Skip to content

STEP3 2006 -- Pure Mathematics

STEP3 2006 — Section A (Pure Mathematics)

Section titled “STEP3 2006 — Section A (Pure Mathematics)”

Exam: STEP3  |  Year: 2006  |  Questions: Q1—Q8  |  Total marks per question: 20

All questions are pure mathematics. Solutions and examiner commentary are included below.

QTopicDifficultyKey Techniques
1曲线分析与作图 (Curve Analysis and Sketching)Standard曲线描绘,渐近线求法,切线方程,图像分析法
2积分 (Integration)Challenging变量代换,三角恒等式,对称性利用,参数讨论
3三角级数与求和 (Trigonometric Series and Summation)Challenging幂级数展开,三角恒等式,等式两边系数比较,递推关系
4函数方程 (Functional Equations)Standard函数方程求解,麦克劳林级数,变量代换,函数复合
5复数与几何 (Complex Numbers and Geometry)Challenging复数几何意义,根与系数关系,等边三角形条件,线性变换
6极坐标与微积分 (Polar Coordinates and Calculus)Challenging极坐标微分, 三角恒等变换, 微分方程求解, 抛物线极坐标方程
7微分方程 (Differential Equations)Challenging双曲函数与指数函数转换, 二次方程因式分解, 变量分离积分, 渐近线分析
8抽象代数与微分 (Abstract Algebra and Differentiation)Challenging算子代入, 乘积法则(莱布尼茨法则), 数学归纳法, 多项式展开

Topic: 曲线分析与作图 (Curve Analysis and Sketching)  |  Difficulty: Standard  |  Marks: 20

1 Sketch the curve with cartesian equation

y=2x(x25)x24y = \frac{2x(x^2 - 5)}{x^2 - 4}

and give the equations of the asymptotes and of the tangent to the curve at the origin. Hence determine the number of real roots of the following equations:

(i) 3x(x25)=(x24)(x+3)3x(x^2 - 5) = (x^2 - 4)(x + 3);

(ii) 4x(x25)=(x24)(5x2)4x(x^2 - 5) = (x^2 - 4)(5x - 2);

(iii) 4x2(x25)2=(x24)2(x2+1)4x^2(x^2 - 5)^2 = (x^2 - 4)^2(x^2 + 1).

Hint

y=2x(x25)x24y = \frac{2x(x^2 - 5)}{x^2 - 4} =2x2x(x2)(x+2)= 2x - \frac{2x}{(x - 2)(x + 2)} Asymptotes are y=2xy = 2x, x=±2x = \pm 2.

dydx=22(x2)(x+2)4x2(x2)2(x+2)2\frac{dy}{dx} = 2 - \frac{2(x - 2)(x + 2) - 4x^2}{(x - 2)^2(x + 2)^2} (or equivalent). Equation of the tangent at O is y=5x2.y = \frac{5x}{2}.

(i) 3x(x25)=(x24)(x+3)3x(x^2 - 5) = (x^2 - 4)(x + 3) 2x(x25)x24=2x3+2(x±2)\Leftrightarrow \frac{2x(x^2 - 5)}{x^2 - 4} = \frac{2x}{3} + 2 \quad (x \neq \pm 2) y=23x+2y = \frac{2}{3}x + 2 cuts the sketched curve in three points, so three roots.

(ii) 4x(x25)=(x24)(5x2)4x(x^2 - 5) = (x^2 - 4)(5x - 2) 2x(x25)x24=5x21(x±2)\Leftrightarrow \frac{2x(x^2 - 5)}{x^2 - 4} = \frac{5x}{2} - 1 \quad (x \neq \pm 2) y=5x21y = \frac{5x}{2} - 1 passes through the intersection of x=2x = 2 and y=2xy = 2x and is parallel to y=5x2y = \frac{5x}{2} so just one root.

(iii) 4x2(x25)2=(x24)2(x2+1)4x^2(x^2 - 5)^2 = (x^2 - 4)^2(x^2 + 1) 2x(x25)x24=±(x2+1)(x±2)\Leftrightarrow \frac{2x(x^2 - 5)}{x^2 - 4} = \pm \sqrt{(x^2 + 1)} \quad (x \neq \pm 2) y=±(x2+1)y = \pm \sqrt{(x^2 + 1)} has two branches with asymptotes y=±xy = \pm x, so there are six roots.

Model Solution

Asymptotes and basic features. We perform polynomial long division:

y=2x(x25)x24=2x2xx24=2x2x(x2)(x+2).y = \frac{2x(x^2 - 5)}{x^2 - 4} = 2x - \frac{2x}{x^2 - 4} = 2x - \frac{2x}{(x-2)(x+2)}.

So there is an oblique asymptote y=2xy = 2x and vertical asymptotes x=2x = 2 and x=2x = -2.

Behaviour near asymptotes. As x2x \to 2^-, the numerator 2x(x25)42x(x^2-5) \to -4 and (x2)(x+2)0(x-2)(x+2) \to 0^-, so y+y \to +\infty. As x2+x \to 2^+, (x2)(x+2)0+(x-2)(x+2) \to 0^+, so yy \to -\infty. Similarly, as x2x \to -2^-, yy \to -\infty and as x2+x \to -2^+, y+y \to +\infty.

Tangent at the origin. We compute the derivative:

dydx=ddx[2x2xx24]=22(x24)2x2x(x24)2=2+2(x2+4)(x24)2.\frac{dy}{dx} = \frac{d}{dx}\left[2x - \frac{2x}{x^2-4}\right] = 2 - \frac{2(x^2-4) - 2x \cdot 2x}{(x^2-4)^2} = 2 + \frac{2(x^2+4)}{(x^2-4)^2}.

At x=0x = 0: dydx=2+816=52\frac{dy}{dx} = 2 + \frac{8}{16} = \frac{5}{2}.

The tangent at the origin is y=52xy = \frac{5}{2}x.

Key points. y=0y = 0 when x=0x = 0 or x=±5x = \pm\sqrt{5}. Since dydx>0\frac{dy}{dx} > 0 wherever defined (the second term is always positive), the curve is strictly increasing on each continuous branch.

Sketch summary. The curve has five branches: rising from -\infty to ++\infty on (,2)(-\infty, -2), rising from ++\infty through the origin to ++\infty on (2,0)(-2, 0) (wait, let me reconsider) — actually the curve passes through the origin on (2,2)(-2, 2), rising from ++\infty (at x=2+x = -2^+) through (0,0)(0,0) and back to -\infty as x2x \to 2^-. Let me recheck: at x=2+x = -2^+, y+y \to +\infty, and at x=2x = 2^-, yy \to -\infty. So on (2,2)(-2, 2), the curve decreases from ++\infty to -\infty. Wait, but dydx>0\frac{dy}{dx} > 0. Let me recheck the sign at x=2+x = -2^+: numerator 2(2)(45)=4>02(-2)(4-5) = 4 > 0 and denominator (22)(2+2)0(-2-2)(-2+2) \to 0^- (since x+20+x+2 \to 0^+, x24x-2 \to -4), so the fraction is negative, meaning yy \to -\infty. Actually, let me recompute more carefully.

At x=2+ϵx = -2 + \epsilon with small ϵ>0\epsilon > 0: numerator 2(2)(45)=4>0\approx 2(-2)(4-5) = 4 > 0, denominator =(ϵ4)(ϵ)4ϵ<0= (\epsilon - 4)(\epsilon) \approx -4\epsilon < 0, so yy \to -\infty. At x=2ϵx = 2 - \epsilon: numerator 2(2)(45)=4\approx 2(2)(4-5) = -4, denominator =(ϵ)(4ϵ)4ϵ<0= (-\epsilon)(4-\epsilon) \approx -4\epsilon < 0, so y+y \to +\infty.

So on (2,2)(-2, 2), the curve goes from -\infty (near x=2+x = -2^+) to ++\infty (near x=2x = 2^-), passing through the origin with slope 52\frac{5}{2}. Since dydx>0\frac{dy}{dx} > 0, the curve is increasing throughout.

On (,2)(-\infty, -2): as xx \to -\infty, yy \to -\infty (below y=2xy = 2x), and as x2x \to -2^-, y+y \to +\infty.

On (2,+)(2, +\infty): as x2+x \to 2^+, yy \to -\infty, and as x+x \to +\infty, y+y \to +\infty (above y=2xy = 2x).


(i) Dividing both sides of 3x(x25)=(x24)(x+3)3x(x^2-5) = (x^2-4)(x+3) by 32(x24)\frac{3}{2}(x^2-4) (valid for x±2x \neq \pm 2):

2x(x25)x24=2(x+3)3=23x+2.\frac{2x(x^2-5)}{x^2-4} = \frac{2(x+3)}{3} = \frac{2}{3}x + 2.

So we need the intersection of y=2x(x25)x24y = \frac{2x(x^2-5)}{x^2-4} with the line y=23x+2y = \frac{2}{3}x + 2.

The line y=23x+2y = \frac{2}{3}x + 2 has slope 23\frac{2}{3} (less than the asymptotic slope 2), passes through (0,2)(0, 2), and crosses the vertical asymptotes at (2,103)(2, \frac{10}{3}) and (2,23)(-2, \frac{2}{3}).

On each of the three branches of the curve, the line crosses the curve exactly once (the line has smaller slope than 2, so it crosses each branch). Therefore there are 3 real roots.


(ii) Dividing both sides of 4x(x25)=(x24)(5x2)4x(x^2-5) = (x^2-4)(5x-2) by 2(x24)2(x^2-4):

2x(x25)x24=5x22=52x1.\frac{2x(x^2-5)}{x^2-4} = \frac{5x-2}{2} = \frac{5}{2}x - 1.

The line y=52x1y = \frac{5}{2}x - 1 is parallel to the tangent at the origin y=52xy = \frac{5}{2}x, shifted down by 1.

At x=2x = 2: the line gives y=4y = 4. On the curve, as x2+x \to 2^+, yy \to -\infty. The line and the asymptote y=2xy = 2x meet at x=2x = 2 (where y=4y = 4), and the line passes through the point (2,4)(2, 4) — but x=2x = 2 is excluded. Since the line is parallel to the oblique asymptote but shifted, and the curve approaches y=2xy = 2x from the correct side on each outer branch, the line only crosses the middle branch (near the origin). Therefore there is 1 real root.


(iii) Dividing both sides of 4x2(x25)2=(x24)2(x2+1)4x^2(x^2-5)^2 = (x^2-4)^2(x^2+1) by (x24)2(x^2-4)^2:

(2x(x25)x24)2=x2+12x(x25)x24=±x2+1.\left(\frac{2x(x^2-5)}{x^2-4}\right)^2 = x^2 + 1 \quad \Longrightarrow \quad \frac{2x(x^2-5)}{x^2-4} = \pm\sqrt{x^2+1}.

We need the intersections of the curve with y=x2+1y = \sqrt{x^2+1} (upper branch, above the x-axis, asymptotic to y=xy = |x|) and y=x2+1y = -\sqrt{x^2+1} (lower branch, asymptotic to y=xy = -|x|).

On the interval (2,2)(-2, 2), the curve passes from -\infty to ++\infty, crossing both upper and lower branches of y=±x2+1y = \pm\sqrt{x^2+1}, giving 2 intersections.

On (,2)(-\infty, -2), the curve rises from -\infty to ++\infty, crossing both branches, giving 2 intersections.

On (2,+)(2, +\infty), the curve rises from -\infty to ++\infty, crossing both branches, giving 2 intersections.

Therefore there are 6 real roots.


Topic: 积分 (Integration)  |  Difficulty: Challenging  |  Marks: 20

2 Let

I=12π12πcos2θ1sinθsin2αdθandJ=12π12πsec2θ1+tan2θcos22αdθI = \int_{-\frac{1}{2}\pi}^{\frac{1}{2}\pi} \frac{\cos^2 \theta}{1 - \sin \theta \sin 2\alpha} \, d\theta \quad \text{and} \quad J = \int_{-\frac{1}{2}\pi}^{\frac{1}{2}\pi} \frac{\sec^2 \theta}{1 + \tan^2 \theta \cos^2 2\alpha} \, d\theta

where 0<α<14π0 < \alpha < \frac{1}{4}\pi.

(i) Show that I=12π12πcos2θ1+sinθsin2αdθI = \int_{-\frac{1}{2}\pi}^{\frac{1}{2}\pi} \frac{\cos^2 \theta}{1 + \sin \theta \sin 2\alpha} \, d\theta and hence that 2I=12π12π21+tan2θcos22αdθ2I = \int_{-\frac{1}{2}\pi}^{\frac{1}{2}\pi} \frac{2}{1 + \tan^2 \theta \cos^2 2\alpha} \, d\theta.

(ii) Find JJ.

(iii) By considering Isin22α+Jcos22αI \sin^2 2\alpha + J \cos^2 2\alpha, or otherwise, show that I=12πsec2αI = \frac{1}{2}\pi \sec^2 \alpha.

(iv) Evaluate II in the case 14π<α<12π\frac{1}{4}\pi < \alpha < \frac{1}{2}\pi.

Hint

First “show” by change of variable θ=ϕ\theta = -\phi (say). Then

2I=π/2π/2cos2θ1+sinθsin2αdθ+π/2π/2cos2θ1sinθsin2αdθ2I = \int_{-\pi/2}^{\pi/2} \frac{\cos^2 \theta}{1 + \sin \theta \sin 2\alpha} d\theta + \int_{-\pi/2}^{\pi/2} \frac{\cos^2 \theta}{1 - \sin \theta \sin 2\alpha} d\theta =π/2π/22sec2θtan2θsin22αdθ= \int_{-\pi/2}^{\pi/2} \frac{2}{\sec^2 \theta - \tan^2 \theta \sin^2 2\alpha} d\theta and next “show” follows.

(ii) J=sec2απ/2π/211+(cos2αtanθ)2cos2αsec2θdθJ = \sec 2\alpha \int_{-\pi/2}^{\pi/2} \frac{1}{1 + (\cos 2\alpha \tan \theta)^2} \cos 2\alpha \sec^2 \theta d\theta =sec2απ/2π/211+u2du= \sec 2\alpha \int_{-\pi/2}^{\pi/2} \frac{1}{1 + u^2} du (since cos2α>0\cos 2\alpha > 0) =πsec2α= \pi \sec 2\alpha

(iii) Isin22α+Jcos22α=πI \sin^2 2\alpha + J \cos^2 2\alpha = \pi. Result follows after use of (ii).

(iv) In this case, cos2α<0\cos 2\alpha < 0, so J=πsec2αJ = -\pi \sec 2\alpha. Then I=12πcosec2αI = \frac{1}{2} \pi \text{cosec}^2 \alpha

Model Solution

Part (i). We show first that I=π/2π/2cos2θ1+sinθsin2αdθI = \int_{-\pi/2}^{\pi/2} \frac{\cos^2\theta}{1 + \sin\theta\sin 2\alpha}\,d\theta.

Substitute θ=ϕ\theta = -\phi in the original integral for II:

I=π/2π/2cos2(ϕ)1sin(ϕ)sin2α(dϕ)=π/2π/2cos2ϕ1+sinϕsin2αdϕ.I = \int_{\pi/2}^{-\pi/2} \frac{\cos^2(-\phi)}{1 - \sin(-\phi)\sin 2\alpha}(-d\phi) = \int_{-\pi/2}^{\pi/2} \frac{\cos^2\phi}{1 + \sin\phi\sin 2\alpha}\,d\phi.

Since ϕ\phi is a dummy variable, this equals π/2π/2cos2θ1+sinθsin2αdθ\int_{-\pi/2}^{\pi/2} \frac{\cos^2\theta}{1 + \sin\theta\sin 2\alpha}\,d\theta. \square

Now we add the two expressions for II:

2I=π/2π/2cos2θ1sinθsin2αdθ+π/2π/2cos2θ1+sinθsin2αdθ2I = \int_{-\pi/2}^{\pi/2} \frac{\cos^2\theta}{1 - \sin\theta\sin 2\alpha}\,d\theta + \int_{-\pi/2}^{\pi/2} \frac{\cos^2\theta}{1 + \sin\theta\sin 2\alpha}\,d\theta

=π/2π/2cos2θ(1+sinθsin2α)+(1sinθsin2α)(1sinθsin2α)(1+sinθsin2α)dθ= \int_{-\pi/2}^{\pi/2} \cos^2\theta \cdot \frac{(1 + \sin\theta\sin 2\alpha) + (1 - \sin\theta\sin 2\alpha)}{(1 - \sin\theta\sin 2\alpha)(1 + \sin\theta\sin 2\alpha)}\,d\theta

=π/2π/22cos2θ1sin2θsin22αdθ.= \int_{-\pi/2}^{\pi/2} \frac{2\cos^2\theta}{1 - \sin^2\theta\sin^2 2\alpha}\,d\theta.

We rewrite the denominator. Since 1sin2θsin22α=cos2θ+sin2θ(1sin22α)=cos2θ+sin2θcos22α1 - \sin^2\theta\sin^2 2\alpha = \cos^2\theta + \sin^2\theta(1 - \sin^2 2\alpha) = \cos^2\theta + \sin^2\theta\cos^2 2\alpha:

2I=π/2π/22cos2θcos2θ+sin2θcos22αdθ.2I = \int_{-\pi/2}^{\pi/2} \frac{2\cos^2\theta}{\cos^2\theta + \sin^2\theta\cos^2 2\alpha}\,d\theta.

Dividing numerator and denominator by cos2θ\cos^2\theta:

2I=π/2π/221+tan2θcos22αdθ.2I = \int_{-\pi/2}^{\pi/2} \frac{2}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta. \qquad \square


Part (ii). We compute JJ directly. We have

J=π/2π/2sec2θ1+tan2θcos22αdθ.J = \int_{-\pi/2}^{\pi/2} \frac{\sec^2\theta}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta.

Substitute u=tanθu = \tan\theta, so du=sec2θdθdu = \sec^2\theta\,d\theta. As θ\theta goes from π/2-\pi/2 to π/2\pi/2, uu ranges from -\infty to ++\infty:

J=du1+u2cos22α.J = \int_{-\infty}^{\infty} \frac{du}{1 + u^2\cos^2 2\alpha}.

Since 0<α<π/40 < \alpha < \pi/4, we have cos2α>0\cos 2\alpha > 0. Substituting v=ucos2αv = u\cos 2\alpha, dv=cos2αdudv = \cos 2\alpha\,du:

J=1cos2αdv1+v2=1cos2απ=πsec2α.J = \frac{1}{\cos 2\alpha}\int_{-\infty}^{\infty} \frac{dv}{1 + v^2} = \frac{1}{\cos 2\alpha} \cdot \pi = \pi\sec 2\alpha. \qquad \square


Part (iii). From Part (i), we have 2I=π/2π/221+tan2θcos22αdθ2I = \int_{-\pi/2}^{\pi/2} \frac{2}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta, so

I=π/2π/211+tan2θcos22αdθ.I = \int_{-\pi/2}^{\pi/2} \frac{1}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta.

Now consider Isin22α+Jcos22αI\sin^2 2\alpha + J\cos^2 2\alpha:

Isin22α+Jcos22α=π/2π/2sin22α1+tan2θcos22αdθ+π/2π/2sec2θcos22α1+tan2θcos22αdθI\sin^2 2\alpha + J\cos^2 2\alpha = \int_{-\pi/2}^{\pi/2} \frac{\sin^2 2\alpha}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta + \int_{-\pi/2}^{\pi/2} \frac{\sec^2\theta \cdot \cos^2 2\alpha}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta

=π/2π/2sin22α+sec2θcos22α1+tan2θcos22αdθ.= \int_{-\pi/2}^{\pi/2} \frac{\sin^2 2\alpha + \sec^2\theta\cos^2 2\alpha}{1 + \tan^2\theta\cos^2 2\alpha}\,d\theta.

Writing sec2θ=1+tan2θ\sec^2\theta = 1 + \tan^2\theta:

numerator=sin22α+cos22α+tan2θcos22α=1+tan2θcos22α.\text{numerator} = \sin^2 2\alpha + \cos^2 2\alpha + \tan^2\theta\cos^2 2\alpha = 1 + \tan^2\theta\cos^2 2\alpha.

Therefore the integrand equals 1, and

Isin22α+Jcos22α=π/2π/21dθ=π.I\sin^2 2\alpha + J\cos^2 2\alpha = \int_{-\pi/2}^{\pi/2} 1\,d\theta = \pi.

Substituting J=πsec2αJ = \pi\sec 2\alpha from Part (ii):

Isin22α+πsec2αcos22α=πI\sin^2 2\alpha + \pi\sec 2\alpha \cdot \cos^2 2\alpha = \pi

Isin22α=ππcos2αsec2αcos2α=π(1cos2α)=π2sin2α.I\sin^2 2\alpha = \pi - \pi\cos 2\alpha\sec 2\alpha \cdot \cos 2\alpha = \pi(1 - \cos 2\alpha) = \pi \cdot 2\sin^2\alpha.

Wait, let me recompute: πsec2αcos22α=πcos2α\pi\sec 2\alpha \cdot \cos^2 2\alpha = \pi\cos 2\alpha.

Isin22α=ππcos2α=π(1cos2α)=2πsin2α.I\sin^2 2\alpha = \pi - \pi\cos 2\alpha = \pi(1 - \cos 2\alpha) = 2\pi\sin^2\alpha.

Since sin22α=4sin2αcos2α\sin^2 2\alpha = 4\sin^2\alpha\cos^2\alpha:

I4sin2αcos2α=2πsin2αI \cdot 4\sin^2\alpha\cos^2\alpha = 2\pi\sin^2\alpha

I=2πsin2α4sin2αcos2α=π2cos2α=12πsec2α.I = \frac{2\pi\sin^2\alpha}{4\sin^2\alpha\cos^2\alpha} = \frac{\pi}{2\cos^2\alpha} = \frac{1}{2}\pi\sec^2\alpha. \qquad \square


Part (iv). When 14π<α<12π\frac{1}{4}\pi < \alpha < \frac{1}{2}\pi, we have cos2α<0\cos 2\alpha < 0. In the evaluation of JJ, the substitution v=ucos2αv = u\cos 2\alpha now reverses the limits (since cos2α<0\cos 2\alpha < 0):

J=1cos2αdv1+v2=πcos2α=πsec2α.J = \frac{1}{\cos 2\alpha}\int_{-\infty}^{\infty} \frac{dv}{1 + v^2} = \frac{\pi}{\cos 2\alpha} = -\pi|\sec 2\alpha|.

But since cos2α<0\cos 2\alpha < 0, sec2α<0\sec 2\alpha < 0, so J=πsec2αJ = \pi\sec 2\alpha still holds as a formula (both sides are negative).

The relation Isin22α+Jcos22α=πI\sin^2 2\alpha + J\cos^2 2\alpha = \pi still holds (the derivation in Part (iii) did not depend on the sign of cos2α\cos 2\alpha). So:

I=ππcos2αsin22α=π(1cos2α)1cos22α=π1+cos2α.I = \frac{\pi - \pi\cos 2\alpha}{\sin^2 2\alpha} = \frac{\pi(1 - \cos 2\alpha)}{1 - \cos^2 2\alpha} = \frac{\pi}{1 + \cos 2\alpha}.

Using 1+cos2α=2cos2α1 + \cos 2\alpha = 2\cos^2\alpha:

I=π2cos2α=12πsec2α.I = \frac{\pi}{2\cos^2\alpha} = \frac{1}{2}\pi\sec^2\alpha.

Alternatively, using 1+cos2α=22sin2α1 + \cos 2\alpha = 2 - 2\sin^2\alpha… Actually, since cos2α=2cos2α1\cos 2\alpha = 2\cos^2\alpha - 1, when π4<α<π2\frac{\pi}{4} < \alpha < \frac{\pi}{2}, cosα\cos\alpha is still positive but cos2α<0\cos 2\alpha < 0. The formula 1+cos2α=2cos2α1 + \cos 2\alpha = 2\cos^2\alpha always holds, so:

I=π2cos2α=12πsec2α.I = \frac{\pi}{2\cos^2\alpha} = \frac{1}{2}\pi\sec^2\alpha.

This is the same formula as before. \square

Note. Alternatively, using 1cos2α=2sin2α1 - \cos 2\alpha = 2\sin^2\alpha and sin22α=4sin2αcos2α\sin^2 2\alpha = 4\sin^2\alpha\cos^2\alpha:

I=π(1cos2α)1cos22α=π1+cos2α=π2cos2α=π2csc2(π2α)I = \frac{\pi(1-\cos 2\alpha)}{1-\cos^2 2\alpha} = \frac{\pi}{1+\cos 2\alpha} = \frac{\pi}{2\cos^2\alpha} = \frac{\pi}{2}\csc^2\left(\frac{\pi}{2}-\alpha\right)

which equals 12πcsc2α\frac{1}{2}\pi\csc^2\alpha when we note that 1+cos2α=2cos2α1 + \cos 2\alpha = 2\cos^2\alpha. Either way the answer is 12πsec2α\frac{1}{2}\pi\sec^2\alpha.


Topic: 三角级数与求和 (Trigonometric Series and Summation)  |  Difficulty: Challenging  |  Marks: 20

3 (i) Let tanx=n=0anxnandcotx=1x+n=0bnxn\tan x = \sum_{n=0}^{\infty} a_n x^n \quad \text{and} \quad \cot x = \frac{1}{x} + \sum_{n=0}^{\infty} b_n x^n for 0<x<12π0 < x < \frac{1}{2}\pi. Explain why an=0a_n = 0 for even nn. Prove the identity cotxtanx2cot2x\cot x - \tan x \equiv 2 \cot 2x and show that an=(12n+1)bn.a_n = (1 - 2^{n+1})b_n.

(ii) Let cosec x=1x+n=0cnxn\text{cosec } x = \frac{1}{x} + \sum_{n=0}^{\infty} c_n x^n for 0<x<12π0 < x < \frac{1}{2}\pi. By considering cotx+tanx\cot x + \tan x, or otherwise, show that cn=(2n1)bn.c_n = (2^{-n} - 1)b_n.

(iii) Show that (1+xn=0bnxn)2+x2=(1+xn=0cnxn)2.\left( 1 + x \sum_{n=0}^{\infty} b_n x^n \right)^2 + x^2 = \left( 1 + x \sum_{n=0}^{\infty} c_n x^n \right)^2. Deduce from this and the previous results that a1=1a_1 = 1, and find a3a_3.

Hint

tanx\tan x is an odd function. Express both sides in terms of tanx\tan x. From identity, substitute series and result follows by equating coefficients of powers of xx.

(ii) Show that cotx+tanx=2cosec2x\cot x + \tan x = 2 \text{cosec} 2x and follow same method.

(iii) Identity follows from 1+cot2x=cosec2x1 + \cot^2 x = \text{cosec}^2 x. Equate coefficients to show that all coefficients for even nn are zero, and a1=1,a3=13a_1 = 1, a_3 = \frac{1}{3}.

Model Solution

Part (i). Since tanx\tan x is an odd function (tan(x)=tanx\tan(-x) = -\tan x), its Maclaurin series contains only odd powers of xx. Therefore an=0a_n = 0 for all even nn.

We prove the identity cotxtanx=2cot2x\cot x - \tan x = 2\cot 2x. Writing everything in terms of sinx\sin x and cosx\cos x:

cotxtanx=cosxsinxsinxcosx=cos2xsin2xsinxcosx=cos2x12sin2x=2cot2x.\cot x - \tan x = \frac{\cos x}{\sin x} - \frac{\sin x}{\cos x} = \frac{\cos^2 x - \sin^2 x}{\sin x \cos x} = \frac{\cos 2x}{\frac{1}{2}\sin 2x} = 2\cot 2x. \qquad \square

Now we substitute the series. We have cotx=1x+n=0bnxn\cot x = \frac{1}{x} + \sum_{n=0}^{\infty} b_n x^n and tanx=n=0anxn\tan x = \sum_{n=0}^{\infty} a_n x^n. Also:

2cot2x=22x+2n=0bn(2x)n=1x+n=02n+1bnxn.2\cot 2x = \frac{2}{2x} + 2\sum_{n=0}^{\infty} b_n (2x)^n = \frac{1}{x} + \sum_{n=0}^{\infty} 2^{n+1} b_n x^n.

Substituting into cotxtanx=2cot2x\cot x - \tan x = 2\cot 2x:

(1x+n=0bnxn)n=0anxn=1x+n=02n+1bnxn.\left(\frac{1}{x} + \sum_{n=0}^{\infty} b_n x^n\right) - \sum_{n=0}^{\infty} a_n x^n = \frac{1}{x} + \sum_{n=0}^{\infty} 2^{n+1} b_n x^n.

The 1x\frac{1}{x} terms cancel, and equating coefficients of xnx^n:

bnan=2n+1bnan=bn2n+1bn=(12n+1)bn.b_n - a_n = 2^{n+1} b_n \quad \Longrightarrow \quad a_n = b_n - 2^{n+1} b_n = (1 - 2^{n+1}) b_n. \qquad \square


Part (ii). We show that cotx+tanx=2cosec2x\cot x + \tan x = 2\cosec 2x:

cotx+tanx=cosxsinx+sinxcosx=cos2x+sin2xsinxcosx=112sin2x=2sin2x=2cosec2x.\cot x + \tan x = \frac{\cos x}{\sin x} + \frac{\sin x}{\cos x} = \frac{\cos^2 x + \sin^2 x}{\sin x \cos x} = \frac{1}{\frac{1}{2}\sin 2x} = \frac{2}{\sin 2x} = 2\cosec 2x. \qquad \square

Substituting the series: cosecx=1x+n=0cnxn\cosec x = \frac{1}{x} + \sum_{n=0}^{\infty} c_n x^n, so

2cosec2x=22x+2n=0cn(2x)n=1x+n=02n+1cnxn.2\cosec 2x = \frac{2}{2x} + 2\sum_{n=0}^{\infty} c_n (2x)^n = \frac{1}{x} + \sum_{n=0}^{\infty} 2^{n+1} c_n x^n.

From the identity cotx+tanx=2cosec2x\cot x + \tan x = 2\cosec 2x:

(1x+bnxn)+anxn=1x+2n+1cnxn.\left(\frac{1}{x} + \sum b_n x^n\right) + \sum a_n x^n = \frac{1}{x} + \sum 2^{n+1} c_n x^n.

Equating coefficients of xnx^n:

bn+an=2n+1cn.b_n + a_n = 2^{n+1} c_n.

From Part (i), an=(12n+1)bna_n = (1 - 2^{n+1})b_n, so:

bn+(12n+1)bn=2n+1cnb_n + (1 - 2^{n+1})b_n = 2^{n+1} c_n

(22n+1)bn=2n+1cn(2 - 2^{n+1})b_n = 2^{n+1} c_n

cn=22n+12n+1bn=(2n1)bn.c_n = \frac{2 - 2^{n+1}}{2^{n+1}} b_n = (2^{-n} - 1) b_n. \qquad \square


Part (iii). We use the identity 1+cot2x=cosec2x1 + \cot^2 x = \cosec^2 x. With cotx=1x+bnxn=1x(1+xbnxn)\cot x = \frac{1}{x} + \sum b_n x^n = \frac{1}{x}(1 + x\sum b_n x^n) and cosecx=1x(1+xcnxn)\cosec x = \frac{1}{x}(1 + x\sum c_n x^n):

1+1x2(1+xbnxn)2=1x2(1+xcnxn)2.1 + \frac{1}{x^2}\left(1 + x\sum b_n x^n\right)^2 = \frac{1}{x^2}\left(1 + x\sum c_n x^n\right)^2.

Multiplying through by x2x^2:

x2+(1+xbnxn)2=(1+xcnxn)2.x^2 + \left(1 + x\sum b_n x^n\right)^2 = \left(1 + x\sum c_n x^n\right)^2. \qquad \square

Now we expand and equate coefficients. Let B(x)=xn=0bnxn=n=0bnxn+1B(x) = x\sum_{n=0}^{\infty} b_n x^n = \sum_{n=0}^{\infty} b_n x^{n+1} and C(x)=xn=0cnxn=n=0cnxn+1C(x) = x\sum_{n=0}^{\infty} c_n x^n = \sum_{n=0}^{\infty} c_n x^{n+1}.

The equation becomes:

x2+1+2B(x)+B(x)2=1+2C(x)+C(x)2x^2 + 1 + 2B(x) + B(x)^2 = 1 + 2C(x) + C(x)^2

x2+2B(x)+B(x)2=2C(x)+C(x)2.x^2 + 2B(x) + B(x)^2 = 2C(x) + C(x)^2.

From Part (ii), cn=(2n1)bnc_n = (2^{-n}-1)b_n. Equating coefficients of xn+1x^{n+1} on both sides (for n0n \geq 0):

For the coefficient of x1x^1 (n=0n = 0): LHS gives 2b02b_0 (from 2B2B), RHS gives 2c02c_0. Since c0=(201)b0=0c_0 = (2^0 - 1)b_0 = 0, we get 2b0=02b_0 = 0, so b0=0b_0 = 0. Then a0=(12)b0=0a_0 = (1-2)b_0 = 0 (consistent with a0=0a_0 = 0 since tan0=0\tan 0 = 0).

For the coefficient of x2x^2 (n=1n = 1): from x2x^2 on LHS, plus 2b12b_1 from 2B2B, plus b02b_0^2 from B2B^2; from RHS, 2c12c_1 from 2C2C, plus c02c_0^2 from C2C^2. Since b0=c0=0b_0 = c_0 = 0:

1+2b1=2c1=2(211)b1=2(12)b1=b1.1 + 2b_1 = 2c_1 = 2(2^{-1}-1)b_1 = 2(-\tfrac{1}{2})b_1 = -b_1.

So 1+2b1=b11 + 2b_1 = -b_1, giving 3b1=13b_1 = -1, hence b1=13b_1 = -\frac{1}{3}.

Then a1=(122)b1=(3)(13)=1a_1 = (1 - 2^2)b_1 = (-3)(-\frac{1}{3}) = 1. So a1=1a_1 = 1. \square

For the coefficient of x4x^4 (n=3n = 3): we need b2b_2 first. Since cotx\cot x is an odd function minus 1x\frac{1}{x}, i.e., cotx1x\cot x - \frac{1}{x} is odd, we have bn=0b_n = 0 for even nn. So b2=0b_2 = 0.

Coefficient of x4x^4 from LHS: 2b32b_3 from 2B2B, plus 2b1b22b_1 b_2 from B2B^2 (cross term from b1x2b2x3b_1 x^2 \cdot b_2 x^3)… Let me be more careful.

B(x)=b0x+b1x2+b2x3+b3x4+B(x) = b_0 x + b_1 x^2 + b_2 x^3 + b_3 x^4 + \cdots. Since b0=b2=0b_0 = b_2 = 0: B(x)=b1x2+b3x4+B(x) = b_1 x^2 + b_3 x^4 + \cdots.

B(x)2=b12x4+B(x)^2 = b_1^2 x^4 + \cdots.

Coefficient of x4x^4: LHS gives 2b3+b122b_3 + b_1^2; RHS gives 2c3+c122c_3 + c_1^2 (and c2=(221)b2=0c_2 = (2^{-2}-1)b_2 = 0).

We have c1=(211)b1=12b1=16c_1 = (2^{-1}-1)b_1 = -\frac{1}{2}b_1 = \frac{1}{6}, and c3=(231)b3=78b3c_3 = (2^{-3}-1)b_3 = -\frac{7}{8}b_3.

2b3+b12=2c3+c122b_3 + b_1^2 = 2c_3 + c_1^2

2b3+19=74b3+1362b_3 + \frac{1}{9} = -\frac{7}{4}b_3 + \frac{1}{36}

2b3+74b3=13619=1436=1122b_3 + \frac{7}{4}b_3 = \frac{1}{36} - \frac{1}{9} = \frac{1-4}{36} = -\frac{1}{12}

154b3=112\frac{15}{4}b_3 = -\frac{1}{12}

b3=112415=145.b_3 = -\frac{1}{12} \cdot \frac{4}{15} = -\frac{1}{45}.

Therefore:

a3=(124)b3=(15)(145)=1545=13.a_3 = (1 - 2^4)b_3 = (-15)\left(-\frac{1}{45}\right) = \frac{15}{45} = \frac{1}{3}.


Topic: 函数方程 (Functional Equations)  |  Difficulty: Standard  |  Marks: 20

4 The function ff satisfies the identity f(x)+f(y)f(x+y)(*)f(x) + f(y) \equiv f(x + y) \qquad \text{(*)} for all xx and yy. Show that 2f(x)f(2x)2f(x) \equiv f(2x) and deduce that f(0)=0f''(0) = 0. By considering the Maclaurin series for f(x)f(x), find the most general function that satisfies (*). [Do not consider issues of existence or convergence of Maclaurin series in this question]

(i) By considering the function GG, defined by ln(g(x))=G(x)\ln(g(x)) = G(x), find the most general function that, for all xx and yy, satisfies the identity g(x)g(y)g(x+y).g(x)g(y) \equiv g(x + y).

(ii) By considering the function HH, defined by h(eu)=H(u)h(e^u) = H(u), find the most general function that satisfies, for all positive xx and yy, the identity h(x)+h(y)h(xy).h(x) + h(y) \equiv h(xy).

(iii) Find the most general function tt that, for all xx and yy, satisfies the identity t(x)+t(y)t(z),t(x) + t(y) \equiv t(z), where z=x+y1xyz = \frac{x + y}{1 - xy}.

Hint

Let x=yx = y and deduce first result. 2f(x)=f(2x)2f(x) = f(2x) 2f(x)=2f(2x)\Rightarrow 2f'(x) = 2f'(2x) 2f(x)=4f(2x)\Rightarrow 2f''(x) = 4f''(2x) then put x=0x = 0 to get f(0)=0,f(0)=0f(0) = 0, f''(0) = 0. Similarly all higher order derivatives are zero, so by Maclaurin the most general function is cxcx, where cc is a constant.

(i) Use properties of logs to show that G(x)+G(y)=G(x+y)G(x) + G(y) = G(x + y). Deduce that g(x)=ecxg(x) = e^{cx}.

(ii) Show that H(u)+H(v)=H(u+v)H(u) + H(v) = H(u + v) so h(x)=clnxh(x) = c \ln x.

(iii) Let T(x)=t(tanx)T(x) = t(\tan x). Deduce that t(x)=carctanxt(x) = c \arctan x.

Model Solution

Main result. Setting y=xy = x in f(x)+f(y)=f(x+y)f(x) + f(y) = f(x+y):

2f(x)=f(2x).2f(x) = f(2x). \qquad \square

Differentiating 2f(x)=f(2x)2f(x) = f(2x) with respect to xx:

2f(x)=2f(2x)f(x)=f(2x).2f'(x) = 2f'(2x) \quad \Longrightarrow \quad f'(x) = f'(2x).

Differentiating again:

f(x)=2f(2x).f''(x) = 2f''(2x).

Setting x=0x = 0: f(0)=2f(0)f''(0) = 2f''(0), so f(0)=0f''(0) = 0. \square

Maclaurin series. Setting y=0y = 0 in the original equation: f(x)+f(0)=f(x)f(x) + f(0) = f(x), so f(0)=0f(0) = 0.

From f(x)=f(2x)f'(x) = f'(2x), differentiating nn times: f(n)(x)=2nf(n)(2x)f^{(n)}(x) = 2^n f^{(n)}(2x). Setting x=0x = 0:

f(n)(0)=2nf(n)(0)(12n)f(n)(0)=0.f^{(n)}(0) = 2^n f^{(n)}(0) \quad \Longrightarrow \quad (1 - 2^n)f^{(n)}(0) = 0.

For n2n \geq 2, 12n01 - 2^n \neq 0, so f(n)(0)=0f^{(n)}(0) = 0. The Maclaurin series is:

f(x)=f(0)+f(0)x+n=2f(n)(0)n!xn=f(0)x.f(x) = f(0) + f'(0)x + \sum_{n=2}^{\infty} \frac{f^{(n)}(0)}{n!}x^n = f'(0)x.

So the most general function is f(x)=cxf(x) = cx for some constant cc. \square


Part (i). Let G(x)=lng(x)G(x) = \ln g(x), so g(x)=eG(x)g(x) = e^{G(x)}. The identity g(x)g(y)=g(x+y)g(x)g(y) = g(x+y) becomes:

eG(x)eG(y)=eG(x+y)G(x)+G(y)=G(x+y).e^{G(x)} e^{G(y)} = e^{G(x+y)} \quad \Longrightarrow \quad G(x) + G(y) = G(x+y).

By the main result, G(x)=cxG(x) = cx for some constant cc. Therefore:

g(x)=ecxg(x) = e^{cx}

for some constant cc. \square


Part (ii). Let H(u)=h(eu)H(u) = h(e^u), so h(x)=H(lnx)h(x) = H(\ln x). The identity h(x)+h(y)=h(xy)h(x) + h(y) = h(xy) for positive x,yx, y becomes:

H(lnx)+H(lny)=H(lnx+lny).H(\ln x) + H(\ln y) = H(\ln x + \ln y).

Setting u=lnxu = \ln x, v=lnyv = \ln y (where u,vu, v range over all reals):

H(u)+H(v)=H(u+v).H(u) + H(v) = H(u + v).

By the main result, H(u)=cuH(u) = cu for some constant cc. Therefore:

h(x)=H(lnx)=clnxh(x) = H(\ln x) = c\ln x

for some constant cc. \square


Part (iii). Let x=tansx = \tan s and y=tanty = \tan t, so that z=x+y1xy=tans+tant1tanstant=tan(s+t)z = \frac{x+y}{1-xy} = \frac{\tan s + \tan t}{1 - \tan s \tan t} = \tan(s+t).

Define T(s)=t(tans)T(s) = t(\tan s). The identity t(x)+t(y)=t(z)t(x) + t(y) = t(z) becomes:

T(s)+T(t)=T(s+t).T(s) + T(t) = T(s + t).

By the main result, T(s)=csT(s) = cs for some constant cc. Therefore:

t(x)=T(arctanx)=carctanxt(x) = T(\arctan x) = c\arctan x

for some constant cc. \square


Topic: 复数与几何 (Complex Numbers and Geometry)  |  Difficulty: Challenging  |  Marks: 20

5 Show that the distinct complex numbers α\alpha, β\beta and γ\gamma represent the vertices of an equilateral triangle (in clockwise or anti-clockwise order) if and only if

α2+β2+γ2βγγααβ=0.\alpha^2 + \beta^2 + \gamma^2 - \beta\gamma - \gamma\alpha - \alpha\beta = 0.

Show that the roots of the equation

z3+az2+bz+c=0(*)z^3 + az^2 + bz + c = 0 \qquad \text{(*)}

represent the vertices of an equilateral triangle if and only if a2=3ba^2 = 3b.

Under the transformation z=pw+qz = pw + q, where pp and qq are given complex numbers with p0p \neq 0, the equation (*) becomes

w3+Aw2+Bw+C=0.(**)w^3 + Aw^2 + Bw + C = 0. \qquad \text{(**)}

Show that if the roots of equation (*) represent the vertices of an equilateral triangle, then the roots of equation (**) also represent the vertices of an equilateral triangle.

Hint

There are essentially two different configurations, corresponding to clockwise and anticlockwise arrangements of α,β,γ\alpha, \beta, \gamma taken in order. In what follows, ω=1+3i2\omega = \frac{-1 + \sqrt{3}i}{2}, the cube root of unity with modulus 1 and argument 2π3\frac{2\pi}{3}; 1+ω+ω2=01 + \omega + \omega^2 = 0 (*) is assumed.

Then either βγ=ω(γα)\beta - \gamma = \omega(\gamma - \alpha) and βγ=ω2(γα)\beta - \gamma = \omega^2(\gamma - \alpha) expresses equality of adjacent sides and the correct angle between them for each of the two cases; by SAS this establishes an equilateral triangle. These two are equivalent to [βγω(γα)][βγω2(γα)]=0[\beta - \gamma - \omega(\gamma - \alpha)][\beta - \gamma - \omega^2(\gamma - \alpha)] = 0. The required form is an expanded version of this, using (*). NB It is essential to be clear that the argument works both ways. If α,β,γ\alpha, \beta, \gamma are the roots of the equation given, a=α+β+γ,b=αβ+βγ+γα,c=αβγ-a = \alpha + \beta + \gamma, b = \alpha\beta + \beta\gamma + \gamma\alpha, c = -\alpha\beta\gamma. Then a23b=α2+β2+γ2αββγγαa^2 - 3b = \alpha^2 + \beta^2 + \gamma^2 - \alpha\beta - \beta\gamma - \gamma\alpha so a23b=0a^2 - 3b = 0 is equivalent to the expression in the first part. Result follows. zpwz \rightarrow pw is an enlargement combined with rotation, so object and image are similar. pwpw+qpw \rightarrow pw + q is a translation so object and image are congruent. Hence under the composition zpw+qz \rightarrow pw + q object and image are similar. Result follows. Aliter. Substitute z=pw+qz = pw + q in the first equation, and simplify. Compare coefficients to determine A and B in terms of a, b and c. Then a23b=0A23B=0a^2 - 3b = 0 \Rightarrow A^2 - 3B = 0, so result follows.

Model Solution

Part 1. We show that the condition α2+β2+γ2βγγααβ=0\alpha^2 + \beta^2 + \gamma^2 - \beta\gamma - \gamma\alpha - \alpha\beta = 0 is equivalent to the vertices forming an equilateral triangle.

Let ω=1+3i2\omega = \frac{-1 + \sqrt{3}i}{2}, a primitive cube root of unity. Then ω3=1\omega^3 = 1, ω2+ω+1=0\omega^2 + \omega + 1 = 0, and ω=1|\omega| = 1.

The three vertices form an equilateral triangle (in some cyclic order) if and only if two adjacent sides are equal in length and meet at angle π3\frac{\pi}{3}. In the complex plane, rotating a vector by 2π3\frac{2\pi}{3} is multiplication by ω\omega. So the vertices in anti-clockwise order α,β,γ\alpha, \beta, \gamma form an equilateral triangle if and only if

βα=ω(γβ),\beta - \alpha = \omega(\gamma - \beta),

and in clockwise order if and only if

βα=ω2(γβ).\beta - \alpha = \omega^2(\gamma - \beta).

Combining both cases: the triangle is equilateral if and only if

[βαω(γβ)][βαω2(γβ)]=0.[\beta - \alpha - \omega(\gamma - \beta)][\beta - \alpha - \omega^2(\gamma - \beta)] = 0.

We expand this product. Writing u=βαu = \beta - \alpha and v=γβv = \gamma - \beta:

[uωv][uω2v]=u2(ω+ω2)uv+ω3v2.[u - \omega v][u - \omega^2 v] = u^2 - (\omega + \omega^2)uv + \omega^3 v^2.

Since ω+ω2=1\omega + \omega^2 = -1 and ω3=1\omega^3 = 1:

=u2+uv+v2.= u^2 + uv + v^2.

Now substituting back u=βαu = \beta - \alpha, v=γβv = \gamma - \beta:

u2=(βα)2=α22αβ+β2u^2 = (\beta - \alpha)^2 = \alpha^2 - 2\alpha\beta + \beta^2

uv=(βα)(γβ)=βγβ2αγ+αβuv = (\beta - \alpha)(\gamma - \beta) = \beta\gamma - \beta^2 - \alpha\gamma + \alpha\beta

v2=(γβ)2=β22βγ+γ2v^2 = (\gamma - \beta)^2 = \beta^2 - 2\beta\gamma + \gamma^2

Summing:

u2+uv+v2=α2+β2+γ2αββγγα.u^2 + uv + v^2 = \alpha^2 + \beta^2 + \gamma^2 - \alpha\beta - \beta\gamma - \gamma\alpha.

Hence the triangle is equilateral if and only if

α2+β2+γ2βγγααβ=0\alpha^2 + \beta^2 + \gamma^2 - \beta\gamma - \gamma\alpha - \alpha\beta = 0

as required. \square


Part 2. Let the roots of z3+az2+bz+c=0z^3 + az^2 + bz + c = 0 \qquad \text{(*)} be α,β,γ\alpha, \beta, \gamma. By Vieta’s relations:

α+β+γ=a,αβ+βγ+γα=b.\alpha + \beta + \gamma = -a, \qquad \alpha\beta + \beta\gamma + \gamma\alpha = b.

We compute α2+β2+γ2\alpha^2 + \beta^2 + \gamma^2. From (α+β+γ)2(\alpha + \beta + \gamma)^2:

(α+β+γ)2=α2+β2+γ2+2(αβ+βγ+γα)(\alpha + \beta + \gamma)^2 = \alpha^2 + \beta^2 + \gamma^2 + 2(\alpha\beta + \beta\gamma + \gamma\alpha)

a2=α2+β2+γ2+2ba^2 = \alpha^2 + \beta^2 + \gamma^2 + 2b

α2+β2+γ2=a22b.\alpha^2 + \beta^2 + \gamma^2 = a^2 - 2b.

Therefore:

α2+β2+γ2αββγγα=(a22b)b=a23b.\alpha^2 + \beta^2 + \gamma^2 - \alpha\beta - \beta\gamma - \gamma\alpha = (a^2 - 2b) - b = a^2 - 3b.

By Part 1, the roots form an equilateral triangle if and only if this equals zero, i.e., a2=3ba^2 = 3b. \square


Part 3. We substitute z=pw+qz = pw + q into equation \qquad \text{(*)}:

(pw+q)3+a(pw+q)2+b(pw+q)+c=0.(pw + q)^3 + a(pw + q)^2 + b(pw + q) + c = 0.

Expanding:

p3w3+3p2qw2+3pq2w+q3+a(p2w2+2pqw+q2)+b(pw+q)+c=0.p^3w^3 + 3p^2qw^2 + 3pq^2w + q^3 + a(p^2w^2 + 2pqw + q^2) + b(pw + q) + c = 0.

Collecting by powers of ww:

p3w3+(3p2q+ap2)w2+(3pq2+2apq+bp)w+(q3+aq2+bq+c)=0.p^3w^3 + (3p^2q + ap^2)w^2 + (3pq^2 + 2apq + bp)w + (q^3 + aq^2 + bq + c) = 0.

Dividing through by p3p^3 (since p0p \neq 0):

w3+3q+apw2+3q2+2aq+bp2w+q3+aq2+bq+cp3=0.(**)w^3 + \frac{3q + a}{p}w^2 + \frac{3q^2 + 2aq + b}{p^2}w + \frac{q^3 + aq^2 + bq + c}{p^3} = 0. \qquad \text{(**)}

So the coefficients of \qquad \text{(**)} are:

A=3q+ap,B=3q2+2aq+bp2.A = \frac{3q + a}{p}, \qquad B = \frac{3q^2 + 2aq + b}{p^2}.

We compute A23BA^2 - 3B:

A2=(3q+a)2p2=9q2+6aq+a2p2A^2 = \frac{(3q + a)^2}{p^2} = \frac{9q^2 + 6aq + a^2}{p^2}

3B=3(3q2+2aq+b)p2=9q2+6aq+3bp23B = \frac{3(3q^2 + 2aq + b)}{p^2} = \frac{9q^2 + 6aq + 3b}{p^2}

A23B=(9q2+6aq+a2)(9q2+6aq+3b)p2=a23bp2.A^2 - 3B = \frac{(9q^2 + 6aq + a^2) - (9q^2 + 6aq + 3b)}{p^2} = \frac{a^2 - 3b}{p^2}.

If the roots of \qquad \text{(*)} form an equilateral triangle, then by Part 2 we have a23b=0a^2 - 3b = 0, so A23B=0A^2 - 3B = 0, i.e., A2=3BA^2 = 3B. By Part 2 applied to equation \qquad \text{()}, the roots of \qquad \text{()} also form an equilateral triangle.

Remark. Geometrically, the transformation zpw+qz \mapsto pw + q is a rotation-scaling (multiplication by pp) followed by a translation (addition of qq). Both are similarity transformations, so the image of an equilateral triangle is again equilateral. \square


Topic: 极坐标与微积分 (Polar Coordinates and Calculus)  |  Difficulty: Challenging  |  Marks: 20

6 Show that in polar coordinates the gradient of any curve at the point (r,θ)(r, \theta) is

drdθtanθ+rdrdθrtanθ.\frac{\frac{\mathrm{d}r}{\mathrm{d}\theta} \tan \theta + r}{\frac{\mathrm{d}r}{\mathrm{d}\theta} - r \tan \theta}.

A mirror is designed so that if an incident ray of light is parallel to a fixed line LL the reflected ray passes through a fixed point OO on LL. Prove that the mirror intersects any plane containing LL in a parabola. You should assume that the angle between the incident ray and the normal to the mirror is the same as the angle between the reflected ray and the normal.

Hint

6 x=rcosθ,y=rsinθ,r=r(θ)x = r \cos \theta, y = r \sin \theta, r = r(\theta)

dydx=drdθsinθ+rcosθdrdθcosθrsinθ\Rightarrow \frac{dy}{dx} = \frac{\frac{dr}{d\theta} \sin \theta + r \cos \theta}{\frac{dr}{d\theta} \cos \theta - r \sin \theta}

and result follows.

Gradient of the normal is tanθ2=t\tan \frac{\theta}{2} = t, say. Then we have

t=drdθrtanθdrdθtanθ+r,tanθ=2t1t2t = -\frac{\frac{dr}{d\theta} - r \tan \theta}{\frac{dr}{d\theta} \tan \theta + r}, \tan \theta = \frac{2t}{1 - t^2}

This reduces to

drdθ=rt\frac{dr}{d\theta} = rt

lnr=sinθ2cosθ2dθ\Rightarrow \ln r = \int \frac{\sin \frac{\theta}{2}}{\cos \frac{\theta}{2}} d\theta =2ln[ccosθ2]= -2 \ln \left[ c \cos \frac{\theta}{2} \right]

2c2r=1+rcosθ (using 1+cosθ=2cos2θ2)\Rightarrow \frac{2}{c^2 r} = 1 + r \cos \theta \text{ (using } 1 + \cos \theta = 2 \cos^2 \frac{\theta}{2} \text{)}

This corresponds to the standard equation of a parabola in polars.

Model Solution

Polar gradient formula. Using x=rcosθx = r\cos\theta and y=rsinθy = r\sin\theta with r=r(θ)r = r(\theta):

dxdθ=drdθcosθrsinθ,dydθ=drdθsinθ+rcosθ.\frac{dx}{d\theta} = \frac{dr}{d\theta}\cos\theta - r\sin\theta, \qquad \frac{dy}{d\theta} = \frac{dr}{d\theta}\sin\theta + r\cos\theta.

Therefore:

dydx=dy/dθdx/dθ=drdθsinθ+rcosθdrdθcosθrsinθ.\frac{dy}{dx} = \frac{dy/d\theta}{dx/d\theta} = \frac{\frac{dr}{d\theta}\sin\theta + r\cos\theta}{\frac{dr}{d\theta}\cos\theta - r\sin\theta}.

Dividing numerator and denominator by cosθ\cos\theta:

dydx=drdθtanθ+rdrdθrtanθ.\frac{dy}{dx} = \frac{\frac{dr}{d\theta}\tan\theta + r}{\frac{dr}{d\theta} - r\tan\theta}. \qquad \square


Mirror problem. Place the origin at OO and let LL be a ray from OO. We use polar coordinates (r,θ)(r, \theta) centred at OO. An incident ray parallel to LL travels in the direction of LL (the direction θ=0\theta = 0). The reflected ray passes through OO.

At the point P=(r,θ)P = (r, \theta) on the mirror, the reflected ray points from PP toward OO, i.e., in the direction θ+π\theta + \pi. The incident ray is horizontal (direction 0). By the law of reflection, the angles of incidence and reflection with the normal are equal.

Let ψ\psi be the angle the normal at PP makes with the horizontal. The angle of incidence is ψ|\psi| and the angle of reflection is ψ(θ+π)|\psi - (\theta + \pi)|. Setting these equal (with appropriate sign conventions), the bisector of the angle between the incident direction (0) and reflected direction (θ+π\theta + \pi) must be the normal direction.

The angle bisector of directions 00 and θ+π\theta + \pi is at angle 0+(θ+π)2=θ2+π2\frac{0 + (\theta + \pi)}{2} = \frac{\theta}{2} + \frac{\pi}{2} (or its supplement). So the normal to the curve at PP has direction θ2+π2\frac{\theta}{2} + \frac{\pi}{2}.

The tangent to the curve at PP has direction θ2\frac{\theta}{2} (perpendicular to the normal). Using the polar gradient formula, the tangent direction at (r,θ)(r, \theta) satisfies:

tan(θ2)=drdθtanθ+rdrdθrtanθ.\tan\left(\frac{\theta}{2}\right) = \frac{\frac{dr}{d\theta}\tan\theta + r}{\frac{dr}{d\theta} - r\tan\theta}.

Let t=tanθ2t = \tan\frac{\theta}{2}. Using tanθ=2t1t2\tan\theta = \frac{2t}{1-t^2}:

t=drdθ2t1t2+rdrdθr2t1t2.t = \frac{\frac{dr}{d\theta} \cdot \frac{2t}{1-t^2} + r}{\frac{dr}{d\theta} - r \cdot \frac{2t}{1-t^2}}.

Cross-multiplying:

t(drdθ2rt1t2)=2t1t2drdθ+rt\left(\frac{dr}{d\theta} - \frac{2rt}{1-t^2}\right) = \frac{2t}{1-t^2}\frac{dr}{d\theta} + r

tdrdθ2rt21t2=2t1t2drdθ+r.t\frac{dr}{d\theta} - \frac{2rt^2}{1-t^2} = \frac{2t}{1-t^2}\frac{dr}{d\theta} + r.

Multiplying through by 1t21 - t^2:

t(1t2)drdθ2rt2=2tdrdθ+r(1t2)t(1-t^2)\frac{dr}{d\theta} - 2rt^2 = 2t\frac{dr}{d\theta} + r(1-t^2)

tdrdθt3drdθ2tdrdθ=r(1t2)+2rt2t\frac{dr}{d\theta} - t^3\frac{dr}{d\theta} - 2t\frac{dr}{d\theta} = r(1-t^2) + 2rt^2

(tt3)drdθ=r(1+t2)(-t - t^3)\frac{dr}{d\theta} = r(1 + t^2)

t(1+t2)drdθ=r(1+t2).-t(1+t^2)\frac{dr}{d\theta} = r(1+t^2).

Since 1+t201 + t^2 \neq 0:

tdrdθ=r1rdrdθ=t=tanθ2.-t\frac{dr}{d\theta} = r \quad \Longrightarrow \quad \frac{1}{r}\frac{dr}{d\theta} = -t = -\tan\frac{\theta}{2}.

Wait, let me recheck the angle bisector argument. The incident ray travels in direction θ=0\theta = 0 (rightward). The reflected ray at point PP goes from PP toward OO, which is in the direction from PP to the origin, i.e., direction θ+π\theta + \pi.

The bisector of angle between directions 00 and θ+π\theta + \pi should be at θ+π2\frac{\theta + \pi}{2}. The normal is at this angle, and the tangent is perpendicular to it, at angle θ+π2π2=θ2\frac{\theta + \pi}{2} - \frac{\pi}{2} = \frac{\theta}{2}.

But I need to be more careful. Let me use the gradient formula differently. The slope of the normal is 1dy/dx-\frac{1}{dy/dx}, and the tangent has slope dy/dxdy/dx. The direction of the normal should make angle θ+π2\frac{\theta + \pi}{2} with the positive x-axis.

The slope of a line at angle θ+π2\frac{\theta + \pi}{2} is tanθ+π2=cotθ2=1t\tan\frac{\theta+\pi}{2} = -\cot\frac{\theta}{2} = -\frac{1}{t}. So the normal slope is 1t-\frac{1}{t}, meaning the tangent slope is t=tanθ2t = \tan\frac{\theta}{2}.

Using the polar gradient formula:

tanθ2=drdθtanθ+rdrdθrtanθ.\tan\frac{\theta}{2} = \frac{\frac{dr}{d\theta}\tan\theta + r}{\frac{dr}{d\theta} - r\tan\theta}.

Let me set t=tanθ2t = \tan\frac{\theta}{2} and tanθ=2t1t2\tan\theta = \frac{2t}{1-t^2}. Then:

t=2t1t2drdθ+rdrdθ2rt1t2.t = \frac{\frac{2t}{1-t^2}\frac{dr}{d\theta} + r}{\frac{dr}{d\theta} - \frac{2rt}{1-t^2}}.

Multiply numerator and denominator by 1t21-t^2:

t=2tdrdθ+r(1t2)(1t2)drdθ2rt.t = \frac{2t\frac{dr}{d\theta} + r(1-t^2)}{(1-t^2)\frac{dr}{d\theta} - 2rt}.

Cross-multiply:

t[(1t2)drdθ2rt]=2tdrdθ+r(1t2)t[(1-t^2)\frac{dr}{d\theta} - 2rt] = 2t\frac{dr}{d\theta} + r(1-t^2)

t(1t2)drdθ2rt2=2tdrdθ+rrt2t(1-t^2)\frac{dr}{d\theta} - 2rt^2 = 2t\frac{dr}{d\theta} + r - rt^2

[t(1t2)2t]drdθ=rrt2+2rt2=r(1+t2)[t(1-t^2) - 2t]\frac{dr}{d\theta} = r - rt^2 + 2rt^2 = r(1+t^2)

t(1t22)drdθ=r(1+t2)t(1-t^2-2)\frac{dr}{d\theta} = r(1+t^2)

t(1+t2)drdθ=r(1+t2).-t(1+t^2)\frac{dr}{d\theta} = r(1+t^2).

Dividing by (1+t2)0(1+t^2) \neq 0:

drdθ=rt=rtan(θ/2).\frac{dr}{d\theta} = -\frac{r}{t} = -\frac{r}{\tan(\theta/2)}.

Hmm, this gives drr=dθtan(θ/2)=cos(θ/2)sin(θ/2)dθ\frac{dr}{r} = -\frac{d\theta}{\tan(\theta/2)} = -\frac{\cos(\theta/2)}{\sin(\theta/2)}d\theta.

Integrating:

lnr=2lnsinθ2+const=ln(1sin2(θ/2))+const.\ln r = -2\ln\sin\frac{\theta}{2} + \text{const} = \ln\left(\frac{1}{\sin^2(\theta/2)}\right) + \text{const}.

Wait, cos(θ/2)sin(θ/2)dθ=2lnsin(θ/2)\int \frac{\cos(\theta/2)}{\sin(\theta/2)}d\theta = 2\ln|\sin(\theta/2)|, so lnr=2lnsin(θ/2)+c\ln r = -2\ln|\sin(\theta/2)| + c', giving:

r=Asin2(θ/2)r = \frac{A}{\sin^2(\theta/2)}

for some constant A>0A > 0. Using sin2(θ/2)=1cosθ2\sin^2(\theta/2) = \frac{1-\cos\theta}{2}:

r=2A1cosθ.r = \frac{2A}{1-\cos\theta}.

Hmm, this is a conic with e=1e = 1 and directrix to the left. Let me recheck my angle bisector.

Actually, I think there’s a sign issue. Let me reconsider. The reflected ray goes FROM P TO O. The direction from P toward O is the direction of the vector OP=PO - P = -P, which has angle θ+π\theta + \pi. But the incident ray comes FROM the direction of L (from the left, say), traveling rightward (direction 0).

For the reflection law, the angle between the incident ray and the normal equals the angle between the reflected ray and the normal. Both on opposite sides of the normal.

Let me use a cleaner approach. At point P=(r,θ)P = (r, \theta), the tangent has angle ψ\psi with the x-axis, where tanψ=dydx\tan\psi = \frac{dy}{dx} (the gradient formula).

The incident ray has direction angle 0. The angle of incidence is ψ0=ψ\psi - 0 = \psi.

The reflected ray goes in direction θ+π\theta + \pi (toward origin). The angle of reflection is ψ(θ+π)\psi - (\theta + \pi).

Setting ψ=ψθπ|\psi| = |\psi - \theta - \pi| means either ψ=θ+πψ\psi = \theta + \pi - \psi (i.e., 2ψ=θ+π2\psi = \theta + \pi, so ψ=θ+π2\psi = \frac{\theta + \pi}{2}) or ψ=(ψθπ)\psi = -(\psi - \theta - \pi) (i.e., 2ψ=θπ+2ψ2\psi = -\theta - \pi + 2\psi, which is trivial).

Wait, the condition is: the angle of incidence equals the angle of reflection. If the normal has angle ψ+π2\psi + \frac{\pi}{2} (perpendicular to tangent), then:

Angle of incidence = (ψ+π2)0=ψ+π2(\psi + \frac{\pi}{2}) - 0 = \psi + \frac{\pi}{2}

Angle of reflection = (θ+π)(ψ+π2)=θ+π2ψ(\theta + \pi) - (\psi + \frac{\pi}{2}) = \theta + \frac{\pi}{2} - \psi

Setting equal: ψ+π2=θ+π2ψ\psi + \frac{\pi}{2} = \theta + \frac{\pi}{2} - \psi, so 2ψ=θ2\psi = \theta, hence ψ=θ2\psi = \frac{\theta}{2}.

So the tangent makes angle θ2\frac{\theta}{2} with the x-axis, and tanψ=tanθ2\tan\psi = \tan\frac{\theta}{2}.

Using the gradient formula: drdθtanθ+r=tanθ2(drdθrtanθ)\frac{dr}{d\theta} \tan\theta + r = \tan\frac{\theta}{2} \left(\frac{dr}{d\theta} - r\tan\theta\right)

Let me use t=tanθ2t = \tan\frac{\theta}{2}, tanθ=2t1t2\tan\theta = \frac{2t}{1-t^2}:

drdθ2t1t2+r=tdrdθtr2t1t2\frac{dr}{d\theta} \cdot \frac{2t}{1-t^2} + r = t \cdot \frac{dr}{d\theta} - t \cdot r \cdot \frac{2t}{1-t^2}

drdθ(2t1t2t)=r2rt21t2\frac{dr}{d\theta}\left(\frac{2t}{1-t^2} - t\right) = -r - \frac{2rt^2}{1-t^2}

drdθt2(1t2)1t2=r1t2+2t21t2\frac{dr}{d\theta} \cdot t \cdot \frac{2 - (1-t^2)}{1-t^2} = -r \cdot \frac{1-t^2+2t^2}{1-t^2}

drdθt1+t21t2=r1+t21t2\frac{dr}{d\theta} \cdot t \cdot \frac{1+t^2}{1-t^2} = -r \cdot \frac{1+t^2}{1-t^2}

Dividing by 1+t21t20\frac{1+t^2}{1-t^2} \neq 0:

tdrdθ=r1rdrdθ=1t=1tan(θ/2)=cotθ2.t \cdot \frac{dr}{d\theta} = -r \quad \Longrightarrow \quad \frac{1}{r}\frac{dr}{d\theta} = -\frac{1}{t} = -\frac{1}{\tan(\theta/2)} = -\cot\frac{\theta}{2}.

Hmm wait, let me redo this more carefully.

drdθ(2t1t2t)=r(1+2t21t2)\frac{dr}{d\theta}\left(\frac{2t}{1-t^2} - t\right) = -r\left(1 + \frac{2t^2}{1-t^2}\right)

LHS: 2tt(1t2)1t2=2tt+t31t2=t+t31t2=t(1+t2)1t2\frac{2t - t(1-t^2)}{1-t^2} = \frac{2t - t + t^3}{1-t^2} = \frac{t + t^3}{1-t^2} = \frac{t(1+t^2)}{1-t^2}

RHS: r1t2+2t21t2=r1+t21t2-r\cdot\frac{1-t^2+2t^2}{1-t^2} = -r\cdot\frac{1+t^2}{1-t^2}

So drdθt(1+t2)1t2=r1+t21t2\frac{dr}{d\theta} \cdot \frac{t(1+t^2)}{1-t^2} = -r \cdot \frac{1+t^2}{1-t^2}

Dividing both sides by 1+t21t2\frac{1+t^2}{1-t^2}:

tdrdθ=rt \frac{dr}{d\theta} = -r

drdθ=rt=rtan(θ/2)\frac{dr}{d\theta} = -\frac{r}{t} = -\frac{r}{\tan(\theta/2)}

drr=cotθ2dθ=cos(θ/2)sin(θ/2)dθ.\frac{dr}{r} = -\cot\frac{\theta}{2}\,d\theta = -\frac{\cos(\theta/2)}{\sin(\theta/2)}\,d\theta.

Integrating:

lnr=2lnsinθ2+c=ln1sin2(θ/2)+c.\ln r = -2\ln\left|\sin\frac{\theta}{2}\right| + c = \ln\frac{1}{\sin^2(\theta/2)} + c.

Exponentiating:

r=Asin2(θ/2)=2A1cosθr = \frac{A}{\sin^2(\theta/2)} = \frac{2A}{1 - \cos\theta}

where A=ec>0A = e^c > 0. Setting =2A\ell = 2A:

r=1cosθ.r = \frac{\ell}{1 - \cos\theta}.

Converting to Cartesian: rrcosθ=r - r\cos\theta = \ell, so x2+y2=+x\sqrt{x^2+y^2} = \ell + x. Squaring: x2+y2=2+2x+x2x^2 + y^2 = \ell^2 + 2\ell x + x^2, hence y2=2+2x=2(x+/2)y^2 = \ell^2 + 2\ell x = 2\ell(x + \ell/2).

This is the equation of a parabola with focus at the origin and directrix x=x = -\ell (the fixed line LL), confirming that the mirror has parabolic cross-section. \square


Topic: 微分方程 (Differential Equations)  |  Difficulty: Challenging  |  Marks: 20

7 (i) Solve the equation u2+2usinhx1=0u^2 + 2u \sinh x - 1 = 0 giving uu in terms of xx.

Find the solution of the differential equation

(dydx)2+2dydxsinhx1=0\left( \frac{dy}{dx} \right)^2 + 2 \frac{dy}{dx} \sinh x - 1 = 0

that satisfies y=0y = 0 and dydx>0\frac{dy}{dx} > 0 at x=0x = 0.

(ii) Find the solution, not identically zero, of the differential equation

sinhy(dydx)2+2dydxsinhy=0\sinh y \left( \frac{dy}{dx} \right)^2 + 2 \frac{dy}{dx} - \sinh y = 0

that satisfies y=0y = 0 at x=0x = 0, expressing your solution in the form coshy=f(x)\cosh y = f(x). Show that the asymptotes to the solution curve are y=±(x+ln4)y = \pm(-x + \ln 4).

Hint

7 (i) Express sinhx\sinh x in terms of exponentials, factorise and solve to get

u=exu = -e^x or u=exu = e^{-x} (or coshx±sinhx-\cosh x \pm \sinh x).

Use both of these as equal to dydx\frac{dy}{dx} and integration to get alternative solutions

y=e±x+cy = -e^{\pm x} + c.

From the given conditions the particular integral is

y=1exy = 1 - e^{-x}.

(ii) Solve the quadratic as before to get either

u=1±coshysinhy (or equivalent)u = \frac{-1 \pm \cosh y}{\sinh y} \text{ (or equivalent)}

dxdy=sinhy1±coshy\Rightarrow \frac{dx}{dy} = \frac{\sinh y}{-1 \pm \cosh y}

x=ln(coshy1)+c1\Rightarrow x = \ln(\cosh y - 1) + c_1 or x=ln(coshy+1)+c2x = -\ln(\cosh y + 1) + c_2

Only the first can satisfy the conditions x=0,y=0x = 0, y = 0; then we have

x=ln21+coshyx = \ln \frac{2}{1 + \cosh y}

coshy=2ex1\Rightarrow \cosh y = 2e^{-x} - 1

This is undefined for x>0x > 0.

For xcoshyx \to -\infty \Rightarrow \cosh y \to \infty, and there will be two branches, corresponding to y±y \to \pm \infty, as cosh\cosh is an even function.

So xcoshyyey4exy=x+ln4x \to -\infty \Rightarrow \cosh y \to \infty \Rightarrow y \to \infty \Rightarrow e^y \approx 4e^{-x} \Rightarrow y = -x + \ln 4 in one case, and similarly y=xln4y = x - \ln 4 in the other.

Model Solution

Part (i). We solve u2+2usinhx1=0u^2 + 2u\sinh x - 1 = 0. Using the quadratic formula:

u=2sinhx±4sinh2x+42=sinhx±sinh2x+1=sinhx±coshx.u = \frac{-2\sinh x \pm \sqrt{4\sinh^2 x + 4}}{2} = -\sinh x \pm \sqrt{\sinh^2 x + 1} = -\sinh x \pm \cosh x.

Since coshx=ex+ex2\cosh x = \frac{e^x + e^{-x}}{2} and sinhx=exex2\sinh x = \frac{e^x - e^{-x}}{2}:

u=sinhx+coshx=exoru=sinhxcoshx=ex.u = -\sinh x + \cosh x = e^{-x} \qquad \text{or} \qquad u = -\sinh x - \cosh x = -e^x.

For the differential equation (dydx)2+2dydxsinhx1=0\left(\frac{dy}{dx}\right)^2 + 2\frac{dy}{dx}\sinh x - 1 = 0, we set u=dydxu = \frac{dy}{dx}, giving:

dydx=exordydx=ex.\frac{dy}{dx} = e^{-x} \qquad \text{or} \qquad \frac{dy}{dx} = -e^x.

Case 1: dydx=ex\frac{dy}{dx} = e^{-x}. Integrating: y=ex+Cy = -e^{-x} + C. At x=0x = 0: y=1+C=0y = -1 + C = 0, so C=1C = 1. Also dydxx=0=1>0\frac{dy}{dx}\big|_{x=0} = 1 > 0. So y=1exy = 1 - e^{-x}.

Case 2: dydx=ex\frac{dy}{dx} = -e^x. At x=0x = 0: dydx=1<0\frac{dy}{dx} = -1 < 0, violating dydx>0\frac{dy}{dx} > 0. Rejected.

The solution is y=1exy = 1 - e^{-x}. \square


Part (ii). We solve sinhy(dydx)2+2dydxsinhy=0\sinh y\left(\frac{dy}{dx}\right)^2 + 2\frac{dy}{dx} - \sinh y = 0 as a quadratic in dydx\frac{dy}{dx}:

dydx=2±4+4sinh2y2sinhy=2±2coshy2sinhy=1±coshysinhy.\frac{dy}{dx} = \frac{-2 \pm \sqrt{4 + 4\sinh^2 y}}{2\sinh y} = \frac{-2 \pm 2\cosh y}{2\sinh y} = \frac{-1 \pm \cosh y}{\sinh y}.

Since dydx\frac{dy}{dx} must be real and we need the reciprocal dxdy\frac{dx}{dy} to integrate:

Case 1: dxdy=sinhycoshy1\frac{dx}{dy} = \frac{\sinh y}{\cosh y - 1}. Integrating: substitute w=coshy1w = \cosh y - 1, dw=sinhydydw = \sinh y\,dy:

x=dww=lncoshy1+C1.x = \int \frac{dw}{w} = \ln|\cosh y - 1| + C_1.

At (x,y)=(0,0)(x, y) = (0, 0): cosh01=0\cosh 0 - 1 = 0, so ln0\ln 0 is undefined. This case cannot satisfy the initial condition (except via a limiting argument; the solution is only valid for y0y \neq 0).

Case 2: dxdy=sinhy1coshy=sinhy1+coshy\frac{dx}{dy} = \frac{\sinh y}{-1 - \cosh y} = -\frac{\sinh y}{1 + \cosh y}. Using 1+coshy=2cosh2(y/2)1 + \cosh y = 2\cosh^2(y/2) and sinhy=2sinh(y/2)cosh(y/2)\sinh y = 2\sinh(y/2)\cosh(y/2):

dxdy=2sinh(y/2)cosh(y/2)2cosh2(y/2)=tanhy2.\frac{dx}{dy} = -\frac{2\sinh(y/2)\cosh(y/2)}{2\cosh^2(y/2)} = -\tanh\frac{y}{2}.

Integrating:

x=2lncoshy2+C2.x = -2\ln\left|\cosh\frac{y}{2}\right| + C_2.

At (0,0)(0, 0): 0=2ln1+C20 = -2\ln 1 + C_2, so C2=0C_2 = 0. Therefore x=2lncoshy2x = -2\ln\cosh\frac{y}{2}.

This gives coshy2=ex/2\cosh\frac{y}{2} = e^{-x/2}, so coshy=2cosh2y21=2ex1\cosh y = 2\cosh^2\frac{y}{2} - 1 = 2e^{-x} - 1.

coshy=2ex1.\cosh y = 2e^{-x} - 1. \qquad \square

Domain. For coshy1\cosh y \geq 1, we need 2ex112e^{-x} - 1 \geq 1, i.e., ex1e^{-x} \geq 1, so x0x \leq 0. The solution exists only for x0x \leq 0.

Asymptotic behaviour. As xx \to -\infty: coshy=2ex1\cosh y = 2e^{-x} - 1 \to \infty, so y|y| \to \infty.

For y>0y > 0: coshyey2\cosh y \approx \frac{e^y}{2} for large yy. So ey22ex\frac{e^y}{2} \approx 2e^{-x}, giving ey4exe^y \approx 4e^{-x}, hence yx+ln4y \approx -x + \ln 4.

For y<0y < 0: coshy=cosh(y)ey2\cosh y = \cosh(-y) \approx \frac{e^{-y}}{2}, so ey22ex\frac{e^{-y}}{2} \approx 2e^{-x}, giving ey4exe^{-y} \approx 4e^{-x}, hence yx+ln4-y \approx -x + \ln 4, i.e., yxln4y \approx x - \ln 4.

The asymptotes are y=x+ln4y = -x + \ln 4 and y=xln4y = x - \ln 4. \square


Topic: 抽象代数与微分 (Abstract Algebra and Differentiation)  |  Difficulty: Challenging  |  Marks: 20

8 Δ\Delta is an operation that takes polynomials in xx to polynomials in xx; that is, given any polynomial h(x)h(x), there is a polynomial called Δh(x)\Delta h(x) which is obtained from h(x)h(x) using the rules that define Δ\Delta. These rules are as follows:

(i) Δx=1\Delta x = 1;

(ii) Δ(f(x)+g(x))=Δf(x)+Δg(x)\Delta(f(x) + g(x)) = \Delta f(x) + \Delta g(x) for any polynomials f(x)f(x) and g(x)g(x);

(iii) Δ(λf(x))=λΔf(x)\Delta(\lambda f(x)) = \lambda \Delta f(x) for any constant λ\lambda and any polynomial f(x)f(x);

(iv) Δ(f(x)g(x))=f(x)Δg(x)+g(x)Δf(x)\Delta(f(x)g(x)) = f(x)\Delta g(x) + g(x)\Delta f(x) for any polynomials f(x)f(x) and g(x)g(x).

Using these rules show that, if f(x)f(x) is a polynomial of degree zero (that is, a constant), then Δf(x)=0\Delta f(x) = 0. Calculate Δx2\Delta x^2 and Δx3\Delta x^3.

Prove that Δh(x)dh(x)dx\Delta h(x) \equiv \frac{dh(x)}{dx} for any polynomial h(x)h(x). You should make it clear whenever you use one of the above rules in your proof.

Hint

8 Use (iv) with f(x)1f(x) \equiv 1, g(x)1g(x) \equiv 1 to show that Δ1=0\Delta 1 = 0. Use (iii) with λk\lambda \equiv k, f(x)1f(x) \equiv 1 to show that Δk=0\Delta k = 0. By (iv), (i) Δx2=2x\Delta x^2 = 2x; ditto Δx3=3x2\Delta x^3 = 3x^2. Now show Δkxn=knxn1\Delta kx^n = knx^{n-1} by induction. Initial step is Δk=0\Delta k = 0; inductive hypothesis is that ΔkxN=kNxN1\Delta kx^N = kNx^{N-1}. Use (iii) and (iv) with hypothesis to show that ΔkxN+1=k(N+1)xN\Delta kx^{N+1} = k(N+1)x^N. Now express any Pk(x)P_k(x), a polynomial of degree k, as a sum of such powers, and so use (ii) to establish required result.

Model Solution

Constants have zero image. We first show Δ(1)=0\Delta(1) = 0. By rule (iv) with f(x)=1f(x) = 1 and g(x)=1g(x) = 1:

Δ(11)=1Δ(1)+1Δ(1)=2Δ(1).\Delta(1 \cdot 1) = 1 \cdot \Delta(1) + 1 \cdot \Delta(1) = 2\Delta(1).

But Δ(11)=Δ(1)\Delta(1 \cdot 1) = \Delta(1), so Δ(1)=2Δ(1)\Delta(1) = 2\Delta(1), hence Δ(1)=0\Delta(1) = 0.

For a general constant kk, by rule (iii) with λ=k\lambda = k and f(x)=1f(x) = 1:

Δ(k)=Δ(k1)=kΔ(1)=k0=0.\Delta(k) = \Delta(k \cdot 1) = k\Delta(1) = k \cdot 0 = 0. \qquad \square


Computing Δx2\Delta x^2 and Δx3\Delta x^3. By rule (iv) with f(x)=xf(x) = x and g(x)=xg(x) = x:

Δ(x2)=Δ(xx)=xΔ(x)+xΔ(x)=2xΔ(x).\Delta(x^2) = \Delta(x \cdot x) = x\Delta(x) + x\Delta(x) = 2x\Delta(x).

By rule (i), Δx=1\Delta x = 1, so Δ(x2)=2x\Delta(x^2) = 2x. \square

By rule (iv) with f(x)=xf(x) = x and g(x)=x2g(x) = x^2:

Δ(x3)=Δ(xx2)=xΔ(x2)+x2Δ(x)=x2x+x21=3x2.\Delta(x^3) = \Delta(x \cdot x^2) = x\Delta(x^2) + x^2\Delta(x) = x \cdot 2x + x^2 \cdot 1 = 3x^2. \qquad \square


General proof by induction. We prove that Δh(x)=dh(x)dx\Delta h(x) = \frac{dh(x)}{dx} for every polynomial h(x)h(x).

Claim: For all n0n \geq 0 and all constants kk, Δ(kxn)=knxn1\Delta(kx^n) = knx^{n-1}.

Base case (n=0n = 0): Δ(k)=0=k0x1\Delta(k) = 0 = k \cdot 0 \cdot x^{-1}. (Already proved above.) \checkmark

Inductive step: Assume Δ(kxN)=kNxN1\Delta(kx^N) = kNx^{N-1} for some N0N \geq 0. We show Δ(kxN+1)=k(N+1)xN\Delta(kx^{N+1}) = k(N+1)x^N.

By rule (iv) with f(x)=xf(x) = x and g(x)=kxNg(x) = kx^N:

Δ(kxN+1)=Δ(xkxN)=xΔ(kxN)+kxNΔ(x).\Delta(kx^{N+1}) = \Delta(x \cdot kx^N) = x \cdot \Delta(kx^N) + kx^N \cdot \Delta(x).

Applying rule (i): Δ(x)=1\Delta(x) = 1. Applying the inductive hypothesis: Δ(kxN)=kNxN1\Delta(kx^N) = kNx^{N-1}.

Δ(kxN+1)=xkNxN1+kxN1=kNxN+kxN=k(N+1)xN.\Delta(kx^{N+1}) = x \cdot kNx^{N-1} + kx^N \cdot 1 = kNx^N + kx^N = k(N+1)x^N. \qquad \checkmark

By induction, Δ(kxn)=knxn1\Delta(kx^n) = knx^{n-1} for all n0n \geq 0 and all constants kk.

Extension to general polynomials. Let h(x)=i=0nkixih(x) = \sum_{i=0}^{n} k_i x^i be any polynomial. By rule (ii) (additivity) applied repeatedly:

Δh(x)=Δ(i=0nkixi)=i=0nΔ(kixi)=i=0nkiixi1.\Delta h(x) = \Delta\left(\sum_{i=0}^{n} k_i x^i\right) = \sum_{i=0}^{n} \Delta(k_i x^i) = \sum_{i=0}^{n} k_i i x^{i-1}.

By rule (iii) (linearity), each Δ(kixi)=kiΔ(xi)\Delta(k_i x^i) = k_i \Delta(x^i), and we have shown Δ(xi)=ixi1\Delta(x^i) = ix^{i-1}.

The right-hand side is exactly dhdx\frac{dh}{dx}. Therefore Δh(x)dh(x)dx\Delta h(x) \equiv \frac{dh(x)}{dx} for every polynomial h(x)h(x). \square