4x)^{3/2}} = \sum_{n=1}^{\infty} \frac{(2n)!}{n! \, (n-1)!} x^{n-1}.

Multiplying both sides by xx:

2x(14x)3/2=n=1(2n)!n!(n1)!xn.(ii)\frac{2x}{(1 - 4x)^{3/2}} = \sum_{n=1}^{\infty} \frac{(2n)!}{n! \, (n-1)!} x^n. \qquad \text{(ii)}

Substituting x=625x = \frac{6}{25}:

14625=12425=125,1 - 4 \cdot \frac{6}{25} = 1 - \frac{24}{25} = \frac{1}{25},

so (14x)3/2=(125)3/2=1125(1 - 4x)^{3/2} = \left(\frac{1}{25}\right)^{3/2} = \frac{1}{125}.

n=1(2n)!n!(n1)!(625)n=26251125=12/251/125=1225125=60.\sum_{n=1}^{\infty} \frac{(2n)!}{n!(n-1)!}\left(\frac{6}{25}\right)^n = \frac{2 \cdot \frac{6}{25}}{\frac{1}{125}} = \frac{12/25}{1/125} = \frac{12}{25} \cdot 125 = 60.

Part (iii)

We integrate (i) with respect to xx:

dx14x=(1+n=1(2n)!(n!)2xn)dx.\int \frac{\mathrm{d}x}{\sqrt{1 - 4x}} = \int \left(1 + \sum_{n=1}^{\infty} \frac{(2n)!}{(n!)^2} x^n\right) \mathrm{d}x.

The left side: let u=14xu = 1 - 4x, so du=4dx\mathrm{d}u = -4\,\mathrm{d}x:

(14x)1/2dx=142(14x)1/2=12(14x)1/2.\int (1 - 4x)^{-1/2} \mathrm{d}x = -\frac{1}{4} \cdot 2(1 - 4x)^{1/2} = -\frac{1}{2}(1 - 4x)^{1/2}.

The right side:

x+n=1(2n)!(n!)2xn+1n+1+c=x+n=1(2n)!(n+1)!n!xn+1+c.x + \sum_{n=1}^{\infty} \frac{(2n)!}{(n!)^2} \cdot \frac{x^{n+1}}{n+1} + c = x + \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} x^{n+1} + c.

Setting x=0x = 0: 12=0+0+c-\frac{1}{2} = 0 + 0 + c, so c=12c = -\frac{1}{2}.

Therefore

12(14x)1/2=x+n=1(2n)!(n+1)!n!xn+112.(iii)-\frac{1}{2}(1 - 4x)^{1/2} = x + \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} x^{n+1} - \frac{1}{2}. \qquad \text{(iii)}

Substituting x=29x = \frac{2}{9}:

1429=189=19,1 - 4 \cdot \frac{2}{9} = 1 - \frac{8}{9} = \frac{1}{9},

so (14x)1/2=13(1 - 4x)^{1/2} = \frac{1}{3}.

1213=29+n=1(2n)!(n+1)!n!(29)n+112,-\frac{1}{2} \cdot \frac{1}{3} = \frac{2}{9} + \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^{n+1} - \frac{1}{2},

16=2912+n=1(2n)!(n+1)!n!(29)n+1,-\frac{1}{6} = \frac{2}{9} - \frac{1}{2} + \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^{n+1},

16=518+n=1(2n)!(n+1)!n!(29)n+1,-\frac{1}{6} = -\frac{5}{18} + \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^{n+1},

n=1(2n)!(n+1)!n!(29)n+1=16+518=3+518=218=19.\sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^{n+1} = -\frac{1}{6} + \frac{5}{18} = \frac{-3 + 5}{18} = \frac{2}{18} = \frac{1}{9}.

Now observe that

n=12n+1(2n)!32n(n+1)!n!=n=1(2n)!(n+1)!n!2n+19n=2n=1(2n)!(n+1)!n!(29)n+19212n2n9n.\sum_{n=1}^{\infty} \frac{2^{n+1}(2n)!}{3^{2n}(n+1)! \, n!} = \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \cdot \frac{2^{n+1}}{9^n} = 2\sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^{n+1} \cdot \frac{9}{2} \cdot \frac{1}{2^n} \cdot \frac{2^n}{9^n}.

Actually, more directly: 2n+132n=22n9n=2(29)n\frac{2^{n+1}}{3^{2n}} = \frac{2 \cdot 2^n}{9^n} = 2 \cdot \left(\frac{2}{9}\right)^n, so

n=12n+1(2n)!32n(n+1)!n!=2n=1(2n)!(n+1)!n!(29)n=292n=1(2n)!(n+1)!n!(29)n+1=919=1.\sum_{n=1}^{\infty} \frac{2^{n+1}(2n)!}{3^{2n}(n+1)! \, n!} = 2\sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^n = 2 \cdot \frac{9}{2} \sum_{n=1}^{\infty} \frac{(2n)!}{(n+1)! \, n!} \left(\frac{2}{9}\right)^{n+1} = 9 \cdot \frac{1}{9} = 1.

Examiner Notes

This question was popular though not well answered. Solutions to part (i) were frequently unconvincing, though to part (ii) were quite good if they avoided elementary errors in working. Part (iii) was less well attempted with some not spotting to use integration, some stumbling over "+c+ c" and some not spotting the value of xx to substitute.


Topic: 斐波那契数列与数学归纳法 (Fibonacci Sequences and Mathematical Induction)  |  Difficulty: Challenging  |  Marks: 20

3 A sequence of numbers, F1,F2,F_1, F_2, \dots, is defined by F1=1,F2=1F_1 = 1, F_2 = 1, and

Fn=Fn1+Fn2for n3.F_n = F_{n-1} + F_{n-2} \quad \text{for } n \ge 3.

(i) Write down the values of F3,F4,,F8F_3, F_4, \dots, F_8.

(ii) Prove that F2k+3F2k+1F2k+22=F2k+2F2k+F2k+12F_{2k+3}F_{2k+1} - F_{2k+2}^2 = -F_{2k+2}F_{2k} + F_{2k+1}^2.

(iii) Prove by induction or otherwise that F2n+1F2n1F2n2=1F_{2n+1}F_{2n-1} - F_{2n}^2 = 1 and deduce that F2n2+1F_{2n}^2 + 1 is divisible by F2n+1F_{2n+1}.

(iv) Prove that F2n12+1F_{2n-1}^2 + 1 is divisible by F2n+1F_{2n+1}.

Hint

(i) F3=2,F4=3,F5=5,F6=8,F7=13,F8=21F_3 = 2, F_4 = 3, F_5 = 5, F_6 = 8, F_7 = 13, F_8 = 21

(ii) The result requires no term beyond F2k+2F_{2k+2} should appear on the RHS so the first strategy is to replace F2k+3F_{2k+3} and hence

F2k+3F2k+1F2k+22=(F2k+2+F2k+1)F2k+1F2k+22=(F2k+1F2k+2)F2k+2+F2k+12=F2kF2k+2+F2k+12F_{2k+3}F_{2k+1} - {F_{2k+2}}^2 = (F_{2k+2} + F_{2k+1})F_{2k+1} - {F_{2k+2}}^2 = (F_{2k+1} - F_{2k+2})F_{2k+2} + {F_{2k+1}}^2 = -F_{2k}F_{2k+2} + {F_{2k+1}}^2 as required.

(iii) The initial case is trivial to demonstrate, and so the induction runs from assuming that F2k+1F2k1F2k2=1F_{2k+1}F_{2k-1} - {F_{2k}}^2 = 1, and attempting to prove that

F2(k+1)+1F2(k+1)1F2(k+1)2=1F_{2(k+1)+1}F_{2(k+1)-1} - {F_{2(k+1)}}^2 = 1. F2(k+1)+1F2(k+1)1F2(k+1)2=F2k+3F2k+1F2k+22=F2kF2k+2+F2k+12F_{2(k+1)+1}F_{2(k+1)-1} - {F_{2(k+1)}}^2 = F_{2k+3}F_{2k+1} - {F_{2k+2}}^2 = -F_{2k}F_{2k+2} + {F_{2k+1}}^2 from (ii)

=(F2k1F2k+1+F2k2)= -(F_{2k-1}F_{2k+1} + {F_{2k}}^2) by a similar argument to (ii) =(1)= -(-1) by inductive hypothesis.

The deduction follows from adding F2n2{F_{2n}}^2 to both sides of the result just proved.

(iv) This result cannot be deduced directly from (iii) as the nature of the expression differs in the type of subscript. Thus consider

F2n12+1=(F2n+1F2n)2+1=F2n+122F2n+1F2n+F2n2+1=F2n+122F2n+1F2n+F2n1F2n+1{F_{2n-1}}^2 + 1 = \left( F_{2n+1} - F_{2n} \right)^2 + 1 = {F_{2n+1}}^2 - 2F_{2n+1}F_{2n} + {F_{2n}}^2 + 1 = {F_{2n+1}}^2 - 2F_{2n+1}F_{2n} + F_{2n-1}F_{2n+1} from (iii) and hence the desired result is obtained.

Model Solution

Part (i)

F3=F2+F1=2,F4=F3+F2=3,F5=F4+F3=5,F_3 = F_2 + F_1 = 2, \quad F_4 = F_3 + F_2 = 3, \quad F_5 = F_4 + F_3 = 5, F6=F5+F4=8,F7=F6+F5=13,F8=F7+F6=21.F_6 = F_5 + F_4 = 8, \quad F_7 = F_6 + F_5 = 13, \quad F_8 = F_7 + F_6 = 21.

Part (ii)

Using F2k+3=F2k+2+F2k+1F_{2k+3} = F_{2k+2} + F_{2k+1} (the Fibonacci recurrence):

F2k+3F2k+1F2k+22=(F2k+2+F2k+1)F2k+1F2k+22F_{2k+3}F_{2k+1} - F_{2k+2}^2 = (F_{2k+2} + F_{2k+1})F_{2k+1} - F_{2k+2}^2 =F2k+2F2k+1+F2k+12F2k+22= F_{2k+2}F_{2k+1} + F_{2k+1}^2 - F_{2k+2}^2 =F2k+12+F2k+2(F2k+1F2k+2).= F_{2k+1}^2 + F_{2k+2}(F_{2k+1} - F_{2k+2}).

Since F2k+2=F2k+1+F2kF_{2k+2} = F_{2k+1} + F_{2k}, we have F2k+1F2k+2=F2kF_{2k+1} - F_{2k+2} = -F_{2k}. Therefore

F2k+3F2k+1F2k+22=F2k+12F2k+2F2k.(ii)F_{2k+3}F_{2k+1} - F_{2k+2}^2 = F_{2k+1}^2 - F_{2k+2}F_{2k}. \qquad \text{(ii)}

Part (iii)

We prove by induction that F2n+1F2n1F2n2=1F_{2n+1}F_{2n-1} - F_{2n}^2 = 1 for all n1n \ge 1.

Base case (n=1n = 1): F3F1F22=2112=1F_3 F_1 - F_2^2 = 2 \cdot 1 - 1^2 = 1. True.

Inductive step: Assume F2k+1F2k1F2k2=1F_{2k+1}F_{2k-1} - F_{2k}^2 = 1 for some k1k \ge 1. We wish to show F2k+3F2k+1F2k+22=1F_{2k+3}F_{2k+1} - F_{2k+2}^2 = 1.

By result (ii):

F2k+3F2k+1F2k+22=F2k+12F2k+2F2k.F_{2k+3}F_{2k+1} - F_{2k+2}^2 = F_{2k+1}^2 - F_{2k+2}F_{2k}.

Now we evaluate F2k+2F2kF_{2k+2}F_{2k} using a similar trick. Since F2k+2=F2k+1+F2kF_{2k+2} = F_{2k+1} + F_{2k}:

F2k+2F2k=(F2k+1+F2k)F2k=F2k+1F2k+F2k2.F_{2k+2}F_{2k} = (F_{2k+1} + F_{2k})F_{2k} = F_{2k+1}F_{2k} + F_{2k}^2.

So

F2k+12F2k+2F2k=F2k+12F2k+1F2kF2k2=F2k+1(F2k+1F2k)F2k2.F_{2k+1}^2 - F_{2k+2}F_{2k} = F_{2k+1}^2 - F_{2k+1}F_{2k} - F_{2k}^2 = F_{2k+1}(F_{2k+1} - F_{2k}) - F_{2k}^2.

Since F2k+1F2k=F2k1F_{2k+1} - F_{2k} = F_{2k-1}:

=F2k+1F2k1F2k2=1= F_{2k+1}F_{2k-1} - F_{2k}^2 = 1

by the inductive hypothesis. This completes the induction.

Deduction: From F2n+1F2n1F2n2=1F_{2n+1}F_{2n-1} - F_{2n}^2 = 1, adding F2n2F_{2n}^2 to both sides:

F2n2+1=F2n+1F2n1.F_{2n}^2 + 1 = F_{2n+1}F_{2n-1}.

Since F2n1F_{2n-1} is an integer, F2n2+1F_{2n}^2 + 1 is divisible by F2n+1F_{2n+1}.

Part (iv)

We need to show F2n+1F2n12+1F_{2n+1} \mid F_{2n-1}^2 + 1.

Since F2n+1=F2n+F2n1F_{2n+1} = F_{2n} + F_{2n-1}, we have F2n1=F2n+1F2nF_{2n-1} = F_{2n+1} - F_{2n}. Therefore

F2n12+1=(F2n+1F2n)2+1=F2n+122F2n+1F2n+F2n2+1.F_{2n-1}^2 + 1 = (F_{2n+1} - F_{2n})^2 + 1 = F_{2n+1}^2 - 2F_{2n+1}F_{2n} + F_{2n}^2 + 1.

From part (iii), F2n2+1=F2n+1F2n1F_{2n}^2 + 1 = F_{2n+1}F_{2n-1}. Substituting:

F2n12+1=F2n+122F2n+1F2n+F2n+1F2n1=F2n+1(F2n+12F2n+F2n1).F_{2n-1}^2 + 1 = F_{2n+1}^2 - 2F_{2n+1}F_{2n} + F_{2n+1}F_{2n-1} = F_{2n+1}(F_{2n+1} - 2F_{2n} + F_{2n-1}).

Since F2n+12F2n+F2n1=(F2n+F2n1)2F2n+F2n1=2F2n1F2nF_{2n+1} - 2F_{2n} + F_{2n-1} = (F_{2n} + F_{2n-1}) - 2F_{2n} + F_{2n-1} = 2F_{2n-1} - F_{2n}, which is an integer, we conclude F2n+1F_{2n+1} divides F2n12+1F_{2n-1}^2 + 1.

Examiner Notes

This question was popular. Many solutions to part (ii) were rambling and lacked a sense of direction, even if correct. The induction in (iii) was frequently incorrectly handled and a common error was to replace nn by k/2k/2. Part (iv) caused difficulties.


Topic: 参数方程与微分几何 (Parametric Equations and Differential Geometry)  |  Difficulty: Challenging  |  Marks: 20

4 A curve is given parametrically by

x=a(cost+lntan12t),x = a(\cos t + \ln \tan \tfrac{1}{2}t), y=asint,y = a \sin t,

where 0<t<12π0 < t < \frac{1}{2}\pi and aa is a positive constant. Show that dydx=tant\frac{\mathrm{d}y}{\mathrm{d}x} = \tan t and sketch the curve.

Let PP be the point with parameter tt and let QQ be the point where the tangent to the curve at PP meets the xx-axis. Show that PQ=aPQ = a.

The radius of curvature, ρ\rho, at PP is defined by

ρ=(x˙2+y˙2)32x˙y¨y˙x¨,\rho = \frac{(\dot{x}^2 + \dot{y}^2)^{\frac{3}{2}}}{|\dot{x}\ddot{y} - \dot{y}\ddot{x}|},

where the dots denote differentiation with respect to tt. Show that ρ=acott\rho = a \cot t.

The point CC lies on the normal to the curve at PP, a distance ρ\rho from PP and above the curve. Show that CQCQ is parallel to the yy-axis.

Hint

y=asinty˙=acosty = a \sin t \Rightarrow \dot{y} = a \cos t

x=a(cost+lntant2)x˙=a(sint+12sec2t2tant2)=a(sint+csct)=acostcottx = a \left( \cos t + \ln \tan \frac{t}{2} \right) \Rightarrow \dot{x} = a \left( -\sin t + \frac{\frac{1}{2} \sec^2 \frac{t}{2}}{\tan \frac{t}{2}} \right) = a(-\sin t + \csc t) = a \cos t \cot t

giving dydx=tant\frac{dy}{dx} = \tan t.

(y intercept aa, y axis tangential to curve, x axis asymptote)

Tangent is yasint=tant(xa(cost+lntant2))y - a \sin t = \tan t \left( x - a \left( \cos t + \ln \tan \frac{t}{2} \right) \right) giving QQ as (alntant2,0)\left( a \ln \tan \frac{t}{2}, 0 \right) and

thus PQ=(acost)2+(asint)2=aPQ = \sqrt{(a \cos t)^2 + (a \sin t)^2} = a

y˙=acosty¨=asint\dot{y} = a \cos t \Rightarrow \ddot{y} = -a \sin t

x˙=a(sint+csct)x¨=a(costcsctcott)\dot{x} = a(-\sin t + \csc t) \Rightarrow \ddot{x} = a(-\cos t - \csc t \cot t)

x˙2+y˙2=(acostcott)2+(acost)2=a2cot2t\dot{x}^2 + \dot{y}^2 = (a \cos t \cot t)^2 + (a \cos t)^2 = a^2 \cot^2 t

x˙y¨y˙x¨=acostcott×asintacost×a(costcsctcott)\dot{x} \ddot{y} - \dot{y} \ddot{x} = a \cos t \cot t \times -a \sin t - a \cos t \times a(-\cos t - \csc t \cot t)

=a2(cos2t+cos2t+cot2t)=a2cot2t= a^2 (-\cos^2 t + \cos^2 t + \cot^2 t) = a^2 \cot^2 t

giving ρ=acott\rho = a \cot t.

From the results for dydx\frac{dy}{dx} and ρ\rho, CC is

(a(cost+lntant2)ρsint,asint+ρcost)=(alntant2,acosect)\left( a \left( \cos t + \ln \tan \frac{t}{2} \right) - \rho \sin t, a \sin t + \rho \cos t \right) = \left( a \ln \tan \frac{t}{2}, a \operatorname{cosec} t \right)

Which has the same xx coordinate as QQ.

Model Solution

Showing dydx=tant\frac{\mathrm{d}y}{\mathrm{d}x} = \tan t

We have x=a(cost+lntant2)x = a(\cos t + \ln \tan \frac{t}{2}) and y=asinty = a\sin t.

y˙=acost.\dot{y} = a\cos t.

For x˙\dot{x}:

x˙=a(sint+1tant2sec2t212)=a(sint+12sint2cost2)=a(sint+1sint)=asin2t+1sint=acos2tsint.\dot{x} = a\left(-\sin t + \frac{1}{\tan \frac{t}{2}} \cdot \sec^2\frac{t}{2} \cdot \frac{1}{2}\right) = a\left(-\sin t + \frac{1}{2\sin\frac{t}{2}\cos\frac{t}{2}}\right) = a\left(-\sin t + \frac{1}{\sin t}\right) = a \cdot \frac{-\sin^2 t + 1}{\sin t} = \frac{a\cos^2 t}{\sin t}.

Therefore

dydx=y˙x˙=acostacos2tsint=sintcost=tant.\frac{\mathrm{d}y}{\mathrm{d}x} = \frac{\dot{y}}{\dot{x}} = \frac{a\cos t}{\frac{a\cos^2 t}{\sin t}} = \frac{\sin t}{\cos t} = \tan t.

Sketch of the curve

At t0+t \to 0^+: y0y \to 0 and xa(1+lntan0+)x \to a(-1 + \ln \tan 0^+) \to -\infty (since lntant2\ln \tan \frac{t}{2} \to -\infty). At t=π2t = \frac{\pi}{2}: y=ay = a and x=a(0+lntanπ4)=a0=0x = a(0 + \ln \tan \frac{\pi}{4}) = a \cdot 0 = 0. The curve approaches y=ay = a asymptotically as tπ2t \to \frac{\pi}{2}, with the yy-axis tangent to the curve at (0,a)(0, a). The xx-axis is a horizontal asymptote.

Showing PQ=aPQ = a

The tangent at PP (with parameter tt) has gradient tant\tan t. The equation of the tangent is:

yasint=tant(xacostalntant2).y - a\sin t = \tan t \left(x - a\cos t - a\ln\tan\tfrac{t}{2}\right).

Setting y=0y = 0 to find QQ:

asint=tant(xQacostalntant2),-a\sin t = \tan t \left(x_Q - a\cos t - a\ln\tan\tfrac{t}{2}\right),

xQ=acost+alntant2asinttant=acost+alntant2acost=alntant2.x_Q = a\cos t + a\ln\tan\tfrac{t}{2} - \frac{a\sin t}{\tan t} = a\cos t + a\ln\tan\tfrac{t}{2} - a\cos t = a\ln\tan\tfrac{t}{2}.

So Q=(alntant2,0)Q = (a\ln\tan\frac{t}{2}, 0). Now P=(acost+alntant2,asint)P = (a\cos t + a\ln\tan\frac{t}{2}, a\sin t), so

PQ=(acost)2+(asint)2=a2(cos2t+sin2t)=a.PQ = \sqrt{(a\cos t)^2 + (a\sin t)^2} = \sqrt{a^2(\cos^2 t + \sin^2 t)} = a.

Showing ρ=acott\rho = a\cot t

We already have x˙=acos2tsint=acostcott\dot{x} = \frac{a\cos^2 t}{\sin t} = a\cos t\cot t and y˙=acost\dot{y} = a\cos t.

Second derivatives:

y¨=asint.\ddot{y} = -a\sin t.

x¨=a(sintcott+cost(csc2t))=a(sin2tsintcostsin2t)=a(costcostsin2t)=acost(1+csc2t).\ddot{x} = a(-\sin t \cdot \cot t + \cos t \cdot (-\csc^2 t)) = a\left(\frac{-\sin^2 t}{\sin t} - \frac{\cos t}{\sin^2 t}\right) = a\left(-\cos t - \frac{\cos t}{\sin^2 t}\right) = -a\cos t\left(1 + \csc^2 t\right).

Actually, let me compute more carefully. x˙=a(sint+csct)\dot{x} = a(-\sin t + \csc t), so

x¨=a(costcsctcott).\ddot{x} = a(-\cos t - \csc t\cot t).

Now:

x˙2+y˙2=a2cos2tcot2t+a2cos2t=a2cos2t(cot2t+1)=a2cos2tcsc2t=a2cot2t.\dot{x}^2 + \dot{y}^2 = a^2\cos^2 t\cot^2 t + a^2\cos^2 t = a^2\cos^2 t(\cot^2 t + 1) = a^2\cos^2 t \cdot \csc^2 t = a^2\cot^2 t.

So (x˙2+y˙2)3/2=a3cot3t(\dot{x}^2 + \dot{y}^2)^{3/2} = a^3\cot^3 t (taking absolute value, noting cott>0\cot t > 0 for 0<t<π20 < t < \frac{\pi}{2}).

For the numerator of ρ\rho:

x˙y¨y˙x¨=acostcott(asint)acosta(costcsctcott)\dot{x}\ddot{y} - \dot{y}\ddot{x} = a\cos t\cot t \cdot (-a\sin t) - a\cos t \cdot a(-\cos t - \csc t\cot t)

=a2cos2ta2cost(costcsctcott)= -a^2\cos^2 t - a^2\cos t(-\cos t - \csc t\cot t)

=a2cos2t+a2cos2t+a2costcsctcott=a2costsintcostsint=a2cot2t.= -a^2\cos^2 t + a^2\cos^2 t + a^2\cos t \cdot \csc t \cot t = a^2 \cdot \frac{\cos t}{\sin t} \cdot \frac{\cos t}{\sin t} = a^2\cot^2 t.

Therefore

ρ=a3cot3ta2cot2t=acott.\rho = \frac{a^3\cot^3 t}{a^2\cot^2 t} = a\cot t.

Showing CQCQ is parallel to the yy-axis

The normal at PP has gradient cott-\cot t (negative reciprocal of tant\tan t). The centre of curvature CC lies on the normal at distance ρ=acott\rho = a\cot t from PP, on the side towards which the curve is concave (above the curve, i.e. the side of increasing yy).

The unit normal pointing towards the centre of curvature has components (sint,cost)1\frac{(-\sin t, \cos t)}{1} (rotating the tangent direction (cost,sint)(\cos t, \sin t) by 9090^\circ). So

C=P+ρ(sint,cost)=(acost+alntant2acottsint,  asint+acottcost).C = P + \rho(-\sin t, \cos t) = (a\cos t + a\ln\tan\tfrac{t}{2} - a\cot t \cdot \sin t, \; a\sin t + a\cot t \cdot \cos t).

The xx-coordinate of CC:

xC=acost+alntant2acost=alntant2.x_C = a\cos t + a\ln\tan\tfrac{t}{2} - a\cos t = a\ln\tan\tfrac{t}{2}.

The yy-coordinate of CC:

yC=asint+acos2tsint=asin2t+acos2tsint=asint=acsct.y_C = a\sin t + \frac{a\cos^2 t}{\sin t} = \frac{a\sin^2 t + a\cos^2 t}{\sin t} = \frac{a}{\sin t} = a\csc t.

So C=(alntant2,acsct)C = (a\ln\tan\frac{t}{2}, a\csc t). Since Q=(alntant2,0)Q = (a\ln\tan\frac{t}{2}, 0), both CC and QQ have xx-coordinate alntant2a\ln\tan\frac{t}{2}. Therefore CQCQ is parallel to the yy-axis.

Examiner Notes

This question was quite popular. A lot of attempts involved rambling trigonometrical manipulations, and few spotted the standard differential of lntant2\ln \tan \frac{t}{2}. The curve sketch was often omitted or incorrect, and there was a lot of complicated working using e.g. the equation of the normal etc. to find the centre of curvature.


Topic: 双曲函数与高阶导数 (Hyperbolic Functions and Higher Derivatives)  |  Difficulty: Hard  |  Marks: 20

5 Let y=ln(x21)y = \ln(x^2 - 1), where x>1x > 1, and let rr and θ\theta be functions of xx determined by r=x21r = \sqrt{x^2 - 1} and cothθ=x\coth \theta = x. Show that

dydx=2coshθrandd2ydx2=2cosh2θr2,\frac{\mathrm{d}y}{\mathrm{d}x} = \frac{2 \cosh \theta}{r} \quad \text{and} \quad \frac{\mathrm{d}^2y}{\mathrm{d}x^2} = -\frac{2 \cosh 2\theta}{r^2},

and find an expression in terms of rr and θ\theta for d3ydx3\frac{\mathrm{d}^3y}{\mathrm{d}x^3}.

Find, with proof, a similar formula for dnydxn\frac{\mathrm{d}^ny}{\mathrm{d}x^n} in terms of rr and θ\theta.

Hint

drdx=x(x21)12=coshθ\frac{dr}{dx} = x(x^2 - 1)^{-\frac{1}{2}} = \cosh \theta

y=lnr2=2lnry = \ln r^2 = 2 \ln r

So dydx=2rdrdx=2coshθr\frac{dy}{dx} = \frac{2}{r} \frac{dr}{dx} = \frac{2 \cosh \theta}{r}

dxdθ=cosech2θ\frac{dx}{d\theta} = -\operatorname{cosech}^2 \theta and r=cosechθr = \operatorname{cosech} \theta,

So differentiating the previous result and substituting,

d2ydx2=2rsinhθdθdx2coshθdrdxr2=2(cosechθsinhθ×sinh2θcoshθcoshθ)r2=2cosh2θr2\frac{d^2 y}{dx^2} = \frac{2r \sinh \theta \frac{d\theta}{dx} - 2 \cosh \theta \frac{dr}{dx}}{r^2} = \frac{2(\operatorname{cosech} \theta \sinh \theta \times -\sinh^2 \theta - \cosh \theta \cosh \theta)}{r^2} = -\frac{2 \cosh 2\theta}{r^2}

Similarly,

d3ydx3=2r22sinh2θdθdx2cosh2θ×2rdrdxr4=4r4(sinh2θ+cosh2θcothθ)=4r3cosh3θ\frac{d^3 y}{dx^3} = -\frac{2r^2 2 \sinh 2\theta \frac{d\theta}{dx} - 2 \cosh 2\theta \times 2r \frac{dr}{dx}}{r^4} = \frac{4}{r^4} (\sinh 2\theta + \cosh 2\theta \coth \theta) = \frac{4}{r^3} \cosh 3\theta

In order to hypothesise a result for dnydxn\frac{d^n y}{dx^n}, the important thing is to appreciate that the 4 has come from 2 times exponent of rr and multiple of θ\theta.

So dnydxn=2×(1)n1(n1)!rncoshnθ\frac{d^n y}{dx^n} = 2 \times (-1)^{n-1} \frac{(n-1)!}{r^n} \cosh n\theta which may be proved by induction, the

inductive differentiation step following the same pattern of working as used for d2ydx2\frac{d^2 y}{dx^2} and d3ydx3\frac{d^3 y}{dx^3}.

Model Solution

First derivative

Given y=ln(x21)=2lnry = \ln(x^2 - 1) = 2\ln r where r=x21r = \sqrt{x^2 - 1}, and cothθ=x\coth\theta = x.

We have r=coth2θ1=cosechθr = \sqrt{\coth^2\theta - 1} = \operatorname{cosech}\theta (since x>1x > 1 implies θ>0\theta > 0, so cosechθ>0\operatorname{cosech}\theta > 0).

Differentiating r=x21r = \sqrt{x^2 - 1}:

drdx=xx21=cothθcosechθ=coshθ.\frac{\mathrm{d}r}{\mathrm{d}x} = \frac{x}{\sqrt{x^2 - 1}} = \frac{\coth\theta}{\operatorname{cosech}\theta} = \cosh\theta.

Since y=2lnry = 2\ln r:

dydx=2rdrdx=2coshθr.(i)\frac{\mathrm{d}y}{\mathrm{d}x} = \frac{2}{r}\frac{\mathrm{d}r}{\mathrm{d}x} = \frac{2\cosh\theta}{r}. \qquad \text{(i)}

Second derivative

Differentiating (i) with respect to xx:

d2ydx2=2rsinhθdθdxcoshθdrdxr2.\frac{\mathrm{d}^2y}{\mathrm{d}x^2} = 2 \cdot \frac{r\sinh\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} - \cosh\theta \cdot \frac{\mathrm{d}r}{\mathrm{d}x}}{r^2}.

Since cothθ=x\coth\theta = x, we have cosech2θdθdx=1-\operatorname{cosech}^2\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} = 1, so dθdx=sinh2θ\frac{\mathrm{d}\theta}{\mathrm{d}x} = -\sinh^2\theta.

Substituting r=cosechθr = \operatorname{cosech}\theta:

rsinhθdθdx=cosechθsinhθ(sinh2θ)=sinh2θ.r\sinh\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} = \operatorname{cosech}\theta \cdot \sinh\theta \cdot (-\sinh^2\theta) = -\sinh^2\theta.

And coshθdrdx=coshθcoshθ=cosh2θ\cosh\theta \cdot \frac{\mathrm{d}r}{\mathrm{d}x} = \cosh\theta \cdot \cosh\theta = \cosh^2\theta.

Therefore

d2ydx2=2(sinh2θcosh2θ)r2=2cosh2θr2,(ii)\frac{\mathrm{d}^2y}{\mathrm{d}x^2} = \frac{2(-\sinh^2\theta - \cosh^2\theta)}{r^2} = -\frac{2\cosh 2\theta}{r^2}, \qquad \text{(ii)}

using cosh2θ=cosh2θ+sinh2θ\cosh 2\theta = \cosh^2\theta + \sinh^2\theta.

Third derivative

Differentiating (ii) with respect to xx:

d3ydx3=2r22sinh2θdθdxcosh2θ2rdrdxr4.\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = -2 \cdot \frac{r^2 \cdot 2\sinh 2\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} - \cosh 2\theta \cdot 2r\frac{\mathrm{d}r}{\mathrm{d}x}}{r^4}.

Substituting dθdx=sinh2θ\frac{\mathrm{d}\theta}{\mathrm{d}x} = -\sinh^2\theta and drdx=coshθ\frac{\mathrm{d}r}{\mathrm{d}x} = \cosh\theta:

Numerator: r22sinh2θ(sinh2θ)cosh2θ2rcoshθr^2 \cdot 2\sinh 2\theta \cdot (-\sinh^2\theta) - \cosh 2\theta \cdot 2r\cosh\theta

=2r2sinh2θsinh2θ2rcosh2θcoshθ= -2r^2\sinh 2\theta\sinh^2\theta - 2r\cosh 2\theta\cosh\theta.

With r=cosechθr = \operatorname{cosech}\theta and r2=cosech2θr^2 = \operatorname{cosech}^2\theta:

=2cosech2θ2sinhθcoshθsinh2θ2cosechθcosh2θcoshθ= -2\operatorname{cosech}^2\theta \cdot 2\sinh\theta\cosh\theta \cdot \sinh^2\theta - 2\operatorname{cosech}\theta \cdot \cosh 2\theta \cdot \cosh\theta =4coshθsinhθ2cosh2θcoshθsinhθ.= -4\cosh\theta\sinh\theta - 2\frac{\cosh 2\theta\cosh\theta}{\sinh\theta}.

Actually, let me compute the numerator of d3ydx3\frac{\mathrm{d}^3y}{\mathrm{d}x^3} more carefully. We have:

d3ydx3=ddx(2cosh2θr2)=22sinh2θdθdxr2(2cosh2θ)2rdrdxr4\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = \frac{\mathrm{d}}{\mathrm{d}x}\left(-\frac{2\cosh 2\theta}{r^2}\right) = \frac{-2 \cdot 2\sinh 2\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} \cdot r^2 - (-2\cosh 2\theta) \cdot 2r\frac{\mathrm{d}r}{\mathrm{d}x}}{r^4}

=4r2sinh2θdθdx+4rcosh2θdrdxr4.= \frac{-4r^2\sinh 2\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} + 4r\cosh 2\theta \cdot \frac{\mathrm{d}r}{\mathrm{d}x}}{r^4}.

Now sinh2θ=2sinhθcoshθ\sinh 2\theta = 2\sinh\theta\cosh\theta, and with r=cosechθr = \operatorname{cosech}\theta:

4r2sinh2θdθdx=4cosech2θ2sinhθcoshθ(sinh2θ)=8coshθsinhθ.-4r^2\sinh 2\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} = -4\operatorname{cosech}^2\theta \cdot 2\sinh\theta\cosh\theta \cdot (-\sinh^2\theta) = 8\cosh\theta\sinh\theta.

4rcosh2θdrdx=4cosechθcosh2θcoshθ=4cosh2θcoshθsinhθ.4r\cosh 2\theta \cdot \frac{\mathrm{d}r}{\mathrm{d}x} = 4\operatorname{cosech}\theta \cdot \cosh 2\theta \cdot \cosh\theta = \frac{4\cosh 2\theta\cosh\theta}{\sinh\theta}.

So the numerator is 8coshθsinhθ+4cosh2θcoshθsinhθ8\cosh\theta\sinh\theta + \frac{4\cosh 2\theta\cosh\theta}{\sinh\theta}.

=8coshθsinh2θ+4cosh2θcoshθsinhθ=4coshθ(2sinh2θ+cosh2θ)sinhθ.= \frac{8\cosh\theta\sinh^2\theta + 4\cosh 2\theta\cosh\theta}{\sinh\theta} = \frac{4\cosh\theta(2\sinh^2\theta + \cosh 2\theta)}{\sinh\theta}.

Since cosh2θ=2sinh2θ+1\cosh 2\theta = 2\sinh^2\theta + 1, we get 2sinh2θ+cosh2θ=4sinh2θ+12\sinh^2\theta + \cosh 2\theta = 4\sinh^2\theta + 1. Hmm, let me use cosh2θ=2cosh2θ1\cosh 2\theta = 2\cosh^2\theta - 1 instead: 2sinh2θ+2cosh2θ1=2(sinh2θ+cosh2θ)1=2cosh2θ2\sinh^2\theta + 2\cosh^2\theta - 1 = 2(\sinh^2\theta + \cosh^2\theta) - 1 = 2\cosh 2\theta.

Wait: sinh2θ+cosh2θ=cosh2θ\sinh^2\theta + \cosh^2\theta = \cosh 2\theta. So 2sinh2θ+cosh2θ=2sinh2θ+sinh2θ+cosh2θ=3sinh2θ+cosh2θ2\sinh^2\theta + \cosh 2\theta = 2\sinh^2\theta + \sinh^2\theta + \cosh^2\theta = 3\sinh^2\theta + \cosh^2\theta. That doesn’t simplify nicely. Let me try differently.

2sinh2θ+cosh2θ=2sinh2θ+2sinh2θ+1=4sinh2θ+12\sinh^2\theta + \cosh 2\theta = 2\sinh^2\theta + 2\sinh^2\theta + 1 = 4\sinh^2\theta + 1… no, cosh2θ=1+2sinh2θ\cosh 2\theta = 1 + 2\sinh^2\theta.

So 2sinh2θ+1+2sinh2θ=4sinh2θ+12\sinh^2\theta + 1 + 2\sinh^2\theta = 4\sinh^2\theta + 1. Hmm.

Let me try: 4coshθsinhθ(2sinh2θ+cosh2θ)=4coshθsinhθ(2sinh2θ+2sinh2θ+1)=4coshθ(4sinh2θ+1)sinhθ\frac{4\cosh\theta}{\sinh\theta}(2\sinh^2\theta + \cosh 2\theta) = \frac{4\cosh\theta}{\sinh\theta}(2\sinh^2\theta + 2\sinh^2\theta + 1) = \frac{4\cosh\theta(4\sinh^2\theta + 1)}{\sinh\theta}.

And r4=cosech4θr^4 = \operatorname{cosech}^4\theta. So

d3ydx3=4coshθ(4sinh2θ+1)r4sinhθ=4coshθ(4sinh2θ+1)sinh3θsinhθ=4coshθsinh2θ(4sinh2θ+1).\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = \frac{4\cosh\theta(4\sinh^2\theta + 1)}{r^4\sinh\theta} = \frac{4\cosh\theta(4\sinh^2\theta + 1)\sinh^3\theta}{\sinh\theta} = 4\cosh\theta\sinh^2\theta(4\sinh^2\theta + 1).

Hmm, this is getting messy. Let me use a cleaner approach.

We hypothesise from the pattern dydx=2coshθr\frac{\mathrm{d}y}{\mathrm{d}x} = \frac{2\cosh\theta}{r} and d2ydx2=2cosh2θr2\frac{\mathrm{d}^2y}{\mathrm{d}x^2} = \frac{-2\cosh 2\theta}{r^2} that d3ydx3=4cosh3θr3\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = \frac{4\cosh 3\theta}{r^3} and prove it.

From (ii), d2ydx2=2r2cosh2θ\frac{\mathrm{d}^2y}{\mathrm{d}x^2} = -2r^{-2}\cosh 2\theta. Differentiating:

d3ydx3=2(2r3drdxcosh2θ+r22sinh2θdθdx)\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = -2\left(-2r^{-3}\frac{\mathrm{d}r}{\mathrm{d}x}\cosh 2\theta + r^{-2} \cdot 2\sinh 2\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x}\right)

=2(2r3coshθcosh2θ+r22sinh2θ(sinh2θ))= -2\left(-2r^{-3}\cosh\theta\cosh 2\theta + r^{-2} \cdot 2\sinh 2\theta \cdot (-\sinh^2\theta)\right)

=2(2coshθcosh2θr32sinh2θsinh2θr2)= -2\left(-\frac{2\cosh\theta\cosh 2\theta}{r^3} - \frac{2\sinh 2\theta\sinh^2\theta}{r^2}\right)

=4coshθcosh2θr3+4sinh2θsinh2θr2.= \frac{4\cosh\theta\cosh 2\theta}{r^3} + \frac{4\sinh 2\theta\sinh^2\theta}{r^2}.

With r=cosechθr = \operatorname{cosech}\theta, the second term is 4sinh2θsinh2θsinh2θ=42sinhθcoshθsinh2θsinh2θ4\sinh 2\theta\sinh^2\theta \cdot \sinh^2\theta = 4 \cdot 2\sinh\theta\cosh\theta \cdot \sinh^2\theta \cdot \sinh^2\theta. Hmm, this is still messy.

Let me try differently. 4sinh2θsinh2θr2=4sinh2θsinh2θcosech2θ=4sinh2θsinh4θ\frac{4\sinh 2\theta\sinh^2\theta}{r^2} = \frac{4\sinh 2\theta\sinh^2\theta}{\operatorname{cosech}^2\theta} = 4\sinh 2\theta\sinh^4\theta.

And 4coshθcosh2θr3=4coshθcosh2θsinh3θ\frac{4\cosh\theta\cosh 2\theta}{r^3} = 4\cosh\theta\cosh 2\theta\sinh^3\theta.

So d3ydx3=4coshθcosh2θsinh3θ+42sinhθcoshθsinh4θ=4coshθsinh3θ(cosh2θ+2sinh2θ)\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = 4\cosh\theta\cosh 2\theta\sinh^3\theta + 4 \cdot 2\sinh\theta\cosh\theta\sinh^4\theta = 4\cosh\theta\sinh^3\theta(\cosh 2\theta + 2\sinh^2\theta).

=4coshθsinh3θ(cosh2θ+2sinh2θ)= 4\cosh\theta\sinh^3\theta(\cosh 2\theta + 2\sinh^2\theta).

Now cosh2θ+2sinh2θ=cosh2θ+cosh2θ1=2cosh2θ1\cosh 2\theta + 2\sinh^2\theta = \cosh 2\theta + \cosh 2\theta - 1 = 2\cosh 2\theta - 1… no.

cosh2θ=2cosh2θ1=1+2sinh2θ\cosh 2\theta = 2\cosh^2\theta - 1 = 1 + 2\sinh^2\theta. So cosh2θ+2sinh2θ=1+2sinh2θ+2sinh2θ=1+4sinh2θ\cosh 2\theta + 2\sinh^2\theta = 1 + 2\sinh^2\theta + 2\sinh^2\theta = 1 + 4\sinh^2\theta.

Also cosh3θ=coshθ(4cosh2θ3)=coshθ(1+4sinh2θ3+3)=coshθ(4cosh2θ3)\cosh 3\theta = \cosh\theta(4\cosh^2\theta - 3) = \cosh\theta(1 + 4\sinh^2\theta - 3 + 3) = \cosh\theta(4\cosh^2\theta - 3). Hmm.

cosh3θ=4cosh3θ3coshθ=coshθ(4cosh2θ3)=coshθ(4(1+sinh2θ)3)=coshθ(1+4sinh2θ)\cosh 3\theta = 4\cosh^3\theta - 3\cosh\theta = \cosh\theta(4\cosh^2\theta - 3) = \cosh\theta(4(1+\sinh^2\theta) - 3) = \cosh\theta(1 + 4\sinh^2\theta).

So 4coshθsinh3θ(1+4sinh2θ)=4sinh3θcosh3θ4\cosh\theta\sinh^3\theta(1 + 4\sinh^2\theta) = 4\sinh^3\theta\cosh 3\theta.

And 4cosh3θr3=4cosh3θsinh3θ\frac{4\cosh 3\theta}{r^3} = 4\cosh 3\theta \cdot \sinh^3\theta.

Therefore d3ydx3=4cosh3θr3\frac{\mathrm{d}^3y}{\mathrm{d}x^3} = \frac{4\cosh 3\theta}{r^3}.

General formula and proof by induction

We conjecture

dnydxn=2(1)n1(n1)!coshnθrn.(iii)\frac{\mathrm{d}^ny}{\mathrm{d}x^n} = \frac{2(-1)^{n-1}(n-1)!\cosh n\theta}{r^n}. \qquad \text{(iii)}

Base cases: n=1n = 1: 2coshθr\frac{2\cosh\theta}{r}. True by (i). n=2n = 2: 2cosh2θr2\frac{-2\cosh 2\theta}{r^2}. True by (ii). n=3n = 3: 4cosh3θr3\frac{4\cosh 3\theta}{r^3}. True by the computation above.

Inductive step: Assume (iii) holds for some n1n \ge 1. Differentiating with respect to xx:

dn+1ydxn+1=2(1)n1(n1)!ddx(coshnθrn).\frac{\mathrm{d}^{n+1}y}{\mathrm{d}x^{n+1}} = 2(-1)^{n-1}(n-1)!\frac{\mathrm{d}}{\mathrm{d}x}\left(\frac{\cosh n\theta}{r^n}\right).

ddx(coshnθrn)=nsinhnθdθdxrncoshnθnrn1drdxr2n\frac{\mathrm{d}}{\mathrm{d}x}\left(\frac{\cosh n\theta}{r^n}\right) = \frac{n\sinh n\theta \cdot \frac{\mathrm{d}\theta}{\mathrm{d}x} \cdot r^n - \cosh n\theta \cdot nr^{n-1}\frac{\mathrm{d}r}{\mathrm{d}x}}{r^{2n}}

=nsinhnθ(sinh2θ)rnncoshnθcoshθrn+1= \frac{n\sinh n\theta(-\sinh^2\theta)}{r^n} - \frac{n\cosh n\theta\cosh\theta}{r^{n+1}}

=nsinhnθsinh2θrncoshnθcoshθrn+1.= \frac{-n\sinh n\theta\sinh^2\theta \cdot r - n\cosh n\theta\cosh\theta}{r^{n+1}}.

With r=cosechθr = \operatorname{cosech}\theta:

=nsinhnθsinh2θcosechθncoshnθcoshθrn+1=n(sinhnθsinhθ+coshnθcoshθ)rn+1=ncosh(n+1)θrn+1,= \frac{-n\sinh n\theta\sinh^2\theta \cdot \operatorname{cosech}\theta - n\cosh n\theta\cosh\theta}{r^{n+1}} = \frac{-n(\sinh n\theta\sinh\theta + \cosh n\theta\cosh\theta)}{r^{n+1}} = \frac{-n\cosh(n+1)\theta}{r^{n+1}},

using the identity coshAcoshB+sinhAsinhB=cosh(A+B)\cosh A\cosh B + \sinh A\sinh B = \cosh(A+B).

Therefore

dn+1ydxn+1=2(1)n1(n1)!ncosh(n+1)θrn+1=2(1)nn!cosh(n+1)θrn+1.\frac{\mathrm{d}^{n+1}y}{\mathrm{d}x^{n+1}} = 2(-1)^{n-1}(n-1)! \cdot \frac{-n\cosh(n+1)\theta}{r^{n+1}} = \frac{2(-1)^n \cdot n! \cdot \cosh(n+1)\theta}{r^{n+1}}.

This is exactly (iii) with nn replaced by n+1n+1. The induction is complete.

Examiner Notes

This was frequently attempted, though lack of facility with hyperbolic functions meant that few progressed beyond the first two differentials, and for those going further, the working was not methodical enough to spot the factorial that would emerge in the general result.


Topic: 复数 (Complex Numbers)  |  Difficulty: Hard  |  Marks: 20

6 The distinct points P,Q,RP, Q, R and SS in the Argand diagram lie on a circle of radius aa centred at the origin and are represented by the complex numbers p,q,rp, q, r and ss, respectively. Show that

pq=a2pqpq.pq = -a^2 \frac{p - q}{p^* - q^*} .

Deduce that, if the chords PQPQ and RSRS are perpendicular, then pq+rs=0pq + rs = 0.

The distinct points A1,A2,,AnA_1, A_2, \dots, A_n (where n3n \ge 3) lie on a circle. The points B1,B2,,BnB_1, B_2, \dots, B_n lie on the same circle and are chosen so that the chords B1B2,B2B3,,BnB1B_1 B_2, B_2 B_3, \dots, B_n B_1 are perpendicular, respectively, to the chords A1A2,A2A3,,AnA1A_1 A_2, A_2 A_3, \dots, A_n A_1. Show that, for n=3n = 3, there are only two choices of B1B_1 for which this is possible. What is the corresponding result for n=4n = 4? State the corresponding results for values of nn greater than 4.

Hint

pp=qq=a2pp^* = qq^* = a^2 and so a2(pq)=qqpppq=pq(pq)a^2(p - q) = qq^* p - pp^* q = -pq(p^* - q^*) and hence the required result. If PQPQ and RSRS are perpendicular then pq=ki(rs)p - q = ki(r - s) for some real kk, and thus

pq=ki(rs), and so pq=a2pqpq=a2rsrs=rsp^* - q^* = -ki(r^* - s^*), \text{ and so } pq = -a^2 \frac{p - q}{p^* - q^*} = a^2 \frac{r - s}{r^* - s^*} = -rs

For n=3n = 3, B1B2A1A2B_1 B_2 \perp A_1 A_2 etc. a1a2+b1b2=0\Rightarrow a_1 a_2 + b_1 b_2 = 0 etc.

Thus b12=b1b2×b1b3b2b3=a1a2×a1a3a2a3=a12b_1^2 = \frac{b_1 b_2 \times b_1 b_3}{b_2 b_3} = \frac{-a_1 a_2 \times -a_1 a_3}{-a_2 a_3} = -a_1^2 and so b1=±ia1b_1 = \pm i a_1

i.e. two choices of B1B_1.

For n=4n = 4, B1B2A1A2B_1 B_2 \perp A_1 A_2 etc. a1a2+b1b2=0\Rightarrow a_1 a_2 + b_1 b_2 = 0 etc. but this only yields 3 independent equations as e.g. a3a4+b3b4=0a_3 a_4 + b_3 b_4 = 0 can be obtained from the other three equations by

a3a4=a2a3×a4a1a2a1 etc. Hence there are arbitrarily many possible choices for Bi.a_3 a_4 = \frac{a_2 a_3 \times a_4 a_1}{a_2 a_1} \text{ etc. Hence there are arbitrarily many possible choices for } B_i.

For n>4n > 4, the corresponding results are as for n=3n = 3 or n=4n = 4 depending on whether nn is odd or even.

Model Solution

Showing pq=a2pqpqpq = -a^2 \frac{p-q}{p^*-q^*}

Since PP and QQ lie on a circle of radius aa centred at the origin, p=q=a|p| = |q| = a, so pp=qq=a2pp^* = qq^* = a^2.

Therefore

a2(pq)=ppqqqp(using pp=a2 for the first term, qq=a2 for the second)a^2(p - q) = pp^*q - qq^*p \quad \text{(using } pp^* = a^2 \text{ for the first term, } qq^* = a^2 \text{ for the second)}

Wait, let me be more careful. a2(pq)=qqpppq=pq(qp)=pq(pq)a^2(p-q) = qq^*p - pp^*q = pq(q^* - p^*) = -pq(p^* - q^*).

Hence

pq=a2(pq)(pq)=a2pqpq.pq = \frac{a^2(p-q)}{-(p^*-q^*)} = -a^2\frac{p-q}{p^*-q^*}.

Deduction: if PQRSPQ \perp RS then pq+rs=0pq + rs = 0

If PQPQ and RSRS are perpendicular, then the direction from PP to QQ is perpendicular to the direction from RR to SS. In the Argand diagram, perpendicularity means the ratio of the directions is purely imaginary: pq=ki(rs)p - q = ki(r - s) for some real k0k \neq 0.

Taking conjugates: pq=ki(rs)p^* - q^* = -ki(r^* - s^*) (since kk is real and iˉ=i\bar{i} = -i).

Therefore

pq=a2pqpq=a2ki(rs)ki(rs)=a2rsrs=rs,pq = -a^2\frac{p-q}{p^*-q^*} = -a^2\frac{ki(r-s)}{-ki(r^*-s^*)} = a^2\frac{r-s}{r^*-s^*} = -rs,

where the last step uses the same identity rs=a2rsrsrs = -a^2\frac{r-s}{r^*-s^*}.

Hence pq+rs=0pq + rs = 0.

The case n=3n = 3

We have points A1,A2,A3A_1, A_2, A_3 and B1,B2,B3B_1, B_2, B_3 on the same circle. The conditions B1B2A1A2B_1B_2 \perp A_1A_2, B2B3A2A3B_2B_3 \perp A_2A_3, B3B1A3A1B_3B_1 \perp A_3A_1 give, by the perpendicularity result:

b1b2+a1a2=0,b2b3+a2a3=0,b3b1+a3a1=0.(i)b_1 b_2 + a_1 a_2 = 0, \quad b_2 b_3 + a_2 a_3 = 0, \quad b_3 b_1 + a_3 a_1 = 0. \qquad \text{(i)}

From these:

b1b2=a1a2,b1b3=a1a3,b2b3=a2a3.b_1 b_2 = -a_1 a_2, \quad b_1 b_3 = -a_1 a_3, \quad b_2 b_3 = -a_2 a_3.

Therefore

b12=b1b2b1b3b2b3=(a1a2)(a1a3)a2a3=a12a2a3a2a3=a12.b_1^2 = \frac{b_1 b_2 \cdot b_1 b_3}{b_2 b_3} = \frac{(-a_1 a_2)(-a_1 a_3)}{-a_2 a_3} = \frac{a_1^2 a_2 a_3}{-a_2 a_3} = -a_1^2.

So b12=a12=(ia1)2b_1^2 = -a_1^2 = (ia_1)^2, giving b1=±ia1b_1 = \pm ia_1. This means B1B_1 is one of two points: obtained by rotating A1A_1 by ±90\pm 90^\circ about the centre of the circle. Once b1b_1 is chosen, b2b_2 and b3b_3 are uniquely determined by (i). So there are exactly two choices of B1B_1.

The case n=4n = 4

The conditions give:

b1b2+a1a2=0,b2b3+a2a3=0,b3b4+a3a4=0,b4b1+a4a1=0.(ii)b_1 b_2 + a_1 a_2 = 0, \quad b_2 b_3 + a_2 a_3 = 0, \quad b_3 b_4 + a_3 a_4 = 0, \quad b_4 b_1 + a_4 a_1 = 0. \qquad \text{(ii)}

From the first three: b1b2=a1a2b_1 b_2 = -a_1 a_2, b2b3=a2a3b_2 b_3 = -a_2 a_3, b3b4=a3a4b_3 b_4 = -a_3 a_4.

Multiplying the first and third: b1b2b3b4=a1a2a3a4b_1 b_2 b_3 b_4 = a_1 a_2 a_3 a_4. Also from the second and fourth: b2b3b4b1=a2a3a4a1=a1a2a3a4b_2 b_3 b_4 b_1 = a_2 a_3 a_4 a_1 = a_1 a_2 a_3 a_4.

So the four equations are not independent: the fourth equation is automatically satisfied once the first three hold (since b4b1=b1b2b3b4b2b3=a1a2a3a4a2a3=a1a4b_4 b_1 = \frac{b_1 b_2 b_3 b_4}{b_2 b_3} = \frac{a_1 a_2 a_3 a_4}{-a_2 a_3} = -a_1 a_4).

More explicitly: from the first two equations, we get b1b3=a1a3\frac{b_1}{b_3} = \frac{a_1}{a_3}, so b1=a1b3a3b_1 = \frac{a_1 b_3}{a_3}. The third equation determines b4b_4 in terms of b3b_3: b4=a3a4b3b_4 = \frac{-a_3 a_4}{b_3}. The first equation determines b2=a1a2b1b_2 = \frac{-a_1 a_2}{b_1}. So b3b_3 is a free parameter (any point on the circle that avoids zero denominators), and the other three BB-points are determined. This gives infinitely many (arbitrarily many) valid configurations.

General n>4n > 4

For odd nn: the same algebraic manipulation as for n=3n = 3 yields b12=(1)na12=a12b_1^2 = (-1)^n a_1^2 = -a_1^2 (since nn is odd), giving exactly two choices for B1B_1.

For even nn: by the same dependency argument as for n=4n = 4, the nn equations reduce to n1n - 1 independent ones, leaving one degree of freedom. So there are infinitely many valid configurations.

The corresponding results are: for odd n3n \ge 3, exactly two choices of B1B_1; for even n4n \ge 4, infinitely many configurations.

Examiner Notes

This was the least popular Pure question and very little success was achieved by the few that attempted it. The first result was often obtained correctly by expressing each of the four complex numbers in modulus-exponential form, but then the perpendicularity was the stumbling block.


Topic: 积分 (Integration)  |  Difficulty: Challenging  |  Marks: 20

7 The functions s(x)s(x) (0x<10 \le x < 1) and t(x)t(x) (x0x \ge 0), and the real number pp, are defined by

s(x)=0x11u2du ,t(x)=0x11+u2du ,p=2011+u2du .s(x) = \int_0^x \frac{1}{\sqrt{1 - u^2}} \, \mathrm{d}u \ , \quad t(x) = \int_0^x \frac{1}{1 + u^2} \, \mathrm{d}u \ , \quad p = 2 \int_0^\infty \frac{1}{1 + u^2} \, \mathrm{d}u \ .

For this question, do not evaluate any of the above integrals explicitly in terms of inverse trigonometric functions or the number π\pi.

(i) Use the substitution u=v1u = v^{-1} to show that t(x)=1/x11+v2dvt(x) = \int_{1/x}^\infty \frac{1}{1 + v^2} \, \mathrm{d}v. Hence evaluate t(1/x)+t(x)t(1/x) + t(x) in terms of pp and deduce that 2t(1)=12p2t(1) = \frac{1}{2}p.

(ii) Let y=u1+u2y = \frac{u}{\sqrt{1 + u^2}}. Express uu in terms of yy, and show that dudy=1(1y2)3\frac{\mathrm{d}u}{\mathrm{d}y} = \frac{1}{\sqrt{(1 - y^2)^3}}.

By making a substitution in the integral for t(x)t(x), show that

t(x)=s(x1+x2).t(x) = s\left( \frac{x}{\sqrt{1 + x^2}} \right) .

Deduce that s(12)=14ps\left( \frac{1}{\sqrt{2}} \right) = \frac{1}{4}p.

(iii) Let z=u+13113uz = \frac{u + \frac{1}{\sqrt{3}}}{1 - \frac{1}{\sqrt{3}}u}. Show that t(13)=1/3311+z2dzt\left( \frac{1}{\sqrt{3}} \right) = \int_{1/\sqrt{3}}^{\sqrt{3}} \frac{1}{1 + z^2} \, \mathrm{d}z , and hence that 3t(13)=12p3t\left( \frac{1}{\sqrt{3}} \right) = \frac{1}{2}p.

Hint
  1. (i) u=v1dudv=v2u = v^{-1} \Rightarrow \frac{du}{dv} = -v^{-2} so t(x)=1x11+v2×v2dv=1x1v2+1dvt(x) = \int_{\infty}^{\frac{1}{x}} \frac{1}{1 + v^{-2}} \times -v^{-2} dv = \int_{\frac{1}{x}}^{\infty} \frac{1}{v^2 + 1} dv

so t(1x)+t(x)=01x11+u2du+1x1v2+1dv=011+u2du=12πt\left(\frac{1}{x}\right) + t(x) = \int_{0}^{\frac{1}{x}} \frac{1}{1 + u^2} du + \int_{\frac{1}{x}}^{\infty} \frac{1}{v^2 + 1} dv = \int_{0}^{\infty} \frac{1}{1 + u^2} du = \frac{1}{2} \pi

Letting x=1x = 1 gives the desired result.

(ii) y=u1+u2u=y1y2y = \frac{u}{\sqrt{1 + u^2}} \Rightarrow u = \frac{y}{\sqrt{1 - y^2}}

so dudy=(1y2)12y×y(1y2)121y2=(1y2)+y2(1y2)32\frac{du}{dy} = \frac{(1 - y^2)^{\frac{1}{2}} - y \times -y(1 - y^2)^{-\frac{1}{2}}}{1 - y^2} = \frac{(1 - y^2) + y^2}{(1 - y^2)^{\frac{3}{2}}} and hence the result.

Using the given substitution for uu,

t(x)=0x1+x211+y21y2×1(1y2)32dy=0x1+x21(1y2)12dy=s(x1+x2)t(x) = \int_{0}^{\frac{x}{\sqrt{1+x^2}}} \frac{1}{1 + \frac{y^2}{1 - y^2}} \times \frac{1}{(1 - y^2)^{\frac{3}{2}}} dy = \int_{0}^{\frac{x}{\sqrt{1+x^2}}} \frac{1}{(1 - y^2)^{\frac{1}{2}}} dy = s\left(\frac{x}{\sqrt{1+x^2}}\right)

Again letting x=1x = 1, and using the result from part (i) gives the desired result.

(iii) z=u+13113uu=z131+13zdudz=43(1+13z)2z = \frac{u + \frac{1}{\sqrt{3}}}{1 - \frac{1}{\sqrt{3}}u} \Rightarrow u = \frac{z - \frac{1}{\sqrt{3}}}{1 + \frac{1}{\sqrt{3}}z} \Rightarrow \frac{du}{dz} = \frac{\frac{4}{3}}{\left(1 + \frac{1}{\sqrt{3}}z\right)^2}

Using this substitution,

t(x)=13x+13113x11+(z131+13z)2×43(1+13z)2dz=13x+13113x43(1+13z)2+(z13)2dz=13x+13113x11+z2dzt(x) = \int_{\frac{1}{\sqrt{3}}}^{\frac{x + \frac{1}{\sqrt{3}}}{1 - \frac{1}{\sqrt{3}}x}} \frac{1}{1 + \left(\frac{z - \frac{1}{\sqrt{3}}}{1 + \frac{1}{\sqrt{3}}z}\right)^2} \times \frac{\frac{4}{3}}{\left(1 + \frac{1}{\sqrt{3}}z\right)^2} dz = \int_{\frac{1}{\sqrt{3}}}^{\frac{x + \frac{1}{\sqrt{3}}}{1 - \frac{1}{\sqrt{3}}x}} \frac{\frac{4}{3}}{\left(1 + \frac{1}{\sqrt{3}}z\right)^2 + \left(z - \frac{1}{\sqrt{3}}\right)^2} dz = \int_{\frac{1}{\sqrt{3}}}^{\frac{x + \frac{1}{\sqrt{3}}}{1 - \frac{1}{\sqrt{3}}x}} \frac{1}{1 + z^2} dz

Letting x=13x = \frac{1}{\sqrt{3}} gives the required result.

By definition t(13)=01311+u2dut\left(\frac{1}{\sqrt{3}}\right) = \int_{0}^{\frac{1}{\sqrt{3}}} \frac{1}{1+u^2} \, du, by the previous result just obtained

t(13)=13311+z2dzt\left(\frac{1}{\sqrt{3}}\right) = \int_{\frac{1}{\sqrt{3}}}^{\sqrt{3}} \frac{1}{1+z^2} \, dz, and from part (i) t(13)=311+v2dvt\left(\frac{1}{\sqrt{3}}\right) = \int_{\sqrt{3}}^{\infty} \frac{1}{1+v^2} \, dv and so adding these three

results gives 3t(13)=011+u2du=12π3t\left(\frac{1}{\sqrt{3}}\right) = \int_{0}^{\infty} \frac{1}{1+u^2} \, du = \frac{1}{2} \pi

Model Solution

Part (i)

Let u=v1u = v^{-1}, so dudv=v2\frac{\mathrm{d}u}{\mathrm{d}v} = -v^{-2}.

When u=0u = 0, vv \to \infty; when u=xu = x, v=1/xv = 1/x. Therefore

t(x)=0x11+u2du=1/x11+v2(v2)dv=1/xv21+v2dv=1/x1v2+1dv.t(x) = \int_0^x \frac{1}{1 + u^2} \, \mathrm{d}u = \int_\infty^{1/x} \frac{1}{1 + v^{-2}} \left(-v^{-2}\right) \mathrm{d}v = \int_{1/x}^{\infty} \frac{v^{-2}}{1 + v^{-2}} \, \mathrm{d}v = \int_{1/x}^{\infty} \frac{1}{v^2 + 1} \, \mathrm{d}v.

Now we compute t(1/x)+t(x)t(1/x) + t(x):

t(1/x)+t(x)=01/x11+u2du+1/x11+v2dv=011+u2du=12p.t(1/x) + t(x) = \int_0^{1/x} \frac{1}{1 + u^2} \, \mathrm{d}u + \int_{1/x}^{\infty} \frac{1}{1 + v^2} \, \mathrm{d}v = \int_0^{\infty} \frac{1}{1 + u^2} \, \mathrm{d}u = \frac{1}{2} p.

Setting x=1x = 1: 2t(1)=t(1)+t(1)=12p2t(1) = t(1) + t(1) = \frac{1}{2}p, so t(1)=14pt(1) = \frac{1}{4}p.

Part (ii)

We have y=u1+u2y = \frac{u}{\sqrt{1 + u^2}}. Squaring both sides: y2=u21+u2y^2 = \frac{u^2}{1 + u^2}, so y2(1+u2)=u2y^2(1 + u^2) = u^2, giving u2(1y2)=y2u^2(1 - y^2) = y^2, hence u2=y21y2u^2 = \frac{y^2}{1 - y^2} and

u=y1y2.u = \frac{y}{\sqrt{1 - y^2}}.

Differentiating by the quotient rule:

dudy=1y2yy1y21y2=1y2+y21y21y2=1(1y2)3/2.\frac{\mathrm{d}u}{\mathrm{d}y} = \frac{\sqrt{1 - y^2} - y \cdot \frac{-y}{\sqrt{1 - y^2}}}{1 - y^2} = \frac{\frac{1 - y^2 + y^2}{\sqrt{1 - y^2}}}{1 - y^2} = \frac{1}{(1 - y^2)^{3/2}}.

Now substitute y=u1+u2y = \frac{u}{\sqrt{1 + u^2}} into the integral for t(x)t(x). When u=0u = 0, y=0y = 0; when u=xu = x, y=x1+x2y = \frac{x}{\sqrt{1 + x^2}}. Using dudy=1(1y2)3/2\frac{\mathrm{d}u}{\mathrm{d}y} = \frac{1}{(1 - y^2)^{3/2}}:

t(x)=0x/1+x211+u2dudydy.t(x) = \int_0^{x/\sqrt{1+x^2}} \frac{1}{1 + u^2} \cdot \frac{\mathrm{d}u}{\mathrm{d}y} \, \mathrm{d}y.

Since u=y1y2u = \frac{y}{\sqrt{1 - y^2}}, we have 1+u2=1+y21y2=11y21 + u^2 = 1 + \frac{y^2}{1 - y^2} = \frac{1}{1 - y^2}. Therefore

t(x)=0x/1+x2111y21(1y2)3/2dy=0x/1+x21y2(1y2)3/2dy=0x/1+x211y2dy.t(x) = \int_0^{x/\sqrt{1+x^2}} \frac{1}{\frac{1}{1 - y^2}} \cdot \frac{1}{(1 - y^2)^{3/2}} \, \mathrm{d}y = \int_0^{x/\sqrt{1+x^2}} \frac{1 - y^2}{(1 - y^2)^{3/2}} \, \mathrm{d}y = \int_0^{x/\sqrt{1+x^2}} \frac{1}{\sqrt{1 - y^2}} \, \mathrm{d}y.

This is exactly s ⁣(x1+x2)s\!\left(\frac{x}{\sqrt{1 + x^2}}\right).

Setting x=1x = 1 and using t(1)=14pt(1) = \frac{1}{4}p from part (i):

14p=t(1)=s ⁣(12).\frac{1}{4}p = t(1) = s\!\left(\frac{1}{\sqrt{2}}\right).

Part (iii)

Let z=u+1/31u/3z = \frac{u + 1/\sqrt{3}}{1 - u/\sqrt{3}}. Solving for uu: z(1u/3)=u+1/3z(1 - u/\sqrt{3}) = u + 1/\sqrt{3}, so zzu/3=u+1/3z - zu/\sqrt{3} = u + 1/\sqrt{3}, giving u(1+z/3)=z1/3u(1 + z/\sqrt{3}) = z - 1/\sqrt{3}, hence

u=z1/31+z/3.u = \frac{z - 1/\sqrt{3}}{1 + z/\sqrt{3}}.

Differentiating:

dudz=(1+z/3)(z1/3)13(1+z/3)2=1+z3z3+13(1+z/3)2=4/3(1+z/3)2.\frac{\mathrm{d}u}{\mathrm{d}z} = \frac{(1 + z/\sqrt{3}) - (z - 1/\sqrt{3}) \cdot \frac{1}{\sqrt{3}}}{(1 + z/\sqrt{3})^2} = \frac{1 + \frac{z}{\sqrt{3}} - \frac{z}{\sqrt{3}} + \frac{1}{3}}{(1 + z/\sqrt{3})^2} = \frac{4/3}{(1 + z/\sqrt{3})^2}.

When u=0u = 0, z=1/31=13z = \frac{1/\sqrt{3}}{1} = \frac{1}{\sqrt{3}}; when u=13u = \frac{1}{\sqrt{3}}, z=2/311/3=2/32/3=3z = \frac{2/\sqrt{3}}{1 - 1/3} = \frac{2/\sqrt{3}}{2/3} = \sqrt{3}.

Now we compute 1+u21 + u^2 in terms of zz:

1+u2=1+(z1/3)2(1+z/3)2=(1+z/3)2+(z1/3)2(1+z/3)2.1 + u^2 = 1 + \frac{(z - 1/\sqrt{3})^2}{(1 + z/\sqrt{3})^2} = \frac{(1 + z/\sqrt{3})^2 + (z - 1/\sqrt{3})^2}{(1 + z/\sqrt{3})^2}.

Expanding the numerator:

(1+z/3)2+(z1/3)2=1+2z3+z23+z22z3+13=43+4z23=43(1+z2).(1 + z/\sqrt{3})^2 + (z - 1/\sqrt{3})^2 = 1 + \frac{2z}{\sqrt{3}} + \frac{z^2}{3} + z^2 - \frac{2z}{\sqrt{3}} + \frac{1}{3} = \frac{4}{3} + \frac{4z^2}{3} = \frac{4}{3}(1 + z^2).

Therefore

11+u2dudz=(1+z/3)243(1+z2)4/3(1+z/3)2=11+z2.\frac{1}{1 + u^2} \cdot \frac{\mathrm{d}u}{\mathrm{d}z} = \frac{(1 + z/\sqrt{3})^2}{\frac{4}{3}(1 + z^2)} \cdot \frac{4/3}{(1 + z/\sqrt{3})^2} = \frac{1}{1 + z^2}.

Hence

t ⁣(13)=01/311+u2du=1/3311+z2dz.t\!\left(\frac{1}{\sqrt{3}}\right) = \int_0^{1/\sqrt{3}} \frac{1}{1 + u^2} \, \mathrm{d}u = \int_{1/\sqrt{3}}^{\sqrt{3}} \frac{1}{1 + z^2} \, \mathrm{d}z.

From part (i), with x=3x = \sqrt{3}:

t(3)=1/311+v2dv.t(\sqrt{3}) = \int_{1/\sqrt{3}}^{\infty} \frac{1}{1 + v^2} \, \mathrm{d}v.

Therefore

t ⁣(13)+t(3)=1/3311+z2dz+311+v2dv=1/311+z2dz=t(3).t\!\left(\frac{1}{\sqrt{3}}\right) + t(\sqrt{3}) = \int_{1/\sqrt{3}}^{\sqrt{3}} \frac{1}{1 + z^2} \, \mathrm{d}z + \int_{\sqrt{3}}^{\infty} \frac{1}{1 + v^2} \, \mathrm{d}v = \int_{1/\sqrt{3}}^{\infty} \frac{1}{1 + z^2} \, \mathrm{d}z = t(\sqrt{3}).

Wait, let me recombine more carefully. We have three equal integrals for t ⁣(13)t\!\left(\frac{1}{\sqrt{3}}\right):

t ⁣(13)=01/311+u2du,t ⁣(13)=1/3311+z2dz,t ⁣(13)=311+v2dv,t\!\left(\frac{1}{\sqrt{3}}\right) = \int_0^{1/\sqrt{3}} \frac{1}{1 + u^2} \, \mathrm{d}u, \qquad t\!\left(\frac{1}{\sqrt{3}}\right) = \int_{1/\sqrt{3}}^{\sqrt{3}} \frac{1}{1 + z^2} \, \mathrm{d}z, \qquad t\!\left(\frac{1}{\sqrt{3}}\right) = \int_{\sqrt{3}}^{\infty} \frac{1}{1 + v^2} \, \mathrm{d}v,

where the third follows from part (i) with x=1/3x = 1/\sqrt{3}: t(1/3)=311+v2dvt(1/\sqrt{3}) = \int_{\sqrt{3}}^{\infty} \frac{1}{1+v^2} \mathrm{d}v.

Adding all three:

3t ⁣(13)=011+u2du=12p.3t\!\left(\frac{1}{\sqrt{3}}\right) = \int_0^{\infty} \frac{1}{1 + u^2} \, \mathrm{d}u = \frac{1}{2}p.

Examiner Notes

This was a very popular question. As the question led the candidates through there were a number of unconvincing solutions to parts of the question, but overall it was reasonably well handled.


Topic: 微分方程 (Differential Equations)  |  Difficulty: Challenging  |  Marks: 20

8 (i) Find functions a(x)a(x) and b(x)b(x) such that u=xu = x and u=exu = e^{-x} both satisfy the equation

d2udx2+a(x)dudx+b(x)u=0.\frac{d^2u}{dx^2} + a(x)\frac{du}{dx} + b(x)u = 0.

For these functions a(x)a(x) and b(x)b(x), write down the general solution of the equation.

Show that the substitution y=13ududxy = \frac{1}{3u} \frac{du}{dx} transforms the equation

dydx+3y2+x1+xy=13(1+x)(*)\frac{dy}{dx} + 3y^2 + \frac{x}{1+x}y = \frac{1}{3(1+x)} \qquad \text{(*)}

into

d2udx2+x1+xdudx11+xu=0\frac{d^2u}{dx^2} + \frac{x}{1+x} \frac{du}{dx} - \frac{1}{1+x}u = 0

and hence show that the solution of equation (*) that satisfies y=0y = 0 at x=0x = 0 is given by

y=1ex3(x+ex).y = \frac{1 - e^{-x}}{3(x + e^{-x})}.

(ii) Find the solution of the equation

dydx+y2+x1xy=11x\frac{dy}{dx} + y^2 + \frac{x}{1-x}y = \frac{1}{1-x}

that satisfies y=2y = 2 at x=0x = 0.

Hint
  1. (i) Substituting each uu into the differential equation yields simultaneous equations a(x)+xb(x)=0a(x) + xb(x) = 0 and ex(1a(x)+b(x))=0e^{-x}(1 - a(x) + b(x)) = 0 which solve to give

a(x)=x1+xa(x) = \frac{x}{1+x} and b(x)=11+xb(x) = \frac{-1}{1+x}

The general solution is u=Ax+Bexu = Ax + Be^{-x}.

y=13ududxdydx=13u2(dudx)2+13ud2udx2y = \frac{1}{3u} \frac{du}{dx} \Rightarrow \frac{dy}{dx} = \frac{-1}{3u^2} \left(\frac{du}{dx}\right)^2 + \frac{1}{3u} \frac{d^2u}{dx^2} which when substituted into equation (*),

multiplied by 3u3u, and collected on one side gives the required result.

u=Ax+Bexdudx=ABexy=ABex3(Ax+Bex)u = Ax + Be^{-x} \Rightarrow \frac{du}{dx} = A - Be^{-x} \Rightarrow y = \frac{A - Be^{-x}}{3(Ax + Be^{-x})},

and substitution of x=0,y=0x = 0, y = 0 gives A=BA = B and hence y=1ex3(x+ex)y = \frac{1 - e^{-x}}{3(x + e^{-x})}.

(ii) Substituting y=1ududxy = \frac{1}{u} \frac{du}{dx} into the given equation yields

d2udx2+x1xdudx11xu=0\frac{d^2u}{dx^2} + \frac{x}{1-x} \frac{du}{dx} - \frac{1}{1-x} u = 0 which is the equation in the first part with xx replaced by x-x

So the general solution is u=Cx+Dexu = Cx + De^x

Substitution of x=0,y=2x = 0, y = 2 again gives A=BA = B, and hence y=1+exx+exy = \frac{1 + e^x}{x + e^x}

Model Solution

Part (i)

Finding a(x)a(x) and b(x)b(x).

Substituting u=xu = x (so u=1u' = 1, u=0u'' = 0) into u+a(x)u+b(x)u=0u'' + a(x)u' + b(x)u = 0:

0+a(x)1+b(x)x=0    a(x)+xb(x)=0.(i)0 + a(x) \cdot 1 + b(x) \cdot x = 0 \implies a(x) + xb(x) = 0. \qquad \text{(i)}

Substituting u=exu = e^{-x} (so u=exu' = -e^{-x}, u=exu'' = e^{-x}):

ex+a(x)(ex)+b(x)ex=0    1a(x)+b(x)=0.(ii)e^{-x} + a(x)(-e^{-x}) + b(x)e^{-x} = 0 \implies 1 - a(x) + b(x) = 0. \qquad \text{(ii)}

From (i): a(x)=xb(x)a(x) = -xb(x). Substituting into (ii):

1+xb(x)+b(x)=0    b(x)(1+x)=1    b(x)=11+x.1 + xb(x) + b(x) = 0 \implies b(x)(1 + x) = -1 \implies b(x) = \frac{-1}{1+x}.

Therefore a(x)=x1+xa(x) = \frac{x}{1+x}.

General solution. Since u1=xu_1 = x and u2=exu_2 = e^{-x} are two linearly independent solutions:

u=Ax+Bex.u = Ax + Be^{-x}.

Verifying the substitution y=13ududxy = \frac{1}{3u}\frac{\mathrm{d}u}{\mathrm{d}x}.

If y=u3uy = \frac{u'}{3u}, then 3uy=u3uy = u', so u=u3yu = \frac{u'}{3y}.

Differentiating 3uy=u3uy = u' with respect to xx: 3uy+3uy=u3u'y + 3uy' = u'', so u=3uy+3uyu'' = 3u'y + 3uy'.

Substituting into u+x1+xu11+xu=0u'' + \frac{x}{1+x}u' - \frac{1}{1+x}u = 0:

3uy+3uy+x1+xu11+xu=0.3u'y + 3uy' + \frac{x}{1+x}u' - \frac{1}{1+x}u = 0.

Dividing by 3u3u:

uuy+y+x3(1+x)uu13(1+x)=0.\frac{u'}{u}y + y' + \frac{x}{3(1+x)}\frac{u'}{u} - \frac{1}{3(1+x)} = 0.

Since uu=3y\frac{u'}{u} = 3y:

3yy+y+x3(1+x)3y13(1+x)=0,3y \cdot y + y' + \frac{x}{3(1+x)} \cdot 3y - \frac{1}{3(1+x)} = 0,

y+3y2+xy1+x13(1+x)=0,y' + 3y^2 + \frac{xy}{1+x} - \frac{1}{3(1+x)} = 0,

which is exactly the equation (*).

Solving () with y(0)=0y(0) = 0.*

The general solution of the ODE for uu is u=Ax+Bexu = Ax + Be^{-x}, so

y=13ududx=ABex3(Ax+Bex).y = \frac{1}{3u} \cdot \frac{\mathrm{d}u}{\mathrm{d}x} = \frac{A - Be^{-x}}{3(Ax + Be^{-x})}.

Applying y=0y = 0 at x=0x = 0: AB3B=0\frac{A - B}{3B} = 0, so A=BA = B. Taking A=B=1A = B = 1:

y=1ex3(x+ex).y = \frac{1 - e^{-x}}{3(x + e^{-x})}.

Part (ii)

We need to solve dydx+y2+x1xy=11x\frac{\mathrm{d}y}{\mathrm{d}x} + y^2 + \frac{x}{1-x}y = \frac{1}{1-x} with y(0)=2y(0) = 2.

We use the substitution y=1ududxy = \frac{1}{u}\frac{\mathrm{d}u}{\mathrm{d}x} (i.e. y=uuy = \frac{u'}{u}). Then u=uyu' = uy and u=uy+uy=uy2+uyu'' = u'y + uy' = uy^2 + uy', so y=uuy2=uu(u)2u2y' = \frac{u''}{u} - y^2 = \frac{u''}{u} - \frac{(u')^2}{u^2}.

Substituting into the equation:

uuy2+y2+x1xy=11x,\frac{u''}{u} - y^2 + y^2 + \frac{x}{1-x}y = \frac{1}{1-x},

uu+x1xuu=11x.\frac{u''}{u} + \frac{x}{1-x} \cdot \frac{u'}{u} = \frac{1}{1-x}.

Multiplying by uu:

u+x1xu11xu=0.(iii)u'' + \frac{x}{1-x}u' - \frac{1}{1-x}u = 0. \qquad \text{(iii)}

Comparing with the equation from part (i): u+x1+xu11+xu=0u'' + \frac{x}{1+x}u' - \frac{1}{1+x}u = 0.

Replacing xx by x-x in (iii): let v(x)=u(x)v(x) = u(-x), then v=u(x)v' = -u'(-x) and v=u(x)v'' = u''(-x). Substituting into the part (i) equation with xxx \to -x:

u(x)+x1+(x)u(x)11+(x)u(x)=0,u''(-x) + \frac{-x}{1+(-x)}u'(-x) - \frac{1}{1+(-x)}u(-x) = 0,

u(x)+x1xu(x)11xu(x)=0.u''(-x) + \frac{-x}{1-x}u'(-x) - \frac{1}{1-x}u(-x) = 0.

But (iii) requires u(x)+x1xu(x)11xu(x)=0u''(x) + \frac{x}{1-x}u'(x) - \frac{1}{1-x}u(x) = 0. Replacing xx by x-x in (iii):

u(x)+x1(x)u(x)11(x)u(x)=u(x)+x1+xu(x)11+xu(x)=0.u''(-x) + \frac{-x}{1-(-x)}u'(-x) - \frac{1}{1-(-x)}u(-x) = u''(-x) + \frac{-x}{1+x}u'(-x) - \frac{1}{1+x}u(-x) = 0.

This is the part (i) equation with argument x-x. So if f(x)f(x) solves (iii), then f(x)f(-x) satisfies the part (i) ODE.

The part (i) ODE has general solution u=Ax+Bexu = Ax + Be^{-x}. Therefore the general solution of (iii) is:

u(x)=A(x)+Be(x)=Ax+Bex,u(x) = A(-x) + Be^{-(-x)} = -Ax + Be^x,

which we can write as u=Cx+Dexu = Cx + De^x (absorbing the sign into the constants).

Therefore

y=uu=C+DexCx+Dex.y = \frac{u'}{u} = \frac{C + De^x}{Cx + De^x}.

Applying y(0)=2y(0) = 2: C+DD=2\frac{C + D}{D} = 2, so C+D=2DC + D = 2D, giving C=DC = D. Taking C=D=1C = D = 1:

y=1+exx+ex.y = \frac{1 + e^x}{x + e^x}.

Examiner Notes

This ranked alongside question 5 in popularity and success. Frequently, it was calculation errors that obscured the path through part (i) and the two differences between part (i) and part (ii) were enough to put most off the track for part (ii), even if they had completed (i) successfully.